/* * Jalview - A Sequence Alignment Editor and Viewer ($$Version-Rel$$) * Copyright (C) $$Year-Rel$$ The Jalview Authors * * This file is part of Jalview. * * Jalview is free software: you can redistribute it and/or * modify it under the terms of the GNU General Public License * as published by the Free Software Foundation, either version 3 * of the License, or (at your option) any later version. * * Jalview is distributed in the hope that it will be useful, but * WITHOUT ANY WARRANTY; without even the implied warranty * of MERCHANTABILITY or FITNESS FOR A PARTICULAR * PURPOSE. See the GNU General Public License for more details. * * You should have received a copy of the GNU General Public License * along with Jalview. If not, see . * The Jalview Authors are detailed in the 'AUTHORS' file. */ package jalview.renderer; import java.awt.BasicStroke; import java.awt.Color; import java.awt.Font; import java.awt.FontMetrics; import java.awt.Graphics; import java.awt.Graphics2D; import java.awt.Image; import java.awt.RenderingHints; import java.awt.Stroke; import java.awt.geom.AffineTransform; import java.awt.image.ImageObserver; import java.util.BitSet; import java.util.HashMap; import java.util.Hashtable; import java.util.Map; import org.jfree.graphics2d.svg.SVGGraphics2D; import org.jibble.epsgraphics.EpsGraphics2D; import jalview.analysis.AAFrequency; import jalview.analysis.CodingUtils; import jalview.analysis.Rna; import jalview.analysis.StructureFrequency; import jalview.api.AlignViewportI; import jalview.bin.Cache; import jalview.bin.Console; import jalview.datamodel.AlignmentAnnotation; import jalview.datamodel.Annotation; import jalview.datamodel.ColumnSelection; import jalview.datamodel.HiddenColumns; import jalview.datamodel.ProfilesI; import jalview.renderer.api.AnnotationRendererFactoryI; import jalview.renderer.api.AnnotationRowRendererI; import jalview.schemes.ColourSchemeI; import jalview.schemes.NucleotideColourScheme; import jalview.schemes.ResidueProperties; import jalview.schemes.ZappoColourScheme; import jalview.util.Platform; public class AnnotationRenderer { private static final int UPPER_TO_LOWER = 'a' - 'A'; // 32 private static final int CHAR_A = 'A'; // 65 private static final int CHAR_Z = 'Z'; // 90 /** * flag indicating if timing and redraw parameter info should be output */ private final boolean debugRedraw; private int charWidth, endRes, charHeight; private boolean validCharWidth, hasHiddenColumns; private FontMetrics fm; private final boolean USE_FILL_ROUND_RECT = Platform.isAMacAndNotJS(); boolean av_renderHistogram = true, av_renderProfile = true, av_normaliseProfile = false; ResidueShaderI profcolour = null; private ColumnSelection columnSelection; private HiddenColumns hiddenColumns; private ProfilesI hconsensus; private Hashtable[] complementConsensus; private Hashtable[] hStrucConsensus; private boolean av_ignoreGapsConsensus; private boolean renderingVectors = false; private boolean glyphLineDrawn = false; /** * attributes set from AwtRenderPanelI */ /** * old image used when data is currently being calculated and cannot be * rendered */ private Image fadedImage; /** * panel being rendered into */ private ImageObserver annotationPanel; /** * width of image to render in panel */ private int imgWidth; /** * offset to beginning of visible area */ private int sOffset; /** * offset to end of visible area */ private int visHeight; /** * indicate if the renderer should only render the visible portion of the * annotation given the current view settings */ private boolean useClip = true; /** * master flag indicating if renderer should ever try to clip. not enabled for * jalview 2.8.1 */ private boolean canClip = false; public AnnotationRenderer() { this(false); } /** * Create a new annotation Renderer * * @param debugRedraw * flag indicating if timing and redraw parameter info should be * output */ public AnnotationRenderer(boolean debugRedraw) { this.debugRedraw = debugRedraw; } /** * Remove any references and resources when this object is no longer required */ public void dispose() { hiddenColumns = null; hconsensus = null; complementConsensus = null; hStrucConsensus = null; fadedImage = null; annotationPanel = null; rendererFactoryI = null; } void drawStemAnnot(Graphics g, Annotation[] row_annotations, int lastSSX, int x, int y, int iconOffset, int startRes, int column, boolean validRes, boolean validEnd) { int sCol = (lastSSX / charWidth) + hiddenColumns.visibleToAbsoluteColumn(startRes); int x1 = lastSSX; int x2 = (x * charWidth); char dc = (column == 0 || row_annotations[column - 1] == null) ? ' ' : row_annotations[column - 1].secondaryStructure; boolean diffupstream = sCol == 0 || row_annotations[sCol - 1] == null || dc != row_annotations[sCol - 1].secondaryStructure || !validEnd; boolean diffdownstream = !validRes || !validEnd || row_annotations[column] == null || dc != row_annotations[column].secondaryStructure; if (diffupstream || diffdownstream) { // draw glyphline under arrow drawGlyphLine(g, lastSSX, x, y, iconOffset); } g.setColor(STEM_COLOUR); if (column > 0 && Rna.isClosingParenthesis(dc)) { if (diffupstream) // if (validRes && column>1 && row_annotations[column-2]!=null && // dc.equals(row_annotations[column-2].displayCharacter)) { /* * if new annotation with a closing base pair half of the stem, * display a backward arrow */ fillPolygon(g, new int[] { lastSSX + 5, lastSSX + 5, lastSSX }, new int[] { y + iconOffset + 1, y + 13 + iconOffset, y + 7 + iconOffset }, 3); x1 += 5; } if (diffdownstream) { x2 -= 1; } } else { // display a forward arrow if (diffdownstream) { /* * if annotation ending with an opeing base pair half of the stem, * display a forward arrow */ fillPolygon(g, new int[] { x2 - 6, x2 - 6, x2 - 1 }, new int[] { y + iconOffset + 1, y + 13 + iconOffset, y + 7 + iconOffset }, 3); x2 -= 5; } if (diffupstream) { x1 += 1; } } // draw arrow body unsetAntialias(g); fillRect(g, x1, y + 4 + iconOffset, x2 - x1, 6); } void drawNotCanonicalAnnot(Graphics g, Color nonCanColor, Annotation[] row_annotations, int lastSSX, int x, int y, int iconOffset, int startRes, int column, boolean validRes, boolean validEnd) { // Console.info(nonCanColor); int sCol = (lastSSX / charWidth) + hiddenColumns.visibleToAbsoluteColumn(startRes); int x1 = lastSSX; int x2 = (x * charWidth); String dc = (column == 0 || row_annotations[column - 1] == null) ? "" : row_annotations[column - 1].displayCharacter; boolean diffupstream = sCol == 0 || row_annotations[sCol - 1] == null || !dc.equals(row_annotations[sCol - 1].displayCharacter) || !validEnd; boolean diffdownstream = !validRes || !validEnd || row_annotations[column] == null || !dc.equals(row_annotations[column].displayCharacter); // Console.info("Column "+column+" diff up: // "+diffupstream+" // down:"+diffdownstream); // If a closing base pair half of the stem, display a backward arrow if (diffupstream || diffdownstream) { // draw glyphline under arrow drawGlyphLine(g, lastSSX, x, y, iconOffset); } g.setColor(nonCanColor); if (column > 0 && Rna.isClosingParenthesis(dc)) { if (diffupstream) // if (validRes && column>1 && row_annotations[column-2]!=null && // dc.equals(row_annotations[column-2].displayCharacter)) { fillPolygon(g, new int[] { lastSSX + 5, lastSSX + 5, lastSSX }, new int[] { y + iconOffset + 1, y + 13 + iconOffset, y + 7 + iconOffset }, 3); x1 += 5; } if (diffdownstream) { x2 -= 1; } } else { // display a forward arrow if (diffdownstream) { fillPolygon(g, new int[] { x2 - 6, x2 - 6, x2 - 1 }, new int[] { y + iconOffset + 1, y + 13 + iconOffset, y + 7 + iconOffset }, 3); x2 -= 5; } if (diffupstream) { x1 += 1; } } // draw arrow body unsetAntialias(g); fillRect(g, x1, y + 4 + iconOffset, x2 - x1, 6); } // public void updateFromAnnotationPanel(FontMetrics annotFM, AlignViewportI // av) public void updateFromAwtRenderPanel(AwtRenderPanelI annotPanel, AlignViewportI av) { fm = annotPanel.getFontMetrics(); annotationPanel = annotPanel; fadedImage = annotPanel.getFadedImage(); imgWidth = annotPanel.getFadedImageWidth(); // visible area for rendering int[] bounds = annotPanel.getVisibleVRange(); if (bounds != null) { sOffset = bounds[0]; visHeight = bounds[1]; if (visHeight == 0) { useClip = false; } else { useClip = canClip; } } else { useClip = false; } rendererFactoryI = AnnotationRendererFactory.getRendererFactory(); updateFromAlignViewport(av); } public void updateFromAlignViewport(AlignViewportI av) { charWidth = av.getCharWidth(); endRes = av.getRanges().getEndRes(); charHeight = av.getCharHeight(); hasHiddenColumns = av.hasHiddenColumns(); validCharWidth = av.isValidCharWidth(); av_renderHistogram = av.isShowConsensusHistogram(); av_renderProfile = av.isShowSequenceLogo(); av_normaliseProfile = av.isNormaliseSequenceLogo(); profcolour = av.getResidueShading(); if (profcolour == null || profcolour.getColourScheme() == null) { /* * Use default colour for sequence logo if * the alignment has no colourscheme set * (would like to use user preference but n/a for applet) */ ColourSchemeI col = av.getAlignment().isNucleotide() ? new NucleotideColourScheme() : new ZappoColourScheme(); profcolour = new ResidueShader(col); } columnSelection = av.getColumnSelection(); hiddenColumns = av.getAlignment().getHiddenColumns(); hconsensus = av.getSequenceConsensusHash(); complementConsensus = av.getComplementConsensusHash(); hStrucConsensus = av.getRnaStructureConsensusHash(); av_ignoreGapsConsensus = av.isIgnoreGapsConsensus(); } /** * Returns profile data; the first element is the profile type, the second is * the number of distinct values, the third the total count, and the remainder * depend on the profile type. * * @param aa * @param column * @return */ int[] getProfileFor(AlignmentAnnotation aa, int column) { // TODO : consider refactoring the global alignment calculation // properties/rendering attributes as a global 'alignment group' which holds // all vis settings for the alignment as a whole rather than a subset // if (aa.autoCalculated && (aa.label.startsWith("Consensus") || aa.label.startsWith("cDNA Consensus"))) { boolean forComplement = aa.label.startsWith("cDNA Consensus"); if (aa.groupRef != null && aa.groupRef.consensusData != null && aa.groupRef.isShowSequenceLogo()) { // TODO? group consensus for cDNA complement return AAFrequency.extractProfile( aa.groupRef.consensusData.get(column), aa.groupRef.getIgnoreGapsConsensus()); } // TODO extend annotation row to enable dynamic and static profile data to // be stored if (aa.groupRef == null && aa.sequenceRef == null) { if (forComplement) { return AAFrequency.extractCdnaProfile(complementConsensus[column], av_ignoreGapsConsensus); } else { return AAFrequency.extractProfile(hconsensus.get(column), av_ignoreGapsConsensus); } } } else { if (aa.autoCalculated && aa.label.startsWith("StrucConsensus")) { // TODO implement group structure consensus /* * if (aa.groupRef != null && aa.groupRef.consensusData != null && * aa.groupRef.isShowSequenceLogo()) { //TODO check what happens for * group selections return StructureFrequency.extractProfile( * aa.groupRef.consensusData[column], aa.groupRef * .getIgnoreGapsConsensus()); } */ // TODO extend annotation row to enable dynamic and static profile data // to // be stored if (aa.groupRef == null && aa.sequenceRef == null && hStrucConsensus != null && hStrucConsensus.length > column) { return StructureFrequency.extractProfile(hStrucConsensus[column], av_ignoreGapsConsensus); } } } return null; } boolean rna = false; private AnnotationRendererFactoryI rendererFactoryI; /** * Render the annotation rows associated with an alignment. * * @param annotPanel * container frame * @param av * data and view settings to render * @param g * destination for graphics * @param activeRow * row where a mouse event occured (or -1) * @param startRes * first column that will be drawn * @param endRes * last column that will be drawn * @return true if the fadedImage was used for any alignment annotation rows * currently being calculated */ public boolean drawComponent(AwtRenderPanelI annotPanel, AlignViewportI av, Graphics g, int activeRow, int startRes, int endRes) { if (g instanceof EpsGraphics2D || g instanceof SVGGraphics2D) { this.setVectorRendering(true); } Graphics2D g2d = (Graphics2D) g; long stime = System.currentTimeMillis(); boolean usedFaded = false; // NOTES: // AnnotationPanel needs to implement: ImageObserver, access to // AlignViewport updateFromAwtRenderPanel(annotPanel, av); fm = g.getFontMetrics(); AlignmentAnnotation[] aa = av.getAlignment().getAlignmentAnnotation(); // int temp = 0; if (aa == null) { return false; } int x = 0, y = 0; int column = 0; char lastSS; int lastSSX; int iconOffset = 0; boolean validRes = false; boolean validEnd = false; boolean labelAllCols = false; // boolean centreColLabels; // boolean centreColLabelsDef = av.isCentreColumnLabels(); boolean scaleColLabel = false; final AlignmentAnnotation consensusAnnot = av .getAlignmentConsensusAnnotation(); final AlignmentAnnotation structConsensusAnnot = av .getAlignmentStrucConsensusAnnotation(); final AlignmentAnnotation complementConsensusAnnot = av .getComplementConsensusAnnotation(); BitSet graphGroupDrawn = new BitSet(); int charOffset = 0; // offset for a label // \u03B2 \u03B1 // debug ints int yfrom = 0, f_i = 0, yto = 0, f_to = 0; boolean clipst = false, clipend = false; for (int i = 0; i < aa.length; i++) { AlignmentAnnotation row = aa[i]; boolean renderHistogram = true; boolean renderProfile = false; boolean normaliseProfile = false; boolean isRNA = row.isRNA(); // check if this is a consensus annotation row and set the display // settings appropriately // TODO: generalise this to have render styles for consensus/profile // data if (row.groupRef != null && row == row.groupRef.getConsensus()) { renderHistogram = row.groupRef.isShowConsensusHistogram(); renderProfile = row.groupRef.isShowSequenceLogo(); normaliseProfile = row.groupRef.isNormaliseSequenceLogo(); } else if (row == consensusAnnot || row == structConsensusAnnot || row == complementConsensusAnnot) { renderHistogram = av_renderHistogram; renderProfile = av_renderProfile; normaliseProfile = av_normaliseProfile; } Annotation[] row_annotations = row.annotations; if (!row.visible) { continue; } // centreColLabels = row.centreColLabels || centreColLabelsDef; labelAllCols = row.showAllColLabels; scaleColLabel = row.scaleColLabel; lastSS = ' '; lastSSX = 0; if (!useClip || ((y - charHeight) < visHeight && (y + row.height + charHeight * 2) >= sOffset)) {// if_in_visible_region if (!clipst) { clipst = true; yfrom = y; f_i = i; } yto = y; f_to = i; if (row.graph > 0) { if (row.graphGroup > -1 && graphGroupDrawn.get(row.graphGroup)) { continue; } // this is so that we draw the characters below the graph y += row.height; if (row.hasText) { iconOffset = charHeight - fm.getDescent(); y -= charHeight; } } else if (row.hasText) { iconOffset = charHeight - fm.getDescent(); } else { iconOffset = 0; } if (row.autoCalculated && av.isCalculationInProgress(row)) { y += charHeight; usedFaded = true; g.drawImage(fadedImage, 0, y - row.height, imgWidth, y, 0, y - row.height, imgWidth, y, annotationPanel); g.setColor(Color.black); // g.drawString("Calculating "+aa[i].label+"....",20, y-row.height/2); continue; } /* * else if (annotationPanel.av.updatingConservation && * aa[i].label.equals("Conservation")) { * * y += charHeight; g.drawImage(annotationPanel.fadedImage, 0, y - * row.height, annotationPanel.imgWidth, y, 0, y - row.height, * annotationPanel.imgWidth, y, annotationPanel); * * g.setColor(Color.black); // * g.drawString("Calculating Conservation.....",20, y-row.height/2); * * continue; } else if (annotationPanel.av.updatingConservation && * aa[i].label.equals("Quality")) { * * y += charHeight; g.drawImage(annotationPanel.fadedImage, 0, y - * row.height, annotationPanel.imgWidth, y, 0, y - row.height, * annotationPanel.imgWidth, y, annotationPanel); * g.setColor(Color.black); // / * g.drawString("Calculating Quality....",20, y-row.height/2); * * continue; } */ // first pass sets up state for drawing continuation from left-hand // column // of startRes // flag used for vector rendition this.glyphLineDrawn = false; x = (startRes == 0) ? 0 : -1; while (x < endRes - startRes) { if (hasHiddenColumns) { column = hiddenColumns.visibleToAbsoluteColumn(startRes + x); if (column > row_annotations.length - 1) { break; } } else { column = startRes + x; } if ((row_annotations == null) || (row_annotations.length <= column) || (row_annotations[column] == null)) { validRes = false; } else { validRes = true; } final String displayChar = validRes ? row_annotations[column].displayCharacter : null; if (x > -1) { unsetAntialias(g); if (activeRow == i) { g.setColor(Color.red); if (columnSelection != null) { if (columnSelection.contains(column)) { fillRect(g, x * charWidth, y, charWidth, charHeight); } } } if (row.getInvalidStrucPos() > x) { g.setColor(Color.orange); fillRect(g, x * charWidth, y, charWidth, charHeight); } else if (row.getInvalidStrucPos() == x) { g.setColor(Color.orange.darker()); fillRect(g, x * charWidth, y, charWidth, charHeight); } if (validCharWidth && validRes && displayChar != null && (displayChar.length() > 0)) { // Graphics2D gg = (g); float fmWidth = fm.charsWidth(displayChar.toCharArray(), 0, displayChar.length()); /* * shrink label width to fit in column, if that is * both configured and necessary */ boolean scaledToFit = false; float fmScaling = 1f; if (scaleColLabel && fmWidth > charWidth) { scaledToFit = true; fmScaling = charWidth; fmScaling /= fmWidth; // and update the label's width to reflect the scaling. fmWidth = charWidth; } charOffset = (int) ((charWidth - fmWidth) / 2f); if (row_annotations[column].colour == null) { g2d.setColor(Color.black); } else { g2d.setColor(row_annotations[column].colour); } /* * draw the label, unless it is the same secondary structure * symbol (excluding RNA Helix) as the previous column */ final int xPos = (x * charWidth) + charOffset; final int yPos = y + iconOffset; /* * translate to drawing position _before_ applying any scaling */ g2d.translate(xPos, yPos); if (scaledToFit) { /* * use a scaling transform to make the label narrower * (JalviewJS doesn't have Font.deriveFont(AffineTransform)) */ g2d.transform( AffineTransform.getScaleInstance(fmScaling, 1.0)); } setAntialias(g); if (column == 0 || row.graph > 0) { g2d.drawString(displayChar, 0, 0); } else if (row_annotations[column - 1] == null || (labelAllCols || !displayChar.equals( row_annotations[column - 1].displayCharacter) || (displayChar.length() < 2 && row_annotations[column].secondaryStructure == ' '))) { g2d.drawString(displayChar, 0, 0); } if (scaledToFit) { /* * undo scaling before translating back * (restoring saved transform does NOT work in JS PDFGraphics!) */ g2d.transform(AffineTransform .getScaleInstance(1D / fmScaling, 1.0)); } g2d.translate(-xPos, -yPos); } } if (row.hasIcons) { char ss = validRes ? row_annotations[column].secondaryStructure : '-'; if (ss == '(') { // distinguish between forward/backward base-pairing if (displayChar.indexOf(')') > -1) { ss = ')'; } } if (ss == '[') { if ((displayChar.indexOf(']') > -1)) { ss = ']'; } } if (ss == '{') { // distinguish between forward/backward base-pairing if (displayChar.indexOf('}') > -1) { ss = '}'; } } if (ss == '<') { // distinguish between forward/backward base-pairing if (displayChar.indexOf('<') > -1) { ss = '>'; } } if (isRNA && (ss >= CHAR_A) && (ss <= CHAR_Z)) { // distinguish between forward/backward base-pairing int ssLowerCase = ss + UPPER_TO_LOWER; // TODO would .equals() be safer here? or charAt(0)? if (displayChar.indexOf(ssLowerCase) > -1) { ss = (char) ssLowerCase; } } if (!validRes || (ss != lastSS)) { if (x > 0) { // int nb_annot = x - temp; // Console.info("\t type :"+lastSS+"\t x // :"+x+"\t nbre // annot :"+nb_annot); switch (lastSS) { case '(': // Stem case for RNA secondary structure case ')': // and opposite direction drawStemAnnot(g, row_annotations, lastSSX, x, y, iconOffset, startRes, column, validRes, validEnd); // temp = x; break; case 'H': if (!isRNA) { drawHelixAnnot(g, row_annotations, lastSSX, x, y, iconOffset, startRes, column, validRes, validEnd); break; } // no break if isRNA - falls through to drawNotCanonicalAnnot! case 'E': if (!isRNA) { drawSheetAnnot(g, row_annotations, lastSSX, x, y, iconOffset, startRes, column, validRes, validEnd); break; } // no break if isRNA - fall through to drawNotCanonicalAnnot! case '{': case '}': case '[': case ']': case '>': case '<': case 'A': case 'a': case 'B': case 'b': case 'C': case 'c': case 'D': case 'd': case 'e': case 'F': case 'f': case 'G': case 'g': case 'h': case 'I': case 'i': case 'J': case 'j': case 'K': case 'k': case 'L': case 'l': case 'M': case 'm': case 'N': case 'n': case 'O': case 'o': case 'P': case 'p': case 'Q': case 'q': case 'R': case 'r': case 'S': case 's': case 'T': case 't': case 'U': case 'u': case 'V': case 'v': case 'W': case 'w': case 'X': case 'x': case 'Y': case 'y': case 'Z': case 'z': Color nonCanColor = getNotCanonicalColor(lastSS); drawNotCanonicalAnnot(g, nonCanColor, row_annotations, lastSSX, x, y, iconOffset, startRes, column, validRes, validEnd); // temp = x; break; default: if (isVectorRendering()) { // draw single full width glyphline drawGlyphLine(g, lastSSX, endRes - x, y, iconOffset); // disable more glyph lines this.glyphLineDrawn = true; } else { drawGlyphLine(g, lastSSX, x, y, iconOffset); } break; } } if (validRes) { lastSS = ss; } else { lastSS = ' '; } if (x > -1) { lastSSX = (x * charWidth); } } } column++; x++; } if (column >= row_annotations.length) { column = row_annotations.length - 1; validEnd = false; } else { validEnd = true; } if ((row_annotations == null) || (row_annotations.length <= column) || (row_annotations[column] == null)) { validRes = false; } else { validRes = true; } // x ++; if (row.hasIcons) { switch (lastSS) { case 'H': if (!isRNA) { drawHelixAnnot(g, row_annotations, lastSSX, x, y, iconOffset, startRes, column, validRes, validEnd); break; } // no break if isRNA - fall through to drawNotCanonicalAnnot! case 'E': if (!isRNA) { drawSheetAnnot(g, row_annotations, lastSSX, x, y, iconOffset, startRes, column, validRes, validEnd); break; } // no break if isRNA - fall through to drawNotCanonicalAnnot! case '(': case ')': // Stem case for RNA secondary structure drawStemAnnot(g, row_annotations, lastSSX, x, y, iconOffset, startRes, column, validRes, validEnd); break; case '{': case '}': case '[': case ']': case '>': case '<': case 'A': case 'a': case 'B': case 'b': case 'C': case 'c': case 'D': case 'd': case 'e': case 'F': case 'f': case 'G': case 'g': case 'h': case 'I': case 'i': case 'J': case 'j': case 'K': case 'k': case 'L': case 'l': case 'M': case 'm': case 'N': case 'n': case 'O': case 'o': case 'P': case 'p': case 'Q': case 'q': case 'R': case 'r': case 'T': case 't': case 'U': case 'u': case 'V': case 'v': case 'W': case 'w': case 'X': case 'x': case 'Y': case 'y': case 'Z': case 'z': // Console.info(lastSS); Color nonCanColor = getNotCanonicalColor(lastSS); drawNotCanonicalAnnot(g, nonCanColor, row_annotations, lastSSX, x, y, iconOffset, startRes, column, validRes, validEnd); break; default: if (isVectorRendering()) { // draw single full width glyphline drawGlyphLine(g, lastSSX, endRes - x, y, iconOffset); // disable more glyph lines this.glyphLineDrawn = true; } else { drawGlyphLine(g, lastSSX, x, y, iconOffset); } break; } } if (row.graph > 0 && row.graphHeight > 0) { if (row.graph == AlignmentAnnotation.LINE_GRAPH) { if (row.graphGroup > -1 && !graphGroupDrawn.get(row.graphGroup)) { // TODO: JAL-1291 revise rendering model so the graphGroup map is // computed efficiently for all visible labels float groupmax = -999999, groupmin = 9999999; for (int gg = 0; gg < aa.length; gg++) { if (aa[gg].graphGroup != row.graphGroup) { continue; } if (aa[gg] != row) { aa[gg].visible = false; } if (aa[gg].graphMax > groupmax) { groupmax = aa[gg].graphMax; } if (aa[gg].graphMin < groupmin) { groupmin = aa[gg].graphMin; } } for (int gg = 0; gg < aa.length; gg++) { if (aa[gg].graphGroup == row.graphGroup) { drawLineGraph(g, aa[gg], aa[gg].annotations, startRes, endRes, y, groupmin, groupmax, row.graphHeight); } } graphGroupDrawn.set(row.graphGroup); } else { drawLineGraph(g, row, row_annotations, startRes, endRes, y, row.graphMin, row.graphMax, row.graphHeight); } } else if (row.graph == AlignmentAnnotation.BAR_GRAPH) { drawBarGraph(g, row, row_annotations, startRes, endRes, row.graphMin, row.graphMax, y, renderHistogram, renderProfile, normaliseProfile); } else { AnnotationRowRendererI renderer = rendererFactoryI .getRendererFor(row); if (renderer != null) { renderer.renderRow(g, charWidth, charHeight, hasHiddenColumns, av, hiddenColumns, columnSelection, row, row_annotations, startRes, endRes, row.graphMin, row.graphMax, y); } if (debugRedraw) { if (renderer == null) { System.err .println("No renderer found for " + row.toString()); } else { Console.warn( "rendered with " + renderer.getClass().toString()); } } } } } else { if (clipst && !clipend) { clipend = true; } } // end if_in_visible_region if (row.graph > 0 && row.hasText) { y += charHeight; } if (row.graph == 0) { y += aa[i].height; } } if (debugRedraw) { if (canClip) { if (clipst) { Console.warn("Start clip at : " + yfrom + " (index " + f_i + ")"); } if (clipend) { Console.warn("End clip at : " + yto + " (index " + f_to + ")"); } } ; Console.warn("Annotation Rendering time:" + (System.currentTimeMillis() - stime)); } ; return !usedFaded; } public static final Color GLYPHLINE_COLOR = Color.gray; public static final Color SHEET_COLOUR = Color.green; public static final Color HELIX_COLOUR = Color.red; public static final Color STEM_COLOUR = Color.blue; // private Color sdNOTCANONICAL_COLOUR; void drawGlyphLine(Graphics g, int lastSSX, int x, int y, int iconOffset) { if (glyphLineDrawn) { // if we've drawn a single long glyphline for an export, don't draw the // bits return; } unsetAntialias(g); g.setColor(GLYPHLINE_COLOR); g.fillRect(lastSSX, y + 6 + iconOffset, (x * charWidth) - lastSSX, 2); } void drawSheetAnnot(Graphics g, Annotation[] row, int lastSSX, int x, int y, int iconOffset, int startRes, int column, boolean validRes, boolean validEnd) { if (!validEnd || !validRes || row == null || row[column] == null || row[column].secondaryStructure != 'E') { // draw the glyphline underneath drawGlyphLine(g, lastSSX, x, y, iconOffset); g.setColor(SHEET_COLOUR); fillRect(g, lastSSX, y + 4 + iconOffset, (x * charWidth) - lastSSX - 4, 6); fillPolygon(g, new int[] { (x * charWidth) - 6, (x * charWidth) - 6, (x * charWidth - 1) }, new int[] { y + iconOffset + 1, y + 13 + iconOffset, y + 7 + iconOffset }, 3); } else { g.setColor(SHEET_COLOUR); fillRect(g, lastSSX, y + 4 + iconOffset, (x * charWidth) - lastSSX, 6); } } void drawHelixAnnot(Graphics g, Annotation[] row, int lastSSX, int x, int y, int iconOffset, int startRes, int column, boolean validRes, boolean validEnd) { int sCol = (lastSSX / charWidth) + hiddenColumns.visibleToAbsoluteColumn(startRes); int x1 = lastSSX; int x2 = (x * charWidth); if (USE_FILL_ROUND_RECT || isVectorRendering()) { // draw glyph line behind helix (visible in EPS or SVG output) drawGlyphLine(g, lastSSX, x, y, iconOffset); g.setColor(HELIX_COLOUR); setAntialias(g); int ofs = charWidth / 2; // Off by 1 offset when drawing rects and ovals // to offscreen image on the MAC fillRoundRect(g, lastSSX, y + 3 + iconOffset, x2 - x1 - 1, 8, 8, 8); if (sCol == 0 || row[sCol - 1] == null || row[sCol - 1].secondaryStructure != 'H') { } else { fillRoundRect(g, lastSSX, y + 3 + iconOffset, x2 - x1 - ofs, 8, 0, 0); } if (!validRes || row[column] == null || row[column].secondaryStructure != 'H') { } else { fillRoundRect(g, lastSSX + ofs, y + 3 + iconOffset, x2 - x1 - ofs, 8, 0, 0); } return; } boolean leftEnd = sCol == 0 || row[sCol - 1] == null || row[sCol - 1].secondaryStructure != 'H'; boolean rightEnd = !validRes || row[column] == null || row[column].secondaryStructure != 'H'; if (leftEnd || rightEnd) { drawGlyphLine(g, lastSSX, x, y, iconOffset); } g.setColor(HELIX_COLOUR); if (leftEnd) { fillArc(g, lastSSX, y + 3 + iconOffset, charWidth, 8, 90, 180); x1 += charWidth / 2; } if (rightEnd) { fillArc(g, ((x - 1) * charWidth), y + 3 + iconOffset, charWidth, 8, 270, 180); x2 -= charWidth / 2; } fillRect(g, x1, y + 3 + iconOffset, x2 - x1, 8); } void drawLineGraph(Graphics g, AlignmentAnnotation _aa, Annotation[] aa_annotations, int sRes, int eRes, int y, float min, float max, int graphHeight) { if (sRes > aa_annotations.length) { return; } Stroke roundStroke = new BasicStroke(1, BasicStroke.CAP_ROUND, BasicStroke.JOIN_ROUND); Stroke squareStroke = new BasicStroke(1, BasicStroke.CAP_SQUARE, BasicStroke.JOIN_MITER); Graphics2D g2d = (Graphics2D) g; Stroke prevStroke = g2d.getStroke(); g2d.setStroke(roundStroke); int x = 0; // Adjustment for fastpaint to left if (eRes < endRes) { eRes++; } eRes = Math.min(eRes, aa_annotations.length); int y1 = y, y2 = y; float range = max - min; // //Draw origin if (min < 0) { y2 = y - (int) ((0 - min / range) * graphHeight); } g.setColor(Color.gray); drawLine(g, squareStroke, x * charWidth, y2, (eRes - sRes) * charWidth, y2); if (sRes == 0) { x++; } eRes = Math.min(eRes, aa_annotations.length); int column; int aaMax = aa_annotations.length - 1; while (x <= eRes - sRes) { column = sRes + x; if (hasHiddenColumns) { column = hiddenColumns.visibleToAbsoluteColumn(column); } if (column > aaMax) { break; } if (aa_annotations[column] == null) { x++; continue; } if (aa_annotations[column].colour == null) { g.setColor(Color.black); } else { g.setColor(aa_annotations[column].colour); } boolean previousValueExists = column > 0 && aa_annotations[column - 1] != null; float previousValue = previousValueExists ? aa_annotations[column - 1].value : 0; float thisValue = aa_annotations[column].value; boolean nextValueExists = aa_annotations.length > column + 1 && aa_annotations[column + 1] != null; float nextValue = nextValueExists ? aa_annotations[column + 1].value : 0; // check for standalone value if (!previousValueExists && !nextValueExists) { y2 = y - yValueToPixelHeight(thisValue, min, range, graphHeight); drawLine(g, x * charWidth + charWidth / 4, y2, x * charWidth + 3 * charWidth / 4, y2); x++; continue; } if (!previousValueExists) { x++; continue; } y1 = y - yValueToPixelHeight(previousValue, min, range, graphHeight); y2 = y - yValueToPixelHeight(thisValue, min, range, graphHeight); if (x == 0) { // only draw an initial half-line drawLine(g, x * charWidth, y1 + (y2 - y1) / 2, x * charWidth + charWidth / 2, y2); } else if (x == eRes - sRes) { // this is one past the end to draw -- only draw a half line drawLine(g, (x - 1) * charWidth + charWidth / 2, y1, x * charWidth - 1, y1 + (y2 - y1) / 2); } else { drawLine(g, (x - 1) * charWidth + charWidth / 2, y1, x * charWidth + charWidth / 2, y2); } x++; } if (_aa.threshold != null) { g.setColor(_aa.threshold.colour); Graphics2D g2 = (Graphics2D) g; y2 = (int) (y - ((_aa.threshold.value - min) / range) * graphHeight); drawLine(g, dashedLine(charWidth), 0, y2, (eRes - sRes) * charWidth, y2); } g2d.setStroke(prevStroke); } private static double log2 = Math.log(2); // Cached dashed line Strokes private static Map dashedLineLookup = new HashMap<>(); /** * Returns a dashed line stroke as close to 6-4 pixels as fits within the * charWidth. This allows translations of multiples of charWidth without * disrupting the dashed line. The exact values are 0.6-0.4 proportions of * charWidth for charWidth under 16. For charWidth 16 or over, the number of * dashes doubles as charWidth doubles. * * @param charWidth * @return Stroke with appropriate dashed line fitting exactly within the * charWidth */ private static Stroke dashedLine(int charWidth) { if (!dashedLineLookup.containsKey(charWidth)) { int power2 = charWidth >= 16 ? (int) (Math.log(charWidth) / log2) : 2; float width = ((float) charWidth) / ((float) Math.pow(2, power2 - 2)); float segment1 = width * 0.6f; float segment2 = width - segment1; dashedLineLookup.put(charWidth, new BasicStroke(1, BasicStroke.CAP_BUTT, BasicStroke.JOIN_ROUND, 3f, new float[] { segment1, segment2 }, 0f)); } return dashedLineLookup.get(charWidth); } private static int yValueToPixelHeight(float value, float min, float range, int graphHeight) { return (int) (((value - min) / range) * graphHeight); } @SuppressWarnings("unused") void drawBarGraph(Graphics g, AlignmentAnnotation _aa, Annotation[] aa_annotations, int sRes, int eRes, float min, float max, int y, boolean renderHistogram, boolean renderProfile, boolean normaliseProfile) { if (sRes > aa_annotations.length) { return; } Font ofont = g.getFont(); eRes = Math.min(eRes, aa_annotations.length); int x = 0, y1 = y, y2 = y; float range = max - min; if (min < 0) { y2 = y - (int) ((0 - min / (range)) * _aa.graphHeight); } g.setColor(Color.gray); drawLine(g, x, y2, (eRes - sRes) * charWidth, y2); int column; int aaMax = aa_annotations.length - 1; while (x < eRes - sRes) { column = sRes + x; if (hasHiddenColumns) { column = hiddenColumns.visibleToAbsoluteColumn(column); } if (column > aaMax) { break; } if (aa_annotations[column] == null) { x++; continue; } if (aa_annotations[column].colour == null) { g.setColor(Color.black); } else { g.setColor(aa_annotations[column].colour); } y1 = y - (int) (((aa_annotations[column].value - min) / (range)) * _aa.graphHeight); if (renderHistogram) { if (y1 - y2 > 0) { fillRect(g, x * charWidth, y2, charWidth, y1 - y2); } else { fillRect(g, x * charWidth, y1, charWidth, y2 - y1); } } // draw profile if available if (renderProfile) { /* * {profile type, #values, total count, char1, pct1, char2, pct2...} */ int profl[] = getProfileFor(_aa, column); // just try to draw the logo if profl is not null if (profl != null && profl[2] != 0) { boolean isStructureProfile = profl[0] == AlignmentAnnotation.STRUCTURE_PROFILE; boolean isCdnaProfile = profl[0] == AlignmentAnnotation.CDNA_PROFILE; float ht = normaliseProfile ? y - _aa.graphHeight : y1; final double normaliseFactor = normaliseProfile ? _aa.graphHeight : (y2 - y1); /** * Render a single base for a sequence profile, a base pair for * structure profile, and a triplet for a cdna profile */ char[] dc = new char[isStructureProfile ? 2 : (isCdnaProfile ? 3 : 1)]; // lm is not necessary - we can just use fm - could be off by no more // than 0.5 px // LineMetrics lm = g.getFontMetrics(ofont).getLineMetrics("Q", g); // Console.info(asc + " " + dec + " " + (asc - // lm.getAscent()) // + " " + (dec - lm.getDescent())); double asc = fm.getAscent(); double dec = fm.getDescent(); double fht = fm.getHeight(); double scale = 1f / (normaliseProfile ? profl[2] : 100f); // float ofontHeight = 1f / fm.getAscent();// magnify to fill box /* * Traverse the character(s)/percentage data in the array */ float ht2 = ht; // profl[1] is the number of values in the profile for (int i = 0, c = 3, last = profl[1]; i < last; i++) { String s; if (isStructureProfile) { // todo can we encode a structure pair as an int, like codons? dc[0] = (char) profl[c++]; dc[1] = (char) profl[c++]; s = new String(dc); } else if (isCdnaProfile) { CodingUtils.decodeCodon2(profl[c++], dc); s = new String(dc); } else { dc[0] = (char) profl[c++]; s = new String(dc); } // next profl[] position is profile % for the character(s) int percent = profl[c++]; if (percent == 0) { // failsafe in case a count rounds down to 0% continue; } double newHeight = normaliseFactor * scale * percent; /* * Set character colour as per alignment colour scheme; use the * codon translation if a cDNA profile */ Color colour = null; if (isCdnaProfile) { final String codonTranslation = ResidueProperties .codonTranslate(s); colour = profcolour.findColour(codonTranslation.charAt(0), column, null); } else { colour = profcolour.findColour(dc[0], column, null); } g.setColor(colour == Color.white ? Color.lightGray : colour); double sx = 1f * charWidth / fm.charsWidth(dc, 0, dc.length); double sy = newHeight / asc; double newAsc = asc * sy; double newDec = dec * sy; // it is not necessary to recalculate lm for the new font. // note: lm.getBaselineOffsets()[lm.getBaselineIndex()]) must be 0 // by definition. Was: // int hght = (int) (ht + (newAsc - newDec); // - lm.getBaselineOffsets()[lm.getBaselineIndex()])); if (Platform.isJS()) { /* * SwingJS does not implement font.deriveFont() * so use a scaling transform to draw instead, * this is off by a very small amount */ final int hght = (int) (ht2 + (newAsc - newDec)); Graphics2D gg = (Graphics2D) g; int xShift = (int) Math.round(x * charWidth / sx); int yShift = (int) Math.round(hght / sy); gg.transform(AffineTransform.getScaleInstance(sx, sy)); gg.drawString(s, xShift, yShift); gg.transform( AffineTransform.getScaleInstance(1D / sx, 1D / sy)); ht2 += newHeight; } else /** * Java only * * @j2sIgnore */ { // Java ('normal') method is to scale the font to fit final int hght = (int) (ht + (newAsc - newDec)); Font font = ofont .deriveFont(AffineTransform.getScaleInstance(sx, sy)); g.setFont(font); g.drawChars(dc, 0, dc.length, x * charWidth, hght); g.setFont(ofont); ht += newHeight; } } } } x++; } if (_aa.threshold != null) { g.setColor(_aa.threshold.colour); Stroke s = new BasicStroke(1, BasicStroke.CAP_SQUARE, BasicStroke.JOIN_ROUND, 3f, new float[] { 5f, 3f }, 0f); y2 = (int) (y - ((_aa.threshold.value - min) / range) * _aa.graphHeight); drawLine(g, s, 0, y2, (eRes - sRes) * charWidth, y2); } } // used by overview window public void drawGraph(Graphics g, AlignmentAnnotation _aa, Annotation[] aa_annotations, int width, int y, int sRes, int eRes) { eRes = Math.min(eRes, aa_annotations.length); g.setColor(Color.white); fillRect(g, 0, 0, width, y); g.setColor(new Color(0, 0, 180)); int x = 0, height; for (int j = sRes; j < eRes; j++) { if (aa_annotations[j] != null) { if (aa_annotations[j].colour == null) { g.setColor(Color.black); } else { g.setColor(aa_annotations[j].colour); } height = (int) ((aa_annotations[j].value / _aa.graphMax) * y); if (height > y) { height = y; } fillRect(g, x, y - height, charWidth, height); } x += charWidth; } } Color getNotCanonicalColor(char lastss) { switch (lastss) { case '{': case '}': return new Color(255, 125, 5); case '[': case ']': return new Color(245, 115, 10); case '>': case '<': return new Color(235, 135, 15); case 'A': case 'a': return new Color(225, 105, 20); case 'B': case 'b': return new Color(215, 145, 30); case 'C': case 'c': return new Color(205, 95, 35); case 'D': case 'd': return new Color(195, 155, 45); case 'E': case 'e': return new Color(185, 85, 55); case 'F': case 'f': return new Color(175, 165, 65); case 'G': case 'g': return new Color(170, 75, 75); case 'H': case 'h': return new Color(160, 175, 85); case 'I': case 'i': return new Color(150, 65, 95); case 'J': case 'j': return new Color(140, 185, 105); case 'K': case 'k': return new Color(130, 55, 110); case 'L': case 'l': return new Color(120, 195, 120); case 'M': case 'm': return new Color(110, 45, 130); case 'N': case 'n': return new Color(100, 205, 140); case 'O': case 'o': return new Color(90, 35, 150); case 'P': case 'p': return new Color(85, 215, 160); case 'Q': case 'q': return new Color(75, 25, 170); case 'R': case 'r': return new Color(65, 225, 180); case 'S': case 's': return new Color(55, 15, 185); case 'T': case 't': return new Color(45, 235, 195); case 'U': case 'u': return new Color(35, 5, 205); case 'V': case 'v': return new Color(25, 245, 215); case 'W': case 'w': return new Color(15, 0, 225); case 'X': case 'x': return new Color(10, 255, 235); case 'Y': case 'y': return new Color(5, 150, 245); case 'Z': case 'z': return new Color(0, 80, 255); default: Console.info("This is not a interaction : " + lastss); return null; } } private void fillPolygon(Graphics g, int[] xpoints, int[] ypoints, int n) { setAntialias(g); g.fillPolygon(xpoints, ypoints, n); } /* private void fillRect(Graphics g, int a, int b, int c, int d) { fillRect(g, false, a, b, c, d); }*/ private void fillRect(Graphics g, int a, int b, int c, int d) { unsetAntialias(g); g.fillRect(a, b, c, d); } private void fillRoundRect(Graphics g, int a, int b, int c, int d, int e, int f) { setAntialias(g); g.fillRoundRect(a, b, c, d, e, f); } private void fillArc(Graphics g, int a, int b, int c, int d, int e, int f) { setAntialias(g); g.fillArc(a, b, c, d, e, f); } private void drawLine(Graphics g, Stroke s, int a, int b, int c, int d) { Graphics2D g2d = (Graphics2D) g; Stroke p = g2d.getStroke(); g2d.setStroke(s); drawLine(g, a, b, c, d); g2d.setStroke(p); } private void drawLine(Graphics g, int a, int b, int c, int d) { setAntialias(g); g.drawLine(a, b, c, d); } private void setAntialias(Graphics g) { if (isVectorRendering()) { // no need to antialias vector drawings return; } if (Cache.getDefault("ANTI_ALIAS", true)) { Graphics2D g2d = (Graphics2D) g; g2d.setRenderingHint(RenderingHints.KEY_ANTIALIASING, RenderingHints.VALUE_ANTIALIAS_ON); } } private void unsetAntialias(Graphics g) { if (isVectorRendering()) { // no need to antialias vector drawings return; } Graphics2D g2d = (Graphics2D) g; g2d.setRenderingHint(RenderingHints.KEY_ANTIALIASING, RenderingHints.VALUE_ANTIALIAS_OFF); } public void setVectorRendering(boolean b) { renderingVectors = b; } public boolean isVectorRendering() { return renderingVectors; } }