X-Git-Url: http://source.jalview.org/gitweb/?a=blobdiff_plain;ds=sidebyside;f=src%2Fjalview%2Frenderer%2FAnnotationRenderer.java;h=d943d3932fb4de3f980151e09b09bc4b0c0f82ae;hb=refs%2Fheads%2Ffeature%2FJAL-4274_configurable_bitmap_export_preferences;hp=d951aba819ea80526609d64018fb32aee4bae552;hpb=865a855a4ca87eadb3e5ff284ed32ed307d9c34b;p=jalview.git diff --git a/src/jalview/renderer/AnnotationRenderer.java b/src/jalview/renderer/AnnotationRenderer.java index d951aba..d943d39 100644 --- a/src/jalview/renderer/AnnotationRenderer.java +++ b/src/jalview/renderer/AnnotationRenderer.java @@ -1,31 +1,25 @@ /* - * Jalview - A Sequence Alignment Editor and Viewer (Version 2.8.0b1) - * Copyright (C) 2014 The Jalview Authors + * Jalview - A Sequence Alignment Editor and Viewer ($$Version-Rel$$) + * Copyright (C) $$Year-Rel$$ The Jalview Authors * * This file is part of Jalview. * * Jalview is free software: you can redistribute it and/or * modify it under the terms of the GNU General Public License - * as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version. + * as published by the Free Software Foundation, either version 3 + * of the License, or (at your option) any later version. * * Jalview is distributed in the hope that it will be useful, but * WITHOUT ANY WARRANTY; without even the implied warranty * of MERCHANTABILITY or FITNESS FOR A PARTICULAR * PURPOSE. See the GNU General Public License for more details. * - * You should have received a copy of the GNU General Public License along with Jalview. If not, see . + * You should have received a copy of the GNU General Public License + * along with Jalview. If not, see . * The Jalview Authors are detailed in the 'AUTHORS' file. */ package jalview.renderer; -import jalview.analysis.AAFrequency; -import jalview.analysis.StructureFrequency; -import jalview.api.AlignViewportI; -import jalview.datamodel.AlignmentAnnotation; -import jalview.datamodel.Annotation; -import jalview.datamodel.ColumnSelection; -import jalview.schemes.ColourSchemeI; - import java.awt.BasicStroke; import java.awt.Color; import java.awt.Font; @@ -33,63 +27,183 @@ import java.awt.FontMetrics; import java.awt.Graphics; import java.awt.Graphics2D; import java.awt.Image; -import java.awt.font.LineMetrics; +import java.awt.RenderingHints; +import java.awt.Stroke; import java.awt.geom.AffineTransform; import java.awt.image.ImageObserver; import java.util.BitSet; import java.util.Hashtable; -import com.stevesoft.pat.Regex; +import org.jfree.graphics2d.svg.SVGGraphics2D; +import org.jibble.epsgraphics.EpsGraphics2D; + +import jalview.analysis.AAFrequency; +import jalview.analysis.CodingUtils; +import jalview.analysis.Rna; +import jalview.analysis.StructureFrequency; +import jalview.api.AlignViewportI; +import jalview.bin.Cache; +import jalview.bin.Console; +import jalview.datamodel.AlignmentAnnotation; +import jalview.datamodel.Annotation; +import jalview.datamodel.ColumnSelection; +import jalview.datamodel.HiddenColumns; +import jalview.datamodel.ProfilesI; +import jalview.renderer.api.AnnotationRendererFactoryI; +import jalview.renderer.api.AnnotationRowRendererI; +import jalview.schemes.ColourSchemeI; +import jalview.schemes.NucleotideColourScheme; +import jalview.schemes.ResidueProperties; +import jalview.schemes.ZappoColourScheme; +import jalview.util.Platform; public class AnnotationRenderer { + private static final int UPPER_TO_LOWER = 'a' - 'A'; // 32 + + private static final int CHAR_A = 'A'; // 65 + + private static final int CHAR_Z = 'Z'; // 90 + /** * flag indicating if timing and redraw parameter info should be output */ private final boolean debugRedraw; + private int charWidth, endRes, charHeight; + + private boolean validCharWidth, hasHiddenColumns; + + private FontMetrics fm; + + private final boolean USE_FILL_ROUND_RECT = Platform.isAMacAndNotJS(); + + boolean av_renderHistogram = true, av_renderProfile = true, + av_normaliseProfile = false; + + ResidueShaderI profcolour = null; + + private ColumnSelection columnSelection; + + private HiddenColumns hiddenColumns; + + private ProfilesI hconsensus; + + private Hashtable[] complementConsensus; + + private Hashtable[] hStrucConsensus; + + private boolean av_ignoreGapsConsensus; + + private boolean vectorRendition = false; + + private boolean glyphLineDrawn = false; + + /** + * attributes set from AwtRenderPanelI + */ + /** + * old image used when data is currently being calculated and cannot be + * rendered + */ + private Image fadedImage; + + /** + * panel being rendered into + */ + private ImageObserver annotationPanel; + + /** + * width of image to render in panel + */ + private int imgWidth; + + /** + * offset to beginning of visible area + */ + private int sOffset; + + /** + * offset to end of visible area + */ + private int visHeight; + + /** + * indicate if the renderer should only render the visible portion of the + * annotation given the current view settings + */ + private boolean useClip = true; + + /** + * master flag indicating if renderer should ever try to clip. not enabled for + * jalview 2.8.1 + */ + private boolean canClip = false; + public AnnotationRenderer() { this(false); } + /** * Create a new annotation Renderer - * @param debugRedraw flag indicating if timing and redraw parameter info should be output + * + * @param debugRedraw + * flag indicating if timing and redraw parameter info should be + * output */ public AnnotationRenderer(boolean debugRedraw) { - this.debugRedraw=debugRedraw; + this.debugRedraw = debugRedraw; } - public void drawStemAnnot(Graphics g, Annotation[] row_annotations, - int lastSSX, int x, int y, int iconOffset, int startRes, - int column, boolean validRes, boolean validEnd) + /** + * Remove any references and resources when this object is no longer required + */ + public void dispose() + { + hiddenColumns = null; + hconsensus = null; + complementConsensus = null; + hStrucConsensus = null; + fadedImage = null; + annotationPanel = null; + rendererFactoryI = null; + } + + void drawStemAnnot(Graphics g, Annotation[] row_annotations, int lastSSX, + int x, int y, int iconOffset, int startRes, int column, + boolean validRes, boolean validEnd) { g.setColor(STEM_COLOUR); - int sCol = (lastSSX / charWidth) + startRes; + int sCol = (lastSSX / charWidth) + + hiddenColumns.visibleToAbsoluteColumn(startRes); int x1 = lastSSX; int x2 = (x * charWidth); - Regex closeparen = new Regex("(\\))"); - String dc = (column == 0 || row_annotations[column - 1] == null) ? "" - : row_annotations[column - 1].displayCharacter; + char dc = (column == 0 || row_annotations[column - 1] == null) ? ' ' + : row_annotations[column - 1].secondaryStructure; boolean diffupstream = sCol == 0 || row_annotations[sCol - 1] == null - || !dc.equals(row_annotations[sCol - 1].displayCharacter); + || dc != row_annotations[sCol - 1].secondaryStructure; boolean diffdownstream = !validRes || !validEnd || row_annotations[column] == null - || !dc.equals(row_annotations[column].displayCharacter); - // System.out.println("Column "+column+" diff up: "+diffupstream+" down:"+diffdownstream); - // If a closing base pair half of the stem, display a backward arrow - if (column > 0 && closeparen.search(dc)) + || dc != row_annotations[column].secondaryStructure; + + if (column > 0 && Rna.isClosingParenthesis(dc)) { if (diffupstream) // if (validRes && column>1 && row_annotations[column-2]!=null && // dc.equals(row_annotations[column-2].displayCharacter)) { - g.fillPolygon(new int[] - { lastSSX + 5, lastSSX + 5, lastSSX }, new int[] - { y + iconOffset, y + 14 + iconOffset, y + 8 + iconOffset }, 3); + /* + * if new annotation with a closing base pair half of the stem, + * display a backward arrow + */ + fillPolygon(g, new int[] { lastSSX + 5, lastSSX + 5, lastSSX }, + new int[] + { y + iconOffset, y + 14 + iconOffset, y + 8 + iconOffset }, + 3); x1 += 5; } if (diffdownstream) @@ -102,9 +216,14 @@ public class AnnotationRenderer // display a forward arrow if (diffdownstream) { - g.fillPolygon(new int[] - { x2 - 5, x2 - 5, x2 }, new int[] - { y + iconOffset, y + 14 + iconOffset, y + 8 + iconOffset }, 3); + /* + * if annotation ending with an opeing base pair half of the stem, + * display a forward arrow + */ + fillPolygon(g, new int[] { x2 - 5, x2 - 5, x2 }, + new int[] + { y + iconOffset, y + 14 + iconOffset, y + 8 + iconOffset }, + 3); x2 -= 5; } if (diffupstream) @@ -113,65 +232,81 @@ public class AnnotationRenderer } } // draw arrow body - g.fillRect(x1, y + 4 + iconOffset, x2 - x1, 7); + fillRect(g, x1, y + 4 + iconOffset, x2 - x1, 7); } - private int charWidth, endRes, charHeight; - - private boolean validCharWidth, hasHiddenColumns; - - private FontMetrics fm; - - private final boolean MAC = new jalview.util.Platform().isAMac(); - - boolean av_renderHistogram = true, av_renderProfile = true, - av_normaliseProfile = false; - - ColourSchemeI profcolour = null; - - private ColumnSelection columnSelection; + void drawNotCanonicalAnnot(Graphics g, Color nonCanColor, + Annotation[] row_annotations, int lastSSX, int x, int y, + int iconOffset, int startRes, int column, boolean validRes, + boolean validEnd) + { + // Console.info(nonCanColor); - private Hashtable[] hconsensus; + int sCol = (lastSSX / charWidth) + + hiddenColumns.visibleToAbsoluteColumn(startRes); + int x1 = lastSSX; + int x2 = (x * charWidth); - private Hashtable[] hStrucConsensus; + String dc = (column == 0 || row_annotations[column - 1] == null) ? "" + : row_annotations[column - 1].displayCharacter; - private boolean av_ignoreGapsConsensus; + boolean diffupstream = sCol == 0 || row_annotations[sCol - 1] == null + || !dc.equals(row_annotations[sCol - 1].displayCharacter); + boolean diffdownstream = !validRes || !validEnd + || row_annotations[column] == null + || !dc.equals(row_annotations[column].displayCharacter); + // Console.info("Column "+column+" diff up: + // "+diffupstream+" + // down:"+diffdownstream); + // If a closing base pair half of the stem, display a backward arrow + if (diffupstream || diffdownstream) + { + // draw glyphline under arrow + drawGlyphLine(g, lastSSX, x, y, iconOffset); + } + g.setColor(nonCanColor); + if (column > 0 && Rna.isClosingParenthesis(dc)) + { - /** - * attributes set from AwtRenderPanelI - */ - /** - * old image used when data is currently being calculated and cannot be - * rendered - */ - private Image fadedImage; + if (diffupstream) + // if (validRes && column>1 && row_annotations[column-2]!=null && + // dc.equals(row_annotations[column-2].displayCharacter)) + { + fillPolygon(g, new int[] { lastSSX + 5, lastSSX + 5, lastSSX }, + new int[] + { y + iconOffset + 1, y + 13 + iconOffset, + y + 7 + iconOffset }, + 3); + x1 += 5; + } + if (diffdownstream) + { + x2 -= 1; + } + } + else + { - /** - * panel being rendered into - */ - private ImageObserver annotationPanel; + // display a forward arrow + if (diffdownstream) + { + fillPolygon(g, new int[] { x2 - 6, x2 - 6, x2 - 1 }, + new int[] + { y + iconOffset + 1, y + 13 + iconOffset, + y + 7 + iconOffset }, + 3); + x2 -= 5; + } + if (diffupstream) + { + x1 += 1; + } + } + // draw arrow body + unsetAntialias(g); + fillRect(g, x1, y + 4 + iconOffset, x2 - x1, 6); + } - /** - * width of image to render in panel - */ - private int imgWidth; - /** - * offset to beginning of visible area - */ - private int sOffset; - /** - * offset to end of visible area - */ - private int visHeight; - /** - * indicate if the renderer should only render the visible portion of the annotation given the current view settings - */ - private boolean useClip=true; - /** - * master flag indicating if renderer should ever try to clip. not enabled for jalview 2.8.1 - */ - private boolean canClip=false; - // public void updateFromAnnotationPanel(FontMetrics annotFM, AlignViewportI // av) public void updateFromAwtRenderPanel(AwtRenderPanelI annotPanel, @@ -182,69 +317,101 @@ public class AnnotationRenderer fadedImage = annotPanel.getFadedImage(); imgWidth = annotPanel.getFadedImageWidth(); // visible area for rendering - int[] bounds=annotPanel.getVisibleVRange(); - if (bounds!=null) + int[] bounds = annotPanel.getVisibleVRange(); + if (bounds != null) { sOffset = bounds[0]; visHeight = bounds[1]; - if (visHeight==0) + if (visHeight == 0) { - useClip=false; - } else { - useClip=canClip; + useClip = false; } - } else { - useClip=false; + else + { + useClip = canClip; + } + } + else + { + useClip = false; } + rendererFactoryI = AnnotationRendererFactory.getRendererFactory(); updateFromAlignViewport(av); } public void updateFromAlignViewport(AlignViewportI av) { charWidth = av.getCharWidth(); - endRes = av.getEndRes(); + endRes = av.getRanges().getEndRes(); charHeight = av.getCharHeight(); hasHiddenColumns = av.hasHiddenColumns(); validCharWidth = av.isValidCharWidth(); av_renderHistogram = av.isShowConsensusHistogram(); av_renderProfile = av.isShowSequenceLogo(); av_normaliseProfile = av.isNormaliseSequenceLogo(); - profcolour = av.getGlobalColourScheme(); - if (profcolour == null) + profcolour = av.getResidueShading(); + if (profcolour == null || profcolour.getColourScheme() == null) { - // Set the default colour for sequence logo if the alignnent has no - // colourscheme set - profcolour = av.getAlignment().isNucleotide() ? new jalview.schemes.NucleotideColourScheme() - : new jalview.schemes.ZappoColourScheme(); + /* + * Use default colour for sequence logo if + * the alignment has no colourscheme set + * (would like to use user preference but n/a for applet) + */ + ColourSchemeI col = av.getAlignment().isNucleotide() + ? new NucleotideColourScheme() + : new ZappoColourScheme(); + profcolour = new ResidueShader(col); } columnSelection = av.getColumnSelection(); - hconsensus = av.getSequenceConsensusHash();// hconsensus; - hStrucConsensus = av.getRnaStructureConsensusHash(); // hStrucConsensus; - av_ignoreGapsConsensus = av.getIgnoreGapsConsensus(); + hiddenColumns = av.getAlignment().getHiddenColumns(); + hconsensus = av.getSequenceConsensusHash(); + complementConsensus = av.getComplementConsensusHash(); + hStrucConsensus = av.getRnaStructureConsensusHash(); + av_ignoreGapsConsensus = av.isIgnoreGapsConsensus(); } - public int[] getProfileFor(AlignmentAnnotation aa, int column) + /** + * Returns profile data; the first element is the profile type, the second is + * the number of distinct values, the third the total count, and the remainder + * depend on the profile type. + * + * @param aa + * @param column + * @return + */ + int[] getProfileFor(AlignmentAnnotation aa, int column) { // TODO : consider refactoring the global alignment calculation // properties/rendering attributes as a global 'alignment group' which holds // all vis settings for the alignment as a whole rather than a subset // - if (aa.autoCalculated && aa.label.startsWith("Consensus")) + if (aa.autoCalculated && (aa.label.startsWith("Consensus") + || aa.label.startsWith("cDNA Consensus"))) { + boolean forComplement = aa.label.startsWith("cDNA Consensus"); if (aa.groupRef != null && aa.groupRef.consensusData != null && aa.groupRef.isShowSequenceLogo()) { + // TODO? group consensus for cDNA complement return AAFrequency.extractProfile( - aa.groupRef.consensusData[column], + aa.groupRef.consensusData.get(column), aa.groupRef.getIgnoreGapsConsensus()); } // TODO extend annotation row to enable dynamic and static profile data to // be stored if (aa.groupRef == null && aa.sequenceRef == null) { - return AAFrequency.extractProfile(hconsensus[column], - av_ignoreGapsConsensus); + if (forComplement) + { + return AAFrequency.extractCdnaProfile(complementConsensus[column], + av_ignoreGapsConsensus); + } + else + { + return AAFrequency.extractProfile(hconsensus.get(column), + av_ignoreGapsConsensus); + } } } else @@ -274,6 +441,10 @@ public class AnnotationRenderer return null; } + boolean rna = false; + + private AnnotationRendererFactoryI rendererFactoryI; + /** * Render the annotation rows associated with an alignment. * @@ -296,7 +467,13 @@ public class AnnotationRenderer AlignViewportI av, Graphics g, int activeRow, int startRes, int endRes) { - long stime=System.currentTimeMillis(); + if (g instanceof EpsGraphics2D || g instanceof SVGGraphics2D) + { + this.setVectorRendition(true); + } + Graphics2D g2d = (Graphics2D) g; + + long stime = System.currentTimeMillis(); boolean usedFaded = false; // NOTES: // AnnotationPanel needs to implement: ImageObserver, access to @@ -304,7 +481,8 @@ public class AnnotationRenderer updateFromAwtRenderPanel(annotPanel, av); fm = g.getFontMetrics(); AlignmentAnnotation[] aa = av.getAlignment().getAlignmentAnnotation(); - if (aa==null) + // int temp = 0; + if (aa == null) { return false; } @@ -316,141 +494,463 @@ public class AnnotationRenderer boolean validRes = false; boolean validEnd = false; boolean labelAllCols = false; - boolean centreColLabels, centreColLabelsDef = av - .getCentreColumnLabels(); + // boolean centreColLabels; + // boolean centreColLabelsDef = av.isCentreColumnLabels(); boolean scaleColLabel = false; - AlignmentAnnotation consensusAnnot=av.getAlignmentConsensusAnnotation(),structConsensusAnnot=av.getAlignmentStrucConsensusAnnotation(); - boolean renderHistogram = true, renderProfile = true, normaliseProfile = false; + final AlignmentAnnotation consensusAnnot = av + .getAlignmentConsensusAnnotation(); + final AlignmentAnnotation structConsensusAnnot = av + .getAlignmentStrucConsensusAnnotation(); + final AlignmentAnnotation complementConsensusAnnot = av + .getComplementConsensusAnnotation(); BitSet graphGroupDrawn = new BitSet(); int charOffset = 0; // offset for a label - float fmWidth, fmScaling = 1f; // scaling for a label to fit it into a - // column. - Font ofont = g.getFont(); // \u03B2 \u03B1 // debug ints - int yfrom=0,f_i=0,yto=0,f_to=0; - boolean clipst=false,clipend=false; + int yfrom = 0, f_i = 0, yto = 0, f_to = 0; + boolean clipst = false, clipend = false; for (int i = 0; i < aa.length; i++) { AlignmentAnnotation row = aa[i]; + boolean renderHistogram = true; + boolean renderProfile = false; + boolean normaliseProfile = false; + boolean isRNA = row.isRNA(); + + // check if this is a consensus annotation row and set the display + // settings appropriately + // TODO: generalise this to have render styles for consensus/profile + // data + if (row.groupRef != null && row == row.groupRef.getConsensus()) { - // check if this is a consensus annotation row and set the display settings appropriately - // TODO: generalise this to have render styles for consensus/profile - // data - if (row.groupRef != null && row == row.groupRef.getConsensus()) - { - renderHistogram = row.groupRef.isShowConsensusHistogram(); - renderProfile = row.groupRef.isShowSequenceLogo(); - normaliseProfile = row.groupRef.isNormaliseSequenceLogo(); - } - else if (row == consensusAnnot || row == structConsensusAnnot) - { - renderHistogram = av_renderHistogram; - renderProfile = av_renderProfile; - normaliseProfile = av_normaliseProfile; - } else { - renderHistogram = true; - // don't need to set render/normaliseProfile since they are not currently used in any other annotation track renderer - } + renderHistogram = row.groupRef.isShowConsensusHistogram(); + renderProfile = row.groupRef.isShowSequenceLogo(); + normaliseProfile = row.groupRef.isNormaliseSequenceLogo(); + } + else if (row == consensusAnnot || row == structConsensusAnnot + || row == complementConsensusAnnot) + { + renderHistogram = av_renderHistogram; + renderProfile = av_renderProfile; + normaliseProfile = av_normaliseProfile; } + Annotation[] row_annotations = row.annotations; if (!row.visible) { continue; } - centreColLabels = row.centreColLabels || centreColLabelsDef; + // centreColLabels = row.centreColLabels || centreColLabelsDef; labelAllCols = row.showAllColLabels; scaleColLabel = row.scaleColLabel; lastSS = ' '; lastSSX = 0; - - if (!useClip || ((y-charHeight)=sOffset)) + + if (!useClip || ((y - charHeight) < visHeight + && (y + row.height + charHeight * 2) >= sOffset)) {// if_in_visible_region if (!clipst) { - clipst=true; - yfrom=y; - f_i=i; + clipst = true; + yfrom = y; + f_i = i; } yto = y; - f_to=i; - if (row.graph > 0) - { - if (row.graphGroup > -1 && graphGroupDrawn.get(row.graphGroup)) { - continue; - } + f_to = i; + if (row.graph > 0) + { + if (row.graphGroup > -1 && graphGroupDrawn.get(row.graphGroup)) + { + continue; + } - // this is so that we draw the characters below the graph - y += row.height; + // this is so that we draw the characters below the graph + y += row.height; - if (row.hasText) + if (row.hasText) + { + iconOffset = charHeight - fm.getDescent(); + y -= charHeight; + } + } + else if (row.hasText) { iconOffset = charHeight - fm.getDescent(); - y -= charHeight; + + } + else + { + iconOffset = 0; } - } - else if (row.hasText) - { - iconOffset = charHeight - fm.getDescent(); - } - else - { - iconOffset = 0; - } + if (row.autoCalculated && av.isCalculationInProgress(row)) + { + y += charHeight; + usedFaded = true; + g.drawImage(fadedImage, 0, y - row.height, imgWidth, y, 0, + y - row.height, imgWidth, y, annotationPanel); + g.setColor(Color.black); + // g.drawString("Calculating "+aa[i].label+"....",20, y-row.height/2); - if (row.autoCalculated && av.isCalculationInProgress(row)) - { - y += charHeight; - usedFaded = true; - g.drawImage(fadedImage, 0, y - row.height, imgWidth, y, 0, y - - row.height, imgWidth, y, annotationPanel); - g.setColor(Color.black); - // g.drawString("Calculating "+aa[i].label+"....",20, y-row.height/2); + continue; + } - continue; - } + /* + * else if (annotationPanel.av.updatingConservation && + * aa[i].label.equals("Conservation")) { + * + * y += charHeight; g.drawImage(annotationPanel.fadedImage, 0, y - + * row.height, annotationPanel.imgWidth, y, 0, y - row.height, + * annotationPanel.imgWidth, y, annotationPanel); + * + * g.setColor(Color.black); // + * g.drawString("Calculating Conservation.....",20, y-row.height/2); + * + * continue; } else if (annotationPanel.av.updatingConservation && + * aa[i].label.equals("Quality")) { + * + * y += charHeight; g.drawImage(annotationPanel.fadedImage, 0, y - + * row.height, annotationPanel.imgWidth, y, 0, y - row.height, + * annotationPanel.imgWidth, y, annotationPanel); + * g.setColor(Color.black); // / + * g.drawString("Calculating Quality....",20, y-row.height/2); + * + * continue; } + */ - /* - * else if (annotationPanel.av.updatingConservation && - * aa[i].label.equals("Conservation")) { - * - * y += charHeight; g.drawImage(annotationPanel.fadedImage, 0, y - - * row.height, annotationPanel.imgWidth, y, 0, y - row.height, - * annotationPanel.imgWidth, y, annotationPanel); - * - * g.setColor(Color.black); // - * g.drawString("Calculating Conservation.....",20, y-row.height/2); - * - * continue; } else if (annotationPanel.av.updatingConservation && - * aa[i].label.equals("Quality")) { - * - * y += charHeight; g.drawImage(annotationPanel.fadedImage, 0, y - - * row.height, annotationPanel.imgWidth, y, 0, y - row.height, - * annotationPanel.imgWidth, y, annotationPanel); g.setColor(Color.black); - * // / g.drawString("Calculating Quality....",20, y-row.height/2); - * - * continue; } - */ - // first pass sets up state for drawing continuation from left-hand column - // of startRes - x = (startRes == 0) ? 0 : -1; - while (x < endRes - startRes) - { - if (hasHiddenColumns) + // first pass sets up state for drawing continuation from left-hand + // column + // of startRes + + // flag used for vector rendition + this.glyphLineDrawn = false; + x = (startRes == 0) ? 0 : -1; + while (x < endRes - startRes) { - column = columnSelection.adjustForHiddenColumns(startRes + x); - if (column > row_annotations.length - 1) + if (hasHiddenColumns) { - break; + column = hiddenColumns.visibleToAbsoluteColumn(startRes + x); + if (column > row_annotations.length - 1) + { + break; + } + } + else + { + column = startRes + x; + } + + if ((row_annotations == null) + || (row_annotations.length <= column) + || (row_annotations[column] == null)) + { + validRes = false; + } + else + { + validRes = true; + } + final String displayChar = validRes + ? row_annotations[column].displayCharacter + : null; + if (x > -1) + { + unsetAntialias(g); + if (activeRow == i) + { + g.setColor(Color.red); + + if (columnSelection != null) + { + if (columnSelection.contains(column)) + { + fillRect(g, x * charWidth, y, charWidth, charHeight); + } + } + } + if (row.getInvalidStrucPos() > x) + { + g.setColor(Color.orange); + fillRect(g, x * charWidth, y, charWidth, charHeight); + } + else if (row.getInvalidStrucPos() == x) + { + g.setColor(Color.orange.darker()); + fillRect(g, x * charWidth, y, charWidth, charHeight); + } + if (validCharWidth && validRes && displayChar != null + && (displayChar.length() > 0)) + { + // Graphics2D gg = (g); + float fmWidth = fm.charsWidth(displayChar.toCharArray(), 0, + displayChar.length()); + + /* + * shrink label width to fit in column, if that is + * both configured and necessary + */ + boolean scaledToFit = false; + float fmScaling = 1f; + if (scaleColLabel && fmWidth > charWidth) + { + scaledToFit = true; + fmScaling = charWidth; + fmScaling /= fmWidth; + // and update the label's width to reflect the scaling. + fmWidth = charWidth; + } + + charOffset = (int) ((charWidth - fmWidth) / 2f); + + if (row_annotations[column].colour == null) + { + g2d.setColor(Color.black); + } + else + { + g2d.setColor(row_annotations[column].colour); + } + + /* + * draw the label, unless it is the same secondary structure + * symbol (excluding RNA Helix) as the previous column + */ + final int xPos = (x * charWidth) + charOffset; + final int yPos = y + iconOffset; + + /* + * translate to drawing position _before_ applying any scaling + */ + g2d.translate(xPos, yPos); + if (scaledToFit) + { + /* + * use a scaling transform to make the label narrower + * (JalviewJS doesn't have Font.deriveFont(AffineTransform)) + */ + g2d.transform( + AffineTransform.getScaleInstance(fmScaling, 1.0)); + } + setAntialias(g); + if (column == 0 || row.graph > 0) + { + g2d.drawString(displayChar, 0, 0); + } + else if (row_annotations[column - 1] == null || (labelAllCols + || !displayChar.equals( + row_annotations[column - 1].displayCharacter) + || (displayChar.length() < 2 + && row_annotations[column].secondaryStructure == ' '))) + { + g2d.drawString(displayChar, 0, 0); + } + if (scaledToFit) + { + /* + * undo scaling before translating back + * (restoring saved transform does NOT work in JS PDFGraphics!) + */ + g2d.transform(AffineTransform + .getScaleInstance(1D / fmScaling, 1.0)); + } + g2d.translate(-xPos, -yPos); + } } + if (row.hasIcons) + { + char ss = validRes ? row_annotations[column].secondaryStructure + : '-'; + + if (ss == '(') + { + // distinguish between forward/backward base-pairing + if (displayChar.indexOf(')') > -1) + { + + ss = ')'; + + } + } + if (ss == '[') + { + if ((displayChar.indexOf(']') > -1)) + { + ss = ']'; + + } + } + if (ss == '{') + { + // distinguish between forward/backward base-pairing + if (displayChar.indexOf('}') > -1) + { + ss = '}'; + + } + } + if (ss == '<') + { + // distinguish between forward/backward base-pairing + if (displayChar.indexOf('<') > -1) + { + ss = '>'; + + } + } + if (isRNA && (ss >= CHAR_A) && (ss <= CHAR_Z)) + { + // distinguish between forward/backward base-pairing + int ssLowerCase = ss + UPPER_TO_LOWER; + // TODO would .equals() be safer here? or charAt(0)? + if (displayChar.indexOf(ssLowerCase) > -1) + { + ss = (char) ssLowerCase; + } + } + + if (!validRes || (ss != lastSS)) + { + + if (x > -1) + { + + // int nb_annot = x - temp; + // Console.info("\t type :"+lastSS+"\t x + // :"+x+"\t nbre + // annot :"+nb_annot); + switch (lastSS) + { + case '(': // Stem case for RNA secondary structure + case ')': // and opposite direction + drawStemAnnot(g, row_annotations, lastSSX, x, y, + iconOffset, startRes, column, validRes, validEnd); + // temp = x; + break; + + case 'H': + if (!isRNA) + { + drawHelixAnnot(g, row_annotations, lastSSX, x, y, + iconOffset, startRes, column, validRes, + validEnd); + break; + } + // no break if isRNA - falls through to drawNotCanonicalAnnot! + case 'E': + if (!isRNA) + { + drawSheetAnnot(g, row_annotations, lastSSX, x, y, + iconOffset, startRes, column, validRes, + validEnd); + break; + } + // no break if isRNA - fall through to drawNotCanonicalAnnot! + + case '{': + case '}': + case '[': + case ']': + case '>': + case '<': + case 'A': + case 'a': + case 'B': + case 'b': + case 'C': + case 'c': + case 'D': + case 'd': + case 'e': + case 'F': + case 'f': + case 'G': + case 'g': + case 'h': + case 'I': + case 'i': + case 'J': + case 'j': + case 'K': + case 'k': + case 'L': + case 'l': + case 'M': + case 'm': + case 'N': + case 'n': + case 'O': + case 'o': + case 'P': + case 'p': + case 'Q': + case 'q': + case 'R': + case 'r': + case 'S': + case 's': + case 'T': + case 't': + case 'U': + case 'u': + case 'V': + case 'v': + case 'W': + case 'w': + case 'X': + case 'x': + case 'Y': + case 'y': + case 'Z': + case 'z': + + Color nonCanColor = getNotCanonicalColor(lastSS); + drawNotCanonicalAnnot(g, nonCanColor, row_annotations, + lastSSX, x, y, iconOffset, startRes, column, + validRes, validEnd); + // temp = x; + break; + default: + if (isVectorRendition()) + { + // draw single full width glyphline + drawGlyphLine(g, lastSSX, endRes - x, y, iconOffset); + // disable more glyph lines + this.glyphLineDrawn = true; + } + else + { + drawGlyphLine(g, lastSSX, x, y, iconOffset); + } + break; + } + } + if (validRes) + { + lastSS = ss; + } + else + { + lastSS = ' '; + } + if (x > -1) + { + lastSSX = (x * charWidth); + } + } + } + column++; + x++; + } + if (column >= row_annotations.length) + { + column = row_annotations.length - 1; + validEnd = false; } else { - column = startRes + x; + validEnd = true; } - if ((row_annotations == null) || (row_annotations.length <= column) || (row_annotations[column] == null)) { @@ -460,252 +960,201 @@ public class AnnotationRenderer { validRes = true; } - if (x > -1) + // x ++; + + if (row.hasIcons) { - if (activeRow == i) + switch (lastSS) { - g.setColor(Color.red); - if (columnSelection != null) + case 'H': + if (!isRNA) { - for (int n = 0; n < columnSelection.size(); n++) - { - int v = columnSelection.columnAt(n); - - if (v == column) - { - g.fillRect(x * charWidth, y, charWidth, charHeight); - } - } + drawHelixAnnot(g, row_annotations, lastSSX, x, y, iconOffset, + startRes, column, validRes, validEnd); + break; } - } - if (!row.isValidStruc()) - { - g.setColor(Color.orange); - g.fillRect((int) row.getInvalidStrucPos() * charWidth, y, - charWidth, charHeight); - } - if (validCharWidth - && validRes - && row_annotations[column].displayCharacter != null - && (row_annotations[column].displayCharacter.length() > 0)) - { - - if (centreColLabels || scaleColLabel) - { - fmWidth = fm.charsWidth( - row_annotations[column].displayCharacter - .toCharArray(), 0, - row_annotations[column].displayCharacter.length()); + // no break if isRNA - fall through to drawNotCanonicalAnnot! - if (scaleColLabel) - { - // justify the label and scale to fit in column - if (fmWidth > charWidth) - { - // scale only if the current font isn't already small enough - fmScaling = charWidth; - fmScaling /= fmWidth; - g.setFont(ofont.deriveFont(AffineTransform - .getScaleInstance(fmScaling, 1.0))); - // and update the label's width to reflect the scaling. - fmWidth = charWidth; - } - } - } - else + case 'E': + if (!isRNA) { - fmWidth = fm - .charWidth(row_annotations[column].displayCharacter - .charAt(0)); + drawSheetAnnot(g, row_annotations, lastSSX, x, y, iconOffset, + startRes, column, validRes, validEnd); + break; } - charOffset = (int) ((charWidth - fmWidth) / 2f); + // no break if isRNA - fall through to drawNotCanonicalAnnot! - if (row_annotations[column].colour == null) - g.setColor(Color.black); - else - g.setColor(row_annotations[column].colour); + case '(': + case ')': // Stem case for RNA secondary structure - if (column == 0 || row.graph > 0) + drawStemAnnot(g, row_annotations, lastSSX, x, y, iconOffset, + startRes, column, validRes, validEnd); + + break; + case '{': + case '}': + case '[': + case ']': + case '>': + case '<': + case 'A': + case 'a': + case 'B': + case 'b': + case 'C': + case 'c': + case 'D': + case 'd': + case 'e': + case 'F': + case 'f': + case 'G': + case 'g': + case 'h': + case 'I': + case 'i': + case 'J': + case 'j': + case 'K': + case 'k': + case 'L': + case 'l': + case 'M': + case 'm': + case 'N': + case 'n': + case 'O': + case 'o': + case 'P': + case 'p': + case 'Q': + case 'q': + case 'R': + case 'r': + case 'T': + case 't': + case 'U': + case 'u': + case 'V': + case 'v': + case 'W': + case 'w': + case 'X': + case 'x': + case 'Y': + case 'y': + case 'Z': + case 'z': + // Console.info(lastSS); + Color nonCanColor = getNotCanonicalColor(lastSS); + drawNotCanonicalAnnot(g, nonCanColor, row_annotations, lastSSX, + x, y, iconOffset, startRes, column, validRes, validEnd); + break; + default: + if (isVectorRendition()) { - g.drawString(row_annotations[column].displayCharacter, - (x * charWidth) + charOffset, y + iconOffset); + // draw single full width glyphline + drawGlyphLine(g, lastSSX, endRes - x, y, iconOffset); + // disable more glyph lines + this.glyphLineDrawn = true; } - else if (row_annotations[column - 1] == null - || (labelAllCols - || !row_annotations[column].displayCharacter - .equals(row_annotations[column - 1].displayCharacter) || (row_annotations[column].displayCharacter - .length() < 2 && row_annotations[column].secondaryStructure == ' '))) + else { - g.drawString(row_annotations[column].displayCharacter, x - * charWidth + charOffset, y + iconOffset); + drawGlyphLine(g, lastSSX, x, y, iconOffset); } - g.setFont(ofont); + break; } } - if (row.hasIcons) + + if (row.graph > 0 && row.graphHeight > 0) { - char ss = validRes ? row_annotations[column].secondaryStructure - : ' '; - if (ss == 'S') - { - // distinguish between forward/backward base-pairing - if (row_annotations[column].displayCharacter.indexOf(')') > -1) - { - ss = 's'; - } - } - if (!validRes || (ss != lastSS)) + if (row.graph == AlignmentAnnotation.LINE_GRAPH) { - if (x > -1) + if (row.graphGroup > -1 && !graphGroupDrawn.get(row.graphGroup)) { - switch (lastSS) + // TODO: JAL-1291 revise rendering model so the graphGroup map is + // computed efficiently for all visible labels + float groupmax = -999999, groupmin = 9999999; + for (int gg = 0; gg < aa.length; gg++) + { + if (aa[gg].graphGroup != row.graphGroup) + { + continue; + } + + if (aa[gg] != row) + { + aa[gg].visible = false; + } + if (aa[gg].graphMax > groupmax) + { + groupmax = aa[gg].graphMax; + } + if (aa[gg].graphMin < groupmin) + { + groupmin = aa[gg].graphMin; + } + } + + for (int gg = 0; gg < aa.length; gg++) { - case 'H': - drawHelixAnnot(g, row_annotations, lastSSX, x, y, - iconOffset, startRes, column, validRes, validEnd); - break; - - case 'E': - drawSheetAnnot(g, row_annotations, lastSSX, x, y, - iconOffset, startRes, column, validRes, validEnd); - break; - - case 'S': // Stem case for RNA secondary structure - case 's': // and opposite direction - drawStemAnnot(g, row_annotations, lastSSX, x, y, - iconOffset, startRes, column, validRes, validEnd); - break; - - default: - g.setColor(Color.gray); - g.fillRect(lastSSX, y + 6 + iconOffset, (x * charWidth) - - lastSSX, 2); - - break; + if (aa[gg].graphGroup == row.graphGroup) + { + drawLineGraph(g, aa[gg], aa[gg].annotations, startRes, + endRes, y, groupmin, groupmax, row.graphHeight); + } } - } - if (validRes) - { - lastSS = ss; + + graphGroupDrawn.set(row.graphGroup); } else { - lastSS = ' '; - } - if (x > -1) - { - lastSSX = (x * charWidth); + drawLineGraph(g, row, row_annotations, startRes, endRes, y, + row.graphMin, row.graphMax, row.graphHeight); } } - } - column++; - x++; - } - if (column >= row_annotations.length) - { - column = row_annotations.length - 1; - validEnd = false; - } - else - { - validEnd = true; - } - if ((row_annotations == null) || (row_annotations.length <= column) - || (row_annotations[column] == null)) - { - validRes = false; - } - else - { - validRes = true; - } - - // x ++; - - if (row.hasIcons) - { - switch (lastSS) - { - case 'H': - drawHelixAnnot(g, row_annotations, lastSSX, x, y, iconOffset, - startRes, column, validRes, validEnd); - break; - - case 'E': - drawSheetAnnot(g, row_annotations, lastSSX, x, y, iconOffset, - startRes, column, validRes, validEnd); - break; - case 's': - case 'S': // Stem case for RNA secondary structure - drawStemAnnot(g, row_annotations, lastSSX, x, y, iconOffset, - startRes, column, validRes, validEnd); - break; - default: - drawGlyphLine(g, row_annotations, lastSSX, x, y, iconOffset, - startRes, column, validRes, validEnd); - break; - } - } - - if (row.graph > 0 && row.graphHeight > 0) - { - if (row.graph == AlignmentAnnotation.LINE_GRAPH) - { - if (row.graphGroup > -1 && !graphGroupDrawn.get(row.graphGroup)) + else if (row.graph == AlignmentAnnotation.BAR_GRAPH) { - // TODO: JAL-1291 revise rendering model so the graphGroup map is computed efficiently for all visible labels - float groupmax = -999999, groupmin = 9999999; - for (int gg = 0; gg < aa.length; gg++) + drawBarGraph(g, row, row_annotations, startRes, endRes, + row.graphMin, row.graphMax, y, renderHistogram, + renderProfile, normaliseProfile); + } + else + { + AnnotationRowRendererI renderer = rendererFactoryI + .getRendererFor(row); + if (renderer != null) { - if (aa[gg].graphGroup != row.graphGroup) - { - continue; - } - - if (aa[gg] != row) - { - aa[gg].visible = false; - } - if (aa[gg].graphMax > groupmax) - { - groupmax = aa[gg].graphMax; - } - if (aa[gg].graphMin < groupmin) - { - groupmin = aa[gg].graphMin; - } + renderer.renderRow(g, charWidth, charHeight, hasHiddenColumns, + av, hiddenColumns, columnSelection, row, + row_annotations, startRes, endRes, row.graphMin, + row.graphMax, y); } - - for (int gg = 0; gg < aa.length; gg++) + if (debugRedraw) { - if (aa[gg].graphGroup == row.graphGroup) + if (renderer == null) + { + System.err + .println("No renderer found for " + row.toString()); + } + else { - drawLineGraph(g, aa[gg], aa[gg].annotations, startRes, - endRes, y, groupmin, groupmax, row.graphHeight); + Console.warn( + "rendered with " + renderer.getClass().toString()); } } - graphGroupDrawn.set(row.graphGroup); - } - else - { - drawLineGraph(g, row, row_annotations, startRes, endRes, y, - row.graphMin, row.graphMax, row.graphHeight); } } - else if (row.graph == AlignmentAnnotation.BAR_GRAPH) - { - drawBarGraph(g, row, row_annotations, startRes, endRes, - row.graphMin, row.graphMax, y, renderHistogram,renderProfile,normaliseProfile); - } } - } else { - if (clipst && !clipend) + else { - clipend = true; - } - }// end if_in_visible_region + if (clipst && !clipend) + { + clipend = true; + } + } // end if_in_visible_region if (row.graph > 0 && row.hasText) { y += charHeight; @@ -722,17 +1171,15 @@ public class AnnotationRenderer { if (clipst) { - System.err.println("Start clip at : " + yfrom + " (index " + f_i - + ")"); + Console.warn("Start clip at : " + yfrom + " (index " + f_i + ")"); } if (clipend) { - System.err.println("End clip at : " + yto + " (index " + f_to - + ")"); + Console.warn("End clip at : " + yto + " (index " + f_to + ")"); } } ; - System.err.println("Annotation Rendering time:" + Console.warn("Annotation Rendering time:" + (System.currentTimeMillis() - stime)); } ; @@ -740,63 +1187,80 @@ public class AnnotationRenderer return !usedFaded; } - private final Color GLYPHLINE_COLOR = Color.gray; + public static final Color GLYPHLINE_COLOR = Color.gray; - private final Color SHEET_COLOUR = Color.green; + public static final Color SHEET_COLOUR = Color.green; - private final Color HELIX_COLOUR = Color.red; + public static final Color HELIX_COLOUR = Color.red; - private final Color STEM_COLOUR = Color.blue; + public static final Color STEM_COLOUR = Color.blue; - public void drawGlyphLine(Graphics g, Annotation[] row, int lastSSX, - int x, int y, int iconOffset, int startRes, int column, - boolean validRes, boolean validEnd) + // private Color sdNOTCANONICAL_COLOUR; + + void drawGlyphLine(Graphics g, int lastSSX, int x, int y, int iconOffset) { + if (glyphLineDrawn) + { + // if we've drawn a single long glyphline for an export, don't draw the + // bits + return; + } + unsetAntialias(g); g.setColor(GLYPHLINE_COLOR); g.fillRect(lastSSX, y + 6 + iconOffset, (x * charWidth) - lastSSX, 2); } - public void drawSheetAnnot(Graphics g, Annotation[] row, int lastSSX, - int x, int y, int iconOffset, int startRes, int column, - boolean validRes, boolean validEnd) - { - g.setColor(SHEET_COLOUR); + void drawSheetAnnot(Graphics g, Annotation[] row, + int lastSSX, int x, int y, int iconOffset, int startRes, + int column, boolean validRes, boolean validEnd) + { if (!validEnd || !validRes || row == null || row[column] == null || row[column].secondaryStructure != 'E') { - g.fillRect(lastSSX, y + 4 + iconOffset, - (x * charWidth) - lastSSX - 4, 7); - g.fillPolygon(new int[] - { (x * charWidth) - 4, (x * charWidth) - 4, (x * charWidth) }, + // draw the glyphline underneath + drawGlyphLine(g, lastSSX, x, y, iconOffset); + + g.setColor(SHEET_COLOUR); + fillRect(g, lastSSX, y + 4 + iconOffset, + (x * charWidth) - lastSSX - 4, 6); + fillPolygon(g, + new int[] + { (x * charWidth) - 6, (x * charWidth) - 6, + (x * charWidth - 1) }, new int[] - { y + iconOffset, y + 14 + iconOffset, y + 7 + iconOffset }, + { y + iconOffset + 1, y + 13 + iconOffset, + y + 7 + iconOffset }, 3); } else { - g.fillRect(lastSSX, y + 4 + iconOffset, - (x + 1) * charWidth - lastSSX, 7); + g.setColor(SHEET_COLOUR); + fillRect(g, lastSSX, y + 4 + iconOffset, (x * charWidth) - lastSSX, + 6); } - } - public void drawHelixAnnot(Graphics g, Annotation[] row, int lastSSX, - int x, int y, int iconOffset, int startRes, int column, - boolean validRes, boolean validEnd) + void drawHelixAnnot(Graphics g, Annotation[] row, int lastSSX, int x, + int y, int iconOffset, int startRes, int column, boolean validRes, + boolean validEnd) { - g.setColor(HELIX_COLOUR); - - int sCol = (lastSSX / charWidth) + startRes; + int sCol = (lastSSX / charWidth) + + hiddenColumns.visibleToAbsoluteColumn(startRes); int x1 = lastSSX; int x2 = (x * charWidth); - if (MAC) + if (USE_FILL_ROUND_RECT || isVectorRendition()) { + // draw glyph line behind helix (visible in EPS or SVG output) + drawGlyphLine(g, lastSSX, x, y, iconOffset); + + g.setColor(HELIX_COLOUR); + setAntialias(g); int ofs = charWidth / 2; // Off by 1 offset when drawing rects and ovals // to offscreen image on the MAC - g.fillRoundRect(lastSSX, y + 4 + iconOffset, x2 - x1, 8, 8, 8); + fillRoundRect(g, lastSSX, y + 3 + iconOffset, x2 - x1 - 1, 8, 8, 8); if (sCol == 0 || row[sCol - 1] == null || row[sCol - 1].secondaryStructure != 'H') { @@ -804,8 +1268,8 @@ public class AnnotationRenderer else { // g.setColor(Color.orange); - g.fillRoundRect(lastSSX, y + 4 + iconOffset, x2 - x1 - ofs + 1, 8, - 0, 0); + fillRoundRect(g, lastSSX, y + 3 + iconOffset, x2 - x1 - ofs, 8, 0, + 0); } if (!validRes || row[column] == null || row[column].secondaryStructure != 'H') @@ -815,40 +1279,55 @@ public class AnnotationRenderer else { // g.setColor(Color.magenta); - g.fillRoundRect(lastSSX + ofs, y + 4 + iconOffset, x2 - x1 - ofs - + 1, 8, 0, 0); - + fillRoundRect(g, lastSSX + ofs, y + 3 + iconOffset, x2 - x1 - ofs, + 8, 0, 0); } return; } - if (sCol == 0 || row[sCol - 1] == null - || row[sCol - 1].secondaryStructure != 'H') + boolean leftEnd = sCol == 0 || row[sCol - 1] == null + || row[sCol - 1].secondaryStructure != 'H'; + boolean rightEnd = !validRes || row[column] == null + || row[column].secondaryStructure != 'H'; + + if (leftEnd || rightEnd) + { + drawGlyphLine(g, lastSSX, x, y, iconOffset); + } + g.setColor(HELIX_COLOUR); + + if (leftEnd) { - g.fillArc(lastSSX, y + 4 + iconOffset, charWidth, 8, 90, 180); + fillArc(g, lastSSX, y + 3 + iconOffset, charWidth, 8, 90, 180); x1 += charWidth / 2; } - if (!validRes || row[column] == null - || row[column].secondaryStructure != 'H') + if (rightEnd) { - g.fillArc((x * charWidth) - charWidth, y + 4 + iconOffset, charWidth, - 8, 270, 180); + fillArc(g, ((x - 1) * charWidth), y + 3 + iconOffset, charWidth, 8, + 270, 180); x2 -= charWidth / 2; } - g.fillRect(x1, y + 4 + iconOffset, x2 - x1, 8); + fillRect(g, x1, y + 3 + iconOffset, x2 - x1, 8); } - public void drawLineGraph(Graphics g, AlignmentAnnotation _aa, - Annotation[] aa_annotations, int sRes, int eRes, int y, - float min, float max, int graphHeight) + void drawLineGraph(Graphics g, AlignmentAnnotation _aa, + Annotation[] aa_annotations, int sRes, int eRes, int y, float min, + float max, int graphHeight) { if (sRes > aa_annotations.length) { return; } + Stroke roundStroke = new BasicStroke(1, BasicStroke.CAP_ROUND, + BasicStroke.JOIN_ROUND); + Stroke squareStroke = new BasicStroke(1, BasicStroke.CAP_SQUARE, + BasicStroke.JOIN_MITER); + Graphics2D g2d = (Graphics2D) g; + Stroke prevStroke = g2d.getStroke(); + g2d.setStroke(roundStroke); int x = 0; @@ -875,7 +1354,8 @@ public class AnnotationRenderer } g.setColor(Color.gray); - g.drawLine(x - charWidth, y2, (eRes - sRes + 1) * charWidth, y2); + drawLine(g, squareStroke, x * charWidth - charWidth, y2, + (eRes - sRes) * charWidth, y2); eRes = Math.min(eRes, aa_annotations.length); @@ -887,7 +1367,7 @@ public class AnnotationRenderer column = sRes + x; if (hasHiddenColumns) { - column = columnSelection.adjustForHiddenColumns(column); + column = hiddenColumns.visibleToAbsoluteColumn(column); } if (column > aaMax) @@ -895,25 +1375,47 @@ public class AnnotationRenderer break; } - if (aa_annotations[column] == null - || aa_annotations[column - 1] == null) + if (aa_annotations[column] == null) { x++; continue; } if (aa_annotations[column].colour == null) + { g.setColor(Color.black); + } else + { g.setColor(aa_annotations[column].colour); + } + + if (aa_annotations[column - 1] == null + && aa_annotations.length > column + 1 + && aa_annotations[column + 1] == null) + { + // standalone value + y1 = y - (int) (((aa_annotations[column].value - min) / range) + * graphHeight); + drawLine(g, x * charWidth + charWidth / 4, y1, + x * charWidth + 3 * charWidth / 4, y1); + x++; + continue; + } + + if (aa_annotations[column - 1] == null) + { + x++; + continue; + } - y1 = y - - (int) (((aa_annotations[column - 1].value - min) / range) * graphHeight); - y2 = y - - (int) (((aa_annotations[column].value - min) / range) * graphHeight); + y1 = y - (int) (((aa_annotations[column - 1].value - min) / range) + * graphHeight); + y2 = y - (int) (((aa_annotations[column].value - min) / range) + * graphHeight); - g.drawLine(x * charWidth - charWidth / 2, y1, x * charWidth - + charWidth / 2, y2); + drawLine(g, (x - 1) * charWidth + charWidth / 2, y1, + x * charWidth + charWidth / 2, y2); x++; } @@ -921,19 +1423,21 @@ public class AnnotationRenderer { g.setColor(_aa.threshold.colour); Graphics2D g2 = (Graphics2D) g; - g2.setStroke(new BasicStroke(1, BasicStroke.CAP_SQUARE, + Stroke s = new BasicStroke(1, BasicStroke.CAP_SQUARE, BasicStroke.JOIN_ROUND, 3f, new float[] - { 5f, 3f }, 0f)); + { 5f, 3f }, 0f); y2 = (int) (y - ((_aa.threshold.value - min) / range) * graphHeight); - g.drawLine(0, y2, (eRes - sRes) * charWidth, y2); - g2.setStroke(new BasicStroke()); + drawLine(g, s, 0, y2, (eRes - sRes) * charWidth, y2); } + g2d.setStroke(prevStroke); } - public void drawBarGraph(Graphics g, AlignmentAnnotation _aa, + @SuppressWarnings("unused") + void drawBarGraph(Graphics g, AlignmentAnnotation _aa, Annotation[] aa_annotations, int sRes, int eRes, float min, - float max, int y, boolean renderHistogram,boolean renderProfile,boolean normaliseProfile) + float max, int y, boolean renderHistogram, boolean renderProfile, + boolean normaliseProfile) { if (sRes > aa_annotations.length) { @@ -953,7 +1457,7 @@ public class AnnotationRenderer g.setColor(Color.gray); - g.drawLine(x, y2, (eRes - sRes) * charWidth, y2); + drawLine(g, x, y2, (eRes - sRes) * charWidth, y2); int column; int aaMax = aa_annotations.length - 1; @@ -962,7 +1466,7 @@ public class AnnotationRenderer column = sRes + x; if (hasHiddenColumns) { - column = columnSelection.adjustForHiddenColumns(column); + column = hiddenColumns.visibleToAbsoluteColumn(column); } if (column > aaMax) @@ -976,91 +1480,175 @@ public class AnnotationRenderer continue; } if (aa_annotations[column].colour == null) + { g.setColor(Color.black); + } else + { g.setColor(aa_annotations[column].colour); + } - y1 = y - - (int) (((aa_annotations[column].value - min) / (range)) * _aa.graphHeight); + y1 = y - (int) (((aa_annotations[column].value - min) / (range)) + * _aa.graphHeight); if (renderHistogram) { if (y1 - y2 > 0) { - g.fillRect(x * charWidth, y2, charWidth, y1 - y2); + fillRect(g, x * charWidth, y2, charWidth, y1 - y2); } else { - g.fillRect(x * charWidth, y1, charWidth, y2 - y1); + fillRect(g, x * charWidth, y1, charWidth, y2 - y1); } } // draw profile if available if (renderProfile) { + /* + * {profile type, #values, total count, char1, pct1, char2, pct2...} + */ int profl[] = getProfileFor(_aa, column); + // just try to draw the logo if profl is not null - if (profl != null && profl[1] != 0) + if (profl != null && profl[2] != 0) { + boolean isStructureProfile = profl[0] == AlignmentAnnotation.STRUCTURE_PROFILE; + boolean isCdnaProfile = profl[0] == AlignmentAnnotation.CDNA_PROFILE; float ht = normaliseProfile ? y - _aa.graphHeight : y1; - double htn = normaliseProfile ? _aa.graphHeight : (y2 - y1);// aa.graphHeight; - double hght; - float wdth; - double ht2 = 0; - char[] dc; + final double normaliseFactor = normaliseProfile ? _aa.graphHeight + : (y2 - y1); /** - * profl.length == 74 indicates that the profile of a secondary - * structure conservation row was accesed. Therefore dc gets length 2, - * to have space for a basepair instead of just a single nucleotide + * Render a single base for a sequence profile, a base pair for + * structure profile, and a triplet for a cdna profile */ - if (profl.length == 74) - { - dc = new char[2]; - } - else - { - dc = new char[1]; - } - LineMetrics lm = g.getFontMetrics(ofont).getLineMetrics("Q", g); - double scale = 1f / (normaliseProfile ? profl[1] : 100f); - float ofontHeight = 1f / lm.getAscent();// magnify to fill box - double scl = 0.0; - for (int c = 2; c < profl[0];) + char[] dc = new char[isStructureProfile ? 2 + : (isCdnaProfile ? 3 : 1)]; + + // lm is not necessary - we can just use fm - could be off by no more + // than 0.5 px + // LineMetrics lm = g.getFontMetrics(ofont).getLineMetrics("Q", g); + // Console.info(asc + " " + dec + " " + (asc - + // lm.getAscent()) + // + " " + (dec - lm.getDescent())); + + double asc = fm.getAscent(); + double dec = fm.getDescent(); + double fht = fm.getHeight(); + + double scale = 1f / (normaliseProfile ? profl[2] : 100f); + // float ofontHeight = 1f / fm.getAscent();// magnify to fill box + + /* + * Traverse the character(s)/percentage data in the array + */ + + float ht2 = ht; + + // profl[1] is the number of values in the profile + for (int i = 0, c = 3, last = profl[1]; i < last; i++) { - dc[0] = (char) profl[c++]; - if (_aa.label.startsWith("StrucConsensus")) + String s; + if (isStructureProfile) { + // todo can we encode a structure pair as an int, like codons? + dc[0] = (char) profl[c++]; dc[1] = (char) profl[c++]; + s = new String(dc); } + else if (isCdnaProfile) + { + CodingUtils.decodeCodon2(profl[c++], dc); + s = new String(dc); + } + else + { + dc[0] = (char) profl[c++]; + s = new String(dc); + } + // next profl[] position is profile % for the character(s) - wdth = charWidth; - wdth /= fm.charsWidth(dc, 0, dc.length); - - ht += scl; + int percent = profl[c++]; + if (percent == 0) + { + // failsafe in case a count rounds down to 0% + continue; + } + double newHeight = normaliseFactor * scale * percent; + + /* + * Set character colour as per alignment colour scheme; use the + * codon translation if a cDNA profile + */ + Color colour = null; + if (isCdnaProfile) + { + final String codonTranslation = ResidueProperties + .codonTranslate(s); + colour = profcolour.findColour(codonTranslation.charAt(0), + column, null); + } + else { - scl = htn * scale * profl[c++]; - lm = ofont.getLineMetrics(dc, 0, 1, g.getFontMetrics() - .getFontRenderContext()); - g.setFont(ofont.deriveFont(AffineTransform.getScaleInstance( - wdth, scl / lm.getAscent()))); - lm = g.getFontMetrics().getLineMetrics(dc, 0, 1, g); - - // Debug - render boxes around characters - // g.setColor(Color.red); - // g.drawRect(x*av.charWidth, (int)ht, av.charWidth, - // (int)(scl)); - // g.setColor(profcolour.findColour(dc[0]).darker()); - g.setColor(profcolour.findColour(dc[0], column, null)); - - hght = (ht + (scl - lm.getDescent() - lm.getBaselineOffsets()[lm - .getBaselineIndex()])); - - g.drawChars(dc, 0, dc.length, x * charWidth, (int) hght); + colour = profcolour.findColour(dc[0], column, null); + } + g.setColor(colour == Color.white ? Color.lightGray : colour); + + // Debug - render boxes around characters + // g.setColor(Color.red); + // g.drawRect(x*av.charWidth, (int)ht, av.charWidth, + // (int)(scl)); + // g.setColor(profcolour.findColour(dc[0]).darker()); + + double sx = 1f * charWidth / fm.charsWidth(dc, 0, dc.length); + double sy = newHeight / asc; + double newAsc = asc * sy; + double newDec = dec * sy; + // it is not necessary to recalculate lm for the new font. + // note: lm.getBaselineOffsets()[lm.getBaselineIndex()]) must be 0 + // by definition. Was: + // int hght = (int) (ht + (newAsc - newDec); + // - lm.getBaselineOffsets()[lm.getBaselineIndex()])); + + if (Platform.isJS()) + { + /* + * SwingJS does not implement font.deriveFont() + * so use a scaling transform to draw instead, + * this is off by a very small amount + */ + final int hght = (int) (ht2 + (newAsc - newDec)); + Graphics2D gg = (Graphics2D) g; + int xShift = (int) Math.round(x * charWidth / sx); + int yShift = (int) Math.round(hght / sy); + gg.transform(AffineTransform.getScaleInstance(sx, sy)); + gg.drawString(s, xShift, yShift); + gg.transform( + AffineTransform.getScaleInstance(1D / sx, 1D / sy)); + ht2 += newHeight; + } + else + /** + * Java only + * + * @j2sIgnore + */ + { + // Java ('normal') method is to scale the font to fit + + final int hght = (int) (ht + (newAsc - newDec)); + Font font = ofont + .deriveFont(AffineTransform.getScaleInstance(sx, sy)); + g.setFont(font); + g.drawChars(dc, 0, dc.length, x * charWidth, hght); + g.setFont(ofont); + + ht += newHeight; } } - g.setFont(ofont); } } x++; @@ -1068,15 +1656,13 @@ public class AnnotationRenderer if (_aa.threshold != null) { g.setColor(_aa.threshold.colour); - Graphics2D g2 = (Graphics2D) g; - g2.setStroke(new BasicStroke(1, BasicStroke.CAP_SQUARE, + Stroke s = new BasicStroke(1, BasicStroke.CAP_SQUARE, BasicStroke.JOIN_ROUND, 3f, new float[] - { 5f, 3f }, 0f)); + { 5f, 3f }, 0f); - y2 = (int) (y - ((_aa.threshold.value - min) / range) - * _aa.graphHeight); - g.drawLine(0, y2, (eRes - sRes) * charWidth, y2); - g2.setStroke(new BasicStroke()); + y2 = (int) (y + - ((_aa.threshold.value - min) / range) * _aa.graphHeight); + drawLine(g, s, 0, y2, (eRes - sRes) * charWidth, y2); } } @@ -1086,7 +1672,7 @@ public class AnnotationRenderer { eRes = Math.min(eRes, aa_annotations.length); g.setColor(Color.white); - g.fillRect(0, 0, width, y); + fillRect(g, 0, 0, width, y); g.setColor(new Color(0, 0, 180)); int x = 0, height; @@ -1096,9 +1682,13 @@ public class AnnotationRenderer if (aa_annotations[j] != null) { if (aa_annotations[j].colour == null) + { g.setColor(Color.black); + } else + { g.setColor(aa_annotations[j].colour); + } height = (int) ((aa_annotations[j].value / _aa.graphMax) * y); if (height > y) @@ -1106,9 +1696,219 @@ public class AnnotationRenderer height = y; } - g.fillRect(x, y - height, charWidth, height); + fillRect(g, x, y - height, charWidth, height); } x += charWidth; } } + + Color getNotCanonicalColor(char lastss) + { + switch (lastss) + { + case '{': + case '}': + return new Color(255, 125, 5); + + case '[': + case ']': + return new Color(245, 115, 10); + + case '>': + case '<': + return new Color(235, 135, 15); + + case 'A': + case 'a': + return new Color(225, 105, 20); + + case 'B': + case 'b': + return new Color(215, 145, 30); + + case 'C': + case 'c': + return new Color(205, 95, 35); + + case 'D': + case 'd': + return new Color(195, 155, 45); + + case 'E': + case 'e': + return new Color(185, 85, 55); + + case 'F': + case 'f': + return new Color(175, 165, 65); + + case 'G': + case 'g': + return new Color(170, 75, 75); + + case 'H': + case 'h': + return new Color(160, 175, 85); + + case 'I': + case 'i': + return new Color(150, 65, 95); + + case 'J': + case 'j': + return new Color(140, 185, 105); + + case 'K': + case 'k': + return new Color(130, 55, 110); + + case 'L': + case 'l': + return new Color(120, 195, 120); + + case 'M': + case 'm': + return new Color(110, 45, 130); + + case 'N': + case 'n': + return new Color(100, 205, 140); + + case 'O': + case 'o': + return new Color(90, 35, 150); + + case 'P': + case 'p': + return new Color(85, 215, 160); + + case 'Q': + case 'q': + return new Color(75, 25, 170); + + case 'R': + case 'r': + return new Color(65, 225, 180); + + case 'S': + case 's': + return new Color(55, 15, 185); + + case 'T': + case 't': + return new Color(45, 235, 195); + + case 'U': + case 'u': + return new Color(35, 5, 205); + + case 'V': + case 'v': + return new Color(25, 245, 215); + + case 'W': + case 'w': + return new Color(15, 0, 225); + + case 'X': + case 'x': + return new Color(10, 255, 235); + + case 'Y': + case 'y': + return new Color(5, 150, 245); + + case 'Z': + case 'z': + return new Color(0, 80, 255); + + default: + Console.info("This is not a interaction : " + lastss); + return null; + + } + } + + private void fillPolygon(Graphics g, int[] xpoints, int[] ypoints, int n) + { + setAntialias(g); + g.fillPolygon(xpoints, ypoints, n); + } + + /* + private void fillRect(Graphics g, int a, int b, int c, int d) + { + fillRect(g, false, a, b, c, d); + }*/ + + private void fillRect(Graphics g, int a, int b, int c, int d) + { + unsetAntialias(g); + g.fillRect(a, b, c, d); + } + + private void fillRoundRect(Graphics g, int a, int b, int c, int d, int e, + int f) + { + setAntialias(g); + g.fillRoundRect(a, b, c, d, e, f); + } + + private void fillArc(Graphics g, int a, int b, int c, int d, int e, int f) + { + setAntialias(g); + g.fillArc(a, b, c, d, e, f); + } + + private void drawLine(Graphics g, Stroke s, int a, int b, int c, int d) + { + Graphics2D g2d = (Graphics2D) g; + Stroke p = g2d.getStroke(); + g2d.setStroke(s); + drawLine(g, a, b, c, d); + g2d.setStroke(p); + } + + private void drawLine(Graphics g, int a, int b, int c, int d) + { + setAntialias(g); + g.drawLine(a, b, c, d); + } + + private void setAntialias(Graphics g) + { + if (isVectorRendition()) + { + // no need to antialias vector drawings + return; + } + if (Cache.getDefault("ANTI_ALIAS", true)) + { + Graphics2D g2d = (Graphics2D) g; + g2d.setRenderingHint(RenderingHints.KEY_ANTIALIASING, + RenderingHints.VALUE_ANTIALIAS_ON); + } + } + + private void unsetAntialias(Graphics g) + { + if (isVectorRendition()) + { + // no need to antialias vector drawings + return; + } + Graphics2D g2d = (Graphics2D) g; + g2d.setRenderingHint(RenderingHints.KEY_ANTIALIASING, + RenderingHints.VALUE_ANTIALIAS_OFF); + } + + public void setVectorRendition(boolean b) + { + vectorRendition = b; + } + + public boolean isVectorRendition() + { + return vectorRendition; + } }