X-Git-Url: http://source.jalview.org/gitweb/?a=blobdiff_plain;f=src%2Fjalview%2Frenderer%2FAnnotationRenderer.java;h=b5dac0d50f95fb5daf98ac5379724f0bea3d6697;hb=refs%2Fheads%2Fbug%2FJAL-4290_headless_alignment_figure_with_sse;hp=8f751b6d794be12064039f6372011a7efc851bd7;hpb=09cce494f72431183bd3c37e77913170a08c3ac3;p=jalview.git diff --git a/src/jalview/renderer/AnnotationRenderer.java b/src/jalview/renderer/AnnotationRenderer.java index 8f751b6..b5dac0d 100644 --- a/src/jalview/renderer/AnnotationRenderer.java +++ b/src/jalview/renderer/AnnotationRenderer.java @@ -20,11 +20,30 @@ */ package jalview.renderer; +import java.awt.BasicStroke; +import java.awt.Color; +import java.awt.Font; +import java.awt.FontMetrics; +import java.awt.Graphics; +import java.awt.Graphics2D; +import java.awt.Image; +import java.awt.RenderingHints; +import java.awt.Stroke; +import java.awt.geom.AffineTransform; +import java.awt.image.ImageObserver; +import java.util.BitSet; +import java.util.Hashtable; + +import org.jfree.graphics2d.svg.SVGGraphics2D; +import org.jibble.epsgraphics.EpsGraphics2D; + import jalview.analysis.AAFrequency; import jalview.analysis.CodingUtils; import jalview.analysis.Rna; import jalview.analysis.StructureFrequency; import jalview.api.AlignViewportI; +import jalview.bin.Cache; +import jalview.bin.Console; import jalview.datamodel.AlignmentAnnotation; import jalview.datamodel.Annotation; import jalview.datamodel.ColumnSelection; @@ -38,19 +57,6 @@ import jalview.schemes.ResidueProperties; import jalview.schemes.ZappoColourScheme; import jalview.util.Platform; -import java.awt.BasicStroke; -import java.awt.Color; -import java.awt.Font; -import java.awt.FontMetrics; -import java.awt.Graphics; -import java.awt.Graphics2D; -import java.awt.Image; -import java.awt.font.LineMetrics; -import java.awt.geom.AffineTransform; -import java.awt.image.ImageObserver; -import java.util.BitSet; -import java.util.Hashtable; - public class AnnotationRenderer { private static final int UPPER_TO_LOWER = 'a' - 'A'; // 32 @@ -70,7 +76,7 @@ public class AnnotationRenderer private FontMetrics fm; - private final boolean MAC = Platform.isAMac(); + private final boolean USE_FILL_ROUND_RECT = Platform.isAMacAndNotJS(); boolean av_renderHistogram = true, av_renderProfile = true, av_normaliseProfile = false; @@ -78,17 +84,21 @@ public class AnnotationRenderer ResidueShaderI profcolour = null; private ColumnSelection columnSelection; - + private HiddenColumns hiddenColumns; private ProfilesI hconsensus; - private Hashtable[] complementConsensus; + private Hashtable[] complementConsensus; - private Hashtable[] hStrucConsensus; + private Hashtable[] hStrucConsensus; private boolean av_ignoreGapsConsensus; + private boolean renderingVectors = false; + + private boolean glyphLineDrawn = false; + /** * attributes set from AwtRenderPanelI */ @@ -152,6 +162,7 @@ public class AnnotationRenderer */ public void dispose() { + hiddenColumns = null; hconsensus = null; complementConsensus = null; hStrucConsensus = null; @@ -164,8 +175,8 @@ public class AnnotationRenderer int x, int y, int iconOffset, int startRes, int column, boolean validRes, boolean validEnd) { - g.setColor(STEM_COLOUR); - int sCol = (lastSSX / charWidth) + startRes; + int sCol = (lastSSX / charWidth) + + hiddenColumns.visibleToAbsoluteColumn(startRes); int x1 = lastSSX; int x2 = (x * charWidth); @@ -173,11 +184,19 @@ public class AnnotationRenderer : row_annotations[column - 1].secondaryStructure; boolean diffupstream = sCol == 0 || row_annotations[sCol - 1] == null - || dc != row_annotations[sCol - 1].secondaryStructure; + || dc != row_annotations[sCol - 1].secondaryStructure + || !validEnd; boolean diffdownstream = !validRes || !validEnd || row_annotations[column] == null || dc != row_annotations[column].secondaryStructure; + if (diffupstream || diffdownstream) + { + // draw glyphline under arrow + drawGlyphLine(g, lastSSX, x, y, iconOffset); + } + g.setColor(STEM_COLOUR); + if (column > 0 && Rna.isClosingParenthesis(dc)) { if (diffupstream) @@ -188,9 +207,11 @@ public class AnnotationRenderer * if new annotation with a closing base pair half of the stem, * display a backward arrow */ - g.fillPolygon(new int[] { lastSSX + 5, lastSSX + 5, lastSSX }, - new int[] { y + iconOffset, y + 14 + iconOffset, - y + 8 + iconOffset }, 3); + fillPolygon(g, new int[] { lastSSX + 5, lastSSX + 5, lastSSX }, + new int[] + { y + iconOffset + 1, y + 13 + iconOffset, + y + 7 + iconOffset }, + 3); x1 += 5; } if (diffdownstream) @@ -207,8 +228,11 @@ public class AnnotationRenderer * if annotation ending with an opeing base pair half of the stem, * display a forward arrow */ - g.fillPolygon(new int[] { x2 - 5, x2 - 5, x2 }, new int[] { - y + iconOffset, y + 14 + iconOffset, y + 8 + iconOffset }, 3); + fillPolygon(g, new int[] { x2 - 6, x2 - 6, x2 - 1 }, + new int[] + { y + iconOffset + 1, y + 13 + iconOffset, + y + 7 + iconOffset }, + 3); x2 -= 5; } if (diffupstream) @@ -217,7 +241,8 @@ public class AnnotationRenderer } } // draw arrow body - g.fillRect(x1, y + 4 + iconOffset, x2 - x1, 7); + unsetAntialias(g); + fillRect(g, x1, y + 4 + iconOffset, x2 - x1, 6); } void drawNotCanonicalAnnot(Graphics g, Color nonCanColor, @@ -225,10 +250,10 @@ public class AnnotationRenderer int iconOffset, int startRes, int column, boolean validRes, boolean validEnd) { - // System.out.println(nonCanColor); + // Console.info(nonCanColor); - g.setColor(nonCanColor); - int sCol = (lastSSX / charWidth) + startRes; + int sCol = (lastSSX / charWidth) + + hiddenColumns.visibleToAbsoluteColumn(startRes); int x1 = lastSSX; int x2 = (x * charWidth); @@ -236,12 +261,21 @@ public class AnnotationRenderer : row_annotations[column - 1].displayCharacter; boolean diffupstream = sCol == 0 || row_annotations[sCol - 1] == null - || !dc.equals(row_annotations[sCol - 1].displayCharacter); + || !dc.equals(row_annotations[sCol - 1].displayCharacter) + || !validEnd; boolean diffdownstream = !validRes || !validEnd || row_annotations[column] == null || !dc.equals(row_annotations[column].displayCharacter); - // System.out.println("Column "+column+" diff up: "+diffupstream+" down:"+diffdownstream); + // Console.info("Column "+column+" diff up: + // "+diffupstream+" + // down:"+diffdownstream); // If a closing base pair half of the stem, display a backward arrow + if (diffupstream || diffdownstream) + { + // draw glyphline under arrow + drawGlyphLine(g, lastSSX, x, y, iconOffset); + } + g.setColor(nonCanColor); if (column > 0 && Rna.isClosingParenthesis(dc)) { @@ -249,9 +283,11 @@ public class AnnotationRenderer // if (validRes && column>1 && row_annotations[column-2]!=null && // dc.equals(row_annotations[column-2].displayCharacter)) { - g.fillPolygon(new int[] { lastSSX + 5, lastSSX + 5, lastSSX }, - new int[] { y + iconOffset, y + 14 + iconOffset, - y + 8 + iconOffset }, 3); + fillPolygon(g, new int[] { lastSSX + 5, lastSSX + 5, lastSSX }, + new int[] + { y + iconOffset + 1, y + 13 + iconOffset, + y + 7 + iconOffset }, + 3); x1 += 5; } if (diffdownstream) @@ -265,8 +301,11 @@ public class AnnotationRenderer // display a forward arrow if (diffdownstream) { - g.fillPolygon(new int[] { x2 - 5, x2 - 5, x2 }, new int[] { - y + iconOffset, y + 14 + iconOffset, y + 8 + iconOffset }, 3); + fillPolygon(g, new int[] { x2 - 6, x2 - 6, x2 - 1 }, + new int[] + { y + iconOffset + 1, y + 13 + iconOffset, + y + 7 + iconOffset }, + 3); x2 -= 5; } if (diffupstream) @@ -275,7 +314,8 @@ public class AnnotationRenderer } } // draw arrow body - g.fillRect(x1, y + 4 + iconOffset, x2 - x1, 7); + unsetAntialias(g); + fillRect(g, x1, y + 4 + iconOffset, x2 - x1, 6); } // public void updateFromAnnotationPanel(FontMetrics annotFM, AlignViewportI @@ -329,7 +369,8 @@ public class AnnotationRenderer * the alignment has no colourscheme set * (would like to use user preference but n/a for applet) */ - ColourSchemeI col = av.getAlignment().isNucleotide() ? new NucleotideColourScheme() + ColourSchemeI col = av.getAlignment().isNucleotide() + ? new NucleotideColourScheme() : new ZappoColourScheme(); profcolour = new ResidueShader(col); } @@ -356,9 +397,8 @@ public class AnnotationRenderer // properties/rendering attributes as a global 'alignment group' which holds // all vis settings for the alignment as a whole rather than a subset // - if (aa.autoCalculated - && (aa.label.startsWith("Consensus") || aa.label - .startsWith("cDNA Consensus"))) + if (aa.autoCalculated && (aa.label.startsWith("Consensus") + || aa.label.startsWith("cDNA Consensus"))) { boolean forComplement = aa.label.startsWith("cDNA Consensus"); if (aa.groupRef != null && aa.groupRef.consensusData != null @@ -375,8 +415,8 @@ public class AnnotationRenderer { if (forComplement) { - return AAFrequency.extractCdnaProfile( - complementConsensus[column], av_ignoreGapsConsensus); + return AAFrequency.extractCdnaProfile(complementConsensus[column], + av_ignoreGapsConsensus); } else { @@ -438,6 +478,12 @@ public class AnnotationRenderer AlignViewportI av, Graphics g, int activeRow, int startRes, int endRes) { + if (g instanceof EpsGraphics2D || g instanceof SVGGraphics2D) + { + this.setVectorRendering(true); + } + Graphics2D g2d = (Graphics2D) g; + long stime = System.currentTimeMillis(); boolean usedFaded = false; // NOTES: @@ -446,7 +492,7 @@ public class AnnotationRenderer updateFromAwtRenderPanel(annotPanel, av); fm = g.getFontMetrics(); AlignmentAnnotation[] aa = av.getAlignment().getAlignmentAnnotation(); - int temp = 0; + // int temp = 0; if (aa == null) { return false; @@ -459,8 +505,8 @@ public class AnnotationRenderer boolean validRes = false; boolean validEnd = false; boolean labelAllCols = false; - boolean centreColLabels; - boolean centreColLabelsDef = av.isCentreColumnLabels(); + // boolean centreColLabels; + // boolean centreColLabelsDef = av.isCentreColumnLabels(); boolean scaleColLabel = false; final AlignmentAnnotation consensusAnnot = av .getAlignmentConsensusAnnotation(); @@ -468,13 +514,9 @@ public class AnnotationRenderer .getAlignmentStrucConsensusAnnotation(); final AlignmentAnnotation complementConsensusAnnot = av .getComplementConsensusAnnotation(); - boolean renderHistogram = true, renderProfile = true, normaliseProfile = false, isRNA = rna; BitSet graphGroupDrawn = new BitSet(); int charOffset = 0; // offset for a label - float fmWidth, fmScaling = 1f; // scaling for a label to fit it into a - // column. - Font ofont = g.getFont(); // \u03B2 \u03B1 // debug ints int yfrom = 0, f_i = 0, yto = 0, f_to = 0; @@ -482,45 +524,42 @@ public class AnnotationRenderer for (int i = 0; i < aa.length; i++) { AlignmentAnnotation row = aa[i]; - isRNA = row.isRNA(); + boolean renderHistogram = true; + boolean renderProfile = false; + boolean normaliseProfile = false; + boolean isRNA = row.isRNA(); + + // check if this is a consensus annotation row and set the display + // settings appropriately + // TODO: generalise this to have render styles for consensus/profile + // data + if (row.groupRef != null && row == row.groupRef.getConsensus()) { - // check if this is a consensus annotation row and set the display - // settings appropriately - // TODO: generalise this to have render styles for consensus/profile - // data - if (row.groupRef != null && row == row.groupRef.getConsensus()) - { - renderHistogram = row.groupRef.isShowConsensusHistogram(); - renderProfile = row.groupRef.isShowSequenceLogo(); - normaliseProfile = row.groupRef.isNormaliseSequenceLogo(); - } - else if (row == consensusAnnot || row == structConsensusAnnot - || row == complementConsensusAnnot) - { - renderHistogram = av_renderHistogram; - renderProfile = av_renderProfile; - normaliseProfile = av_normaliseProfile; - } - else - { - renderHistogram = true; - // don't need to set render/normaliseProfile since they are not - // currently used in any other annotation track renderer - } + renderHistogram = row.groupRef.isShowConsensusHistogram(); + renderProfile = row.groupRef.isShowSequenceLogo(); + normaliseProfile = row.groupRef.isNormaliseSequenceLogo(); } + else if (row == consensusAnnot || row == structConsensusAnnot + || row == complementConsensusAnnot) + { + renderHistogram = av_renderHistogram; + renderProfile = av_renderProfile; + normaliseProfile = av_normaliseProfile; + } + Annotation[] row_annotations = row.annotations; if (!row.visible) { continue; } - centreColLabels = row.centreColLabels || centreColLabelsDef; + // centreColLabels = row.centreColLabels || centreColLabelsDef; labelAllCols = row.showAllColLabels; scaleColLabel = row.scaleColLabel; lastSS = ' '; lastSSX = 0; - if (!useClip - || ((y - charHeight) < visHeight && (y + row.height + charHeight * 2) >= sOffset)) + if (!useClip || ((y - charHeight) < visHeight + && (y + row.height + charHeight * 2) >= sOffset)) {// if_in_visible_region if (!clipst) { @@ -560,8 +599,8 @@ public class AnnotationRenderer { y += charHeight; usedFaded = true; - g.drawImage(fadedImage, 0, y - row.height, imgWidth, y, 0, y - - row.height, imgWidth, y, annotationPanel); + g.drawImage(fadedImage, 0, y - row.height, imgWidth, y, 0, + y - row.height, imgWidth, y, annotationPanel); g.setColor(Color.black); // g.drawString("Calculating "+aa[i].label+"....",20, y-row.height/2); @@ -590,15 +629,19 @@ public class AnnotationRenderer * * continue; } */ + // first pass sets up state for drawing continuation from left-hand // column // of startRes + + // flag used for vector rendition + this.glyphLineDrawn = false; x = (startRes == 0) ? 0 : -1; while (x < endRes - startRes) { if (hasHiddenColumns) { - column = hiddenColumns.adjustForHiddenColumns(startRes + x); + column = hiddenColumns.visibleToAbsoluteColumn(startRes + x); if (column > row_annotations.length - 1) { break; @@ -619,10 +662,12 @@ public class AnnotationRenderer { validRes = true; } - final String displayChar = validRes ? row_annotations[column].displayCharacter + final String displayChar = validRes + ? row_annotations[column].displayCharacter : null; if (x > -1) { + unsetAntialias(g); if (activeRow == i) { g.setColor(Color.red); @@ -631,77 +676,96 @@ public class AnnotationRenderer { if (columnSelection.contains(column)) { - g.fillRect(x * charWidth, y, charWidth, charHeight); + fillRect(g, x * charWidth, y, charWidth, charHeight); } } } if (row.getInvalidStrucPos() > x) { g.setColor(Color.orange); - g.fillRect(x * charWidth, y, charWidth, charHeight); + fillRect(g, x * charWidth, y, charWidth, charHeight); } else if (row.getInvalidStrucPos() == x) { g.setColor(Color.orange.darker()); - g.fillRect(x * charWidth, y, charWidth, charHeight); + fillRect(g, x * charWidth, y, charWidth, charHeight); } if (validCharWidth && validRes && displayChar != null && (displayChar.length() > 0)) { - - fmWidth = fm.charsWidth(displayChar.toCharArray(), 0, + // Graphics2D gg = (g); + float fmWidth = fm.charsWidth(displayChar.toCharArray(), 0, displayChar.length()); - if (/* centreColLabels || */scaleColLabel) + + /* + * shrink label width to fit in column, if that is + * both configured and necessary + */ + boolean scaledToFit = false; + float fmScaling = 1f; + if (scaleColLabel && fmWidth > charWidth) { - // fmWidth = fm.charsWidth(displayChar.toCharArray(), 0, - // displayChar.length()); - // - // if (scaleColLabel) - // { - // justify the label and scale to fit in column - if (fmWidth > charWidth) - { - // scale only if the current font isn't already small enough - fmScaling = charWidth; - fmScaling /= fmWidth; - g.setFont(ofont.deriveFont(AffineTransform - .getScaleInstance(fmScaling, 1.0))); - // and update the label's width to reflect the scaling. - fmWidth = charWidth; - } - // } + scaledToFit = true; + fmScaling = charWidth; + fmScaling /= fmWidth; + // and update the label's width to reflect the scaling. + fmWidth = charWidth; } - // TODO is it ok to use width of / show all characters here? - // else - // { - // fmWidth = fm.charWidth(displayChar.charAt(0)); - // } + charOffset = (int) ((charWidth - fmWidth) / 2f); if (row_annotations[column].colour == null) { - g.setColor(Color.black); + g2d.setColor(Color.black); } else { - g.setColor(row_annotations[column].colour); + g2d.setColor(row_annotations[column].colour); } + /* + * draw the label, unless it is the same secondary structure + * symbol (excluding RNA Helix) as the previous column + */ + final int xPos = (x * charWidth) + charOffset; + final int yPos = y + iconOffset; + + /* + * translate to drawing position _before_ applying any scaling + */ + g2d.translate(xPos, yPos); + if (scaledToFit) + { + /* + * use a scaling transform to make the label narrower + * (JalviewJS doesn't have Font.deriveFont(AffineTransform)) + */ + g2d.transform( + AffineTransform.getScaleInstance(fmScaling, 1.0)); + } + setAntialias(g); if (column == 0 || row.graph > 0) { - g.drawString(displayChar, (x * charWidth) + charOffset, y - + iconOffset); + g2d.drawString(displayChar, 0, 0); } - else if (row_annotations[column - 1] == null - || (labelAllCols - || !displayChar - .equals(row_annotations[column - 1].displayCharacter) || (displayChar - .length() < 2 && row_annotations[column].secondaryStructure == ' '))) + else if (row_annotations[column - 1] == null || (labelAllCols + || !displayChar.equals( + row_annotations[column - 1].displayCharacter) + || (displayChar.length() < 2 + && row_annotations[column].secondaryStructure == ' '))) { - g.drawString(displayChar, x * charWidth + charOffset, y - + iconOffset); + g2d.drawString(displayChar, 0, 0); } - g.setFont(ofont); + if (scaledToFit) + { + /* + * undo scaling before translating back + * (restoring saved transform does NOT work in JS PDFGraphics!) + */ + g2d.transform(AffineTransform + .getScaleInstance(1D / fmScaling, 1.0)); + } + g2d.translate(-xPos, -yPos); } } if (row.hasIcons) @@ -762,15 +826,17 @@ public class AnnotationRenderer if (x > -1) { - int nb_annot = x - temp; - // System.out.println("\t type :"+lastSS+"\t x :"+x+"\t nbre annot :"+nb_annot); + // int nb_annot = x - temp; + // Console.info("\t type :"+lastSS+"\t x + // :"+x+"\t nbre + // annot :"+nb_annot); switch (lastSS) { case '(': // Stem case for RNA secondary structure case ')': // and opposite direction drawStemAnnot(g, row_annotations, lastSSX, x, y, iconOffset, startRes, column, validRes, validEnd); - temp = x; + // temp = x; break; case 'H': @@ -853,13 +919,20 @@ public class AnnotationRenderer drawNotCanonicalAnnot(g, nonCanColor, row_annotations, lastSSX, x, y, iconOffset, startRes, column, validRes, validEnd); - temp = x; + // temp = x; break; default: - g.setColor(Color.gray); - g.fillRect(lastSSX, y + 6 + iconOffset, (x * charWidth) - - lastSSX, 2); - temp = x; + if (isVectorRendering()) + { + // draw single full width glyphline + drawGlyphLine(g, lastSSX, endRes - x, y, iconOffset); + // disable more glyph lines + this.glyphLineDrawn = true; + } + else + { + drawGlyphLine(g, lastSSX, x, y, iconOffset); + } break; } } @@ -984,14 +1057,23 @@ public class AnnotationRenderer case 'y': case 'Z': case 'z': - // System.out.println(lastSS); + // Console.info(lastSS); Color nonCanColor = getNotCanonicalColor(lastSS); drawNotCanonicalAnnot(g, nonCanColor, row_annotations, lastSSX, x, y, iconOffset, startRes, column, validRes, validEnd); break; default: - drawGlyphLine(g, row_annotations, lastSSX, x, y, iconOffset, - startRes, column, validRes, validEnd); + if (isVectorRendering()) + { + // draw single full width glyphline + drawGlyphLine(g, lastSSX, endRes - x, y, iconOffset); + // disable more glyph lines + this.glyphLineDrawn = true; + } + else + { + drawGlyphLine(g, lastSSX, x, y, iconOffset); + } break; } } @@ -1055,22 +1137,22 @@ public class AnnotationRenderer .getRendererFor(row); if (renderer != null) { - renderer.renderRow(g, charWidth, charHeight, - hasHiddenColumns, av, hiddenColumns, columnSelection, - row, row_annotations, startRes, endRes, row.graphMin, + renderer.renderRow(g, charWidth, charHeight, hasHiddenColumns, + av, hiddenColumns, columnSelection, row, + row_annotations, startRes, endRes, row.graphMin, row.graphMax, y); } if (debugRedraw) { if (renderer == null) { - System.err.println("No renderer found for " - + row.toString()); + System.err + .println("No renderer found for " + row.toString()); } else { - System.err.println("rendered with " - + renderer.getClass().toString()); + Console.warn( + "rendered with " + renderer.getClass().toString()); } } @@ -1083,7 +1165,7 @@ public class AnnotationRenderer { clipend = true; } - }// end if_in_visible_region + } // end if_in_visible_region if (row.graph > 0 && row.hasText) { y += charHeight; @@ -1100,17 +1182,15 @@ public class AnnotationRenderer { if (clipst) { - System.err.println("Start clip at : " + yfrom + " (index " + f_i - + ")"); + Console.warn("Start clip at : " + yfrom + " (index " + f_i + ")"); } if (clipend) { - System.err.println("End clip at : " + yto + " (index " + f_to - + ")"); + Console.warn("End clip at : " + yto + " (index " + f_to + ")"); } } ; - System.err.println("Annotation Rendering time:" + Console.warn("Annotation Rendering time:" + (System.currentTimeMillis() - stime)); } ; @@ -1126,65 +1206,80 @@ public class AnnotationRenderer public static final Color STEM_COLOUR = Color.blue; - private Color sdNOTCANONICAL_COLOUR; + // private Color sdNOTCANONICAL_COLOUR; - void drawGlyphLine(Graphics g, Annotation[] row, int lastSSX, int x, - int y, int iconOffset, int startRes, int column, - boolean validRes, boolean validEnd) + void drawGlyphLine(Graphics g, int lastSSX, int x, int y, int iconOffset) { + if (glyphLineDrawn) + { + // if we've drawn a single long glyphline for an export, don't draw the + // bits + return; + } + unsetAntialias(g); g.setColor(GLYPHLINE_COLOR); g.fillRect(lastSSX, y + 6 + iconOffset, (x * charWidth) - lastSSX, 2); } void drawSheetAnnot(Graphics g, Annotation[] row, - int lastSSX, int x, int y, int iconOffset, int startRes, int column, - boolean validRes, boolean validEnd) + int lastSSX, int x, int y, int iconOffset, int startRes, + int column, boolean validRes, boolean validEnd) { - g.setColor(SHEET_COLOUR); - if (!validEnd || !validRes || row == null || row[column] == null || row[column].secondaryStructure != 'E') { - g.fillRect(lastSSX, y + 4 + iconOffset, - (x * charWidth) - lastSSX - 4, 7); - g.fillPolygon(new int[] { (x * charWidth) - 4, (x * charWidth) - 4, - (x * charWidth) }, new int[] { y + iconOffset, - y + 14 + iconOffset, y + 7 + iconOffset }, 3); + // draw the glyphline underneath + drawGlyphLine(g, lastSSX, x, y, iconOffset); + + g.setColor(SHEET_COLOUR); + fillRect(g, lastSSX, y + 4 + iconOffset, + (x * charWidth) - lastSSX - 4, 6); + fillPolygon(g, + new int[] + { (x * charWidth) - 6, (x * charWidth) - 6, + (x * charWidth - 1) }, + new int[] + { y + iconOffset + 1, y + 13 + iconOffset, + y + 7 + iconOffset }, + 3); } else { - g.fillRect(lastSSX, y + 4 + iconOffset, - (x + 1) * charWidth - lastSSX, 7); + g.setColor(SHEET_COLOUR); + fillRect(g, lastSSX, y + 4 + iconOffset, (x * charWidth) - lastSSX, + 6); } - } void drawHelixAnnot(Graphics g, Annotation[] row, int lastSSX, int x, - int y, int iconOffset, int startRes, int column, - boolean validRes, boolean validEnd) + int y, int iconOffset, int startRes, int column, boolean validRes, + boolean validEnd) { - g.setColor(HELIX_COLOUR); - - int sCol = (lastSSX / charWidth) + startRes; + int sCol = (lastSSX / charWidth) + + hiddenColumns.visibleToAbsoluteColumn(startRes); int x1 = lastSSX; int x2 = (x * charWidth); - if (MAC) + if (USE_FILL_ROUND_RECT || isVectorRendering()) { + // draw glyph line behind helix (visible in EPS or SVG output) + drawGlyphLine(g, lastSSX, x, y, iconOffset); + + g.setColor(HELIX_COLOUR); + setAntialias(g); int ofs = charWidth / 2; // Off by 1 offset when drawing rects and ovals // to offscreen image on the MAC - g.fillRoundRect(lastSSX, y + 4 + iconOffset, x2 - x1, 8, 8, 8); + fillRoundRect(g, lastSSX, y + 3 + iconOffset, x2 - x1 - 1, 8, 8, 8); if (sCol == 0 || row[sCol - 1] == null || row[sCol - 1].secondaryStructure != 'H') { } else { - // g.setColor(Color.orange); - g.fillRoundRect(lastSSX, y + 4 + iconOffset, x2 - x1 - ofs + 1, 8, - 0, 0); + fillRoundRect(g, lastSSX, y + 3 + iconOffset, x2 - x1 - ofs, 8, 0, + 0); } if (!validRes || row[column] == null || row[column].secondaryStructure != 'H') @@ -1193,41 +1288,55 @@ public class AnnotationRenderer } else { - // g.setColor(Color.magenta); - g.fillRoundRect(lastSSX + ofs, y + 4 + iconOffset, x2 - x1 - ofs - + 1, 8, 0, 0); - + fillRoundRect(g, lastSSX + ofs, y + 3 + iconOffset, x2 - x1 - ofs, + 8, 0, 0); } return; } - if (sCol == 0 || row[sCol - 1] == null - || row[sCol - 1].secondaryStructure != 'H') + boolean leftEnd = sCol == 0 || row[sCol - 1] == null + || row[sCol - 1].secondaryStructure != 'H'; + boolean rightEnd = !validRes || row[column] == null + || row[column].secondaryStructure != 'H'; + + if (leftEnd || rightEnd) + { + drawGlyphLine(g, lastSSX, x, y, iconOffset); + } + g.setColor(HELIX_COLOUR); + + if (leftEnd) { - g.fillArc(lastSSX, y + 4 + iconOffset, charWidth, 8, 90, 180); + fillArc(g, lastSSX, y + 3 + iconOffset, charWidth, 8, 90, 180); x1 += charWidth / 2; } - if (!validRes || row[column] == null - || row[column].secondaryStructure != 'H') + if (rightEnd) { - g.fillArc((x * charWidth) - charWidth, y + 4 + iconOffset, charWidth, - 8, 270, 180); + fillArc(g, ((x - 1) * charWidth), y + 3 + iconOffset, charWidth, 8, + 270, 180); x2 -= charWidth / 2; } - g.fillRect(x1, y + 4 + iconOffset, x2 - x1, 8); + fillRect(g, x1, y + 3 + iconOffset, x2 - x1, 8); } void drawLineGraph(Graphics g, AlignmentAnnotation _aa, - Annotation[] aa_annotations, int sRes, int eRes, int y, - float min, float max, int graphHeight) + Annotation[] aa_annotations, int sRes, int eRes, int y, float min, + float max, int graphHeight) { if (sRes > aa_annotations.length) { return; } + Stroke roundStroke = new BasicStroke(1, BasicStroke.CAP_ROUND, + BasicStroke.JOIN_ROUND); + Stroke squareStroke = new BasicStroke(1, BasicStroke.CAP_SQUARE, + BasicStroke.JOIN_MITER); + Graphics2D g2d = (Graphics2D) g; + Stroke prevStroke = g2d.getStroke(); + g2d.setStroke(roundStroke); int x = 0; @@ -1254,7 +1363,8 @@ public class AnnotationRenderer } g.setColor(Color.gray); - g.drawLine(x - charWidth, y2, (eRes - sRes + 1) * charWidth, y2); + drawLine(g, squareStroke, x * charWidth - charWidth, y2, + (eRes - sRes) * charWidth, y2); eRes = Math.min(eRes, aa_annotations.length); @@ -1266,7 +1376,7 @@ public class AnnotationRenderer column = sRes + x; if (hasHiddenColumns) { - column = hiddenColumns.adjustForHiddenColumns(column); + column = hiddenColumns.visibleToAbsoluteColumn(column); } if (column > aaMax) @@ -1274,8 +1384,7 @@ public class AnnotationRenderer break; } - if (aa_annotations[column] == null - || aa_annotations[column - 1] == null) + if (aa_annotations[column] == null) { x++; continue; @@ -1290,13 +1399,32 @@ public class AnnotationRenderer g.setColor(aa_annotations[column].colour); } - y1 = y - - (int) (((aa_annotations[column - 1].value - min) / range) * graphHeight); - y2 = y - - (int) (((aa_annotations[column].value - min) / range) * graphHeight); + if (aa_annotations[column - 1] == null + && aa_annotations.length > column + 1 + && aa_annotations[column + 1] == null) + { + // standalone value + y1 = y - (int) (((aa_annotations[column].value - min) / range) + * graphHeight); + drawLine(g, x * charWidth + charWidth / 4, y1, + x * charWidth + 3 * charWidth / 4, y1); + x++; + continue; + } + + if (aa_annotations[column - 1] == null) + { + x++; + continue; + } + + y1 = y - (int) (((aa_annotations[column - 1].value - min) / range) + * graphHeight); + y2 = y - (int) (((aa_annotations[column].value - min) / range) + * graphHeight); - g.drawLine(x * charWidth - charWidth / 2, y1, x * charWidth - + charWidth / 2, y2); + drawLine(g, (x - 1) * charWidth + charWidth / 2, y1, + x * charWidth + charWidth / 2, y2); x++; } @@ -1304,15 +1432,17 @@ public class AnnotationRenderer { g.setColor(_aa.threshold.colour); Graphics2D g2 = (Graphics2D) g; - g2.setStroke(new BasicStroke(1, BasicStroke.CAP_SQUARE, - BasicStroke.JOIN_ROUND, 3f, new float[] { 5f, 3f }, 0f)); + Stroke s = new BasicStroke(1, BasicStroke.CAP_SQUARE, + BasicStroke.JOIN_ROUND, 3f, new float[] + { 5f, 3f }, 0f); y2 = (int) (y - ((_aa.threshold.value - min) / range) * graphHeight); - g.drawLine(0, y2, (eRes - sRes) * charWidth, y2); - g2.setStroke(new BasicStroke()); + drawLine(g, s, 0, y2, (eRes - sRes) * charWidth, y2); } + g2d.setStroke(prevStroke); } + @SuppressWarnings("unused") void drawBarGraph(Graphics g, AlignmentAnnotation _aa, Annotation[] aa_annotations, int sRes, int eRes, float min, float max, int y, boolean renderHistogram, boolean renderProfile, @@ -1336,7 +1466,7 @@ public class AnnotationRenderer g.setColor(Color.gray); - g.drawLine(x, y2, (eRes - sRes) * charWidth, y2); + drawLine(g, x, y2, (eRes - sRes) * charWidth, y2); int column; int aaMax = aa_annotations.length - 1; @@ -1345,7 +1475,7 @@ public class AnnotationRenderer column = sRes + x; if (hasHiddenColumns) { - column = hiddenColumns.adjustForHiddenColumns(column); + column = hiddenColumns.visibleToAbsoluteColumn(column); } if (column > aaMax) @@ -1367,18 +1497,18 @@ public class AnnotationRenderer g.setColor(aa_annotations[column].colour); } - y1 = y - - (int) (((aa_annotations[column].value - min) / (range)) * _aa.graphHeight); + y1 = y - (int) (((aa_annotations[column].value - min) / (range)) + * _aa.graphHeight); if (renderHistogram) { if (y1 - y2 > 0) { - g.fillRect(x * charWidth, y2, charWidth, y1 - y2); + fillRect(g, x * charWidth, y2, charWidth, y1 - y2); } else { - g.fillRect(x * charWidth, y1, charWidth, y2 - y1); + fillRect(g, x * charWidth, y1, charWidth, y2 - y1); } } // draw profile if available @@ -1396,64 +1526,67 @@ public class AnnotationRenderer boolean isStructureProfile = profl[0] == AlignmentAnnotation.STRUCTURE_PROFILE; boolean isCdnaProfile = profl[0] == AlignmentAnnotation.CDNA_PROFILE; float ht = normaliseProfile ? y - _aa.graphHeight : y1; - double htn = normaliseProfile ? _aa.graphHeight : (y2 - y1);// aa.graphHeight; - double hght; - float wdth; - double ht2 = 0; - char[] dc; + final double normaliseFactor = normaliseProfile ? _aa.graphHeight + : (y2 - y1); /** * Render a single base for a sequence profile, a base pair for * structure profile, and a triplet for a cdna profile */ - dc = new char[isStructureProfile ? 2 : (isCdnaProfile ? 3 : 1)]; + char[] dc = new char[isStructureProfile ? 2 + : (isCdnaProfile ? 3 : 1)]; + + // lm is not necessary - we can just use fm - could be off by no more + // than 0.5 px + // LineMetrics lm = g.getFontMetrics(ofont).getLineMetrics("Q", g); + // Console.info(asc + " " + dec + " " + (asc - + // lm.getAscent()) + // + " " + (dec - lm.getDescent())); + + double asc = fm.getAscent(); + double dec = fm.getDescent(); + double fht = fm.getHeight(); - LineMetrics lm = g.getFontMetrics(ofont).getLineMetrics("Q", g); double scale = 1f / (normaliseProfile ? profl[2] : 100f); - float ofontHeight = 1f / lm.getAscent();// magnify to fill box - double scl = 0.0; + // float ofontHeight = 1f / fm.getAscent();// magnify to fill box /* * Traverse the character(s)/percentage data in the array */ - int c = 3; - int valuesProcessed = 0; + + float ht2 = ht; + // profl[1] is the number of values in the profile - while (valuesProcessed < profl[1]) + for (int i = 0, c = 3, last = profl[1]; i < last; i++) { + + String s; if (isStructureProfile) { // todo can we encode a structure pair as an int, like codons? dc[0] = (char) profl[c++]; dc[1] = (char) profl[c++]; + s = new String(dc); } else if (isCdnaProfile) { - dc = CodingUtils.decodeCodon(profl[c++]); + CodingUtils.decodeCodon2(profl[c++], dc); + s = new String(dc); } else { dc[0] = (char) profl[c++]; + s = new String(dc); } - - wdth = charWidth; - wdth /= fm.charsWidth(dc, 0, dc.length); - - ht += scl; // next profl[] position is profile % for the character(s) - scl = htn * scale * profl[c++]; - lm = ofont.getLineMetrics(dc, 0, 1, g.getFontMetrics() - .getFontRenderContext()); - Font font = ofont.deriveFont(AffineTransform.getScaleInstance( - wdth, scl / lm.getAscent())); - g.setFont(font); - lm = g.getFontMetrics().getLineMetrics(dc, 0, 1, g); - // Debug - render boxes around characters - // g.setColor(Color.red); - // g.drawRect(x*av.charWidth, (int)ht, av.charWidth, - // (int)(scl)); - // g.setColor(profcolour.findColour(dc[0]).darker()); + int percent = profl[c++]; + if (percent == 0) + { + // failsafe in case a count rounds down to 0% + continue; + } + double newHeight = normaliseFactor * scale * percent; /* * Set character colour as per alignment colour scheme; use the @@ -1463,7 +1596,7 @@ public class AnnotationRenderer if (isCdnaProfile) { final String codonTranslation = ResidueProperties - .codonTranslate(new String(dc)); + .codonTranslate(s); colour = profcolour.findColour(codonTranslation.charAt(0), column, null); } @@ -1473,13 +1606,58 @@ public class AnnotationRenderer } g.setColor(colour == Color.white ? Color.lightGray : colour); - hght = (ht + (scl - lm.getDescent() - lm.getBaselineOffsets()[lm - .getBaselineIndex()])); + // Debug - render boxes around characters + // g.setColor(Color.red); + // g.drawRect(x*av.charWidth, (int)ht, av.charWidth, + // (int)(scl)); + // g.setColor(profcolour.findColour(dc[0]).darker()); + + double sx = 1f * charWidth / fm.charsWidth(dc, 0, dc.length); + double sy = newHeight / asc; + double newAsc = asc * sy; + double newDec = dec * sy; + // it is not necessary to recalculate lm for the new font. + // note: lm.getBaselineOffsets()[lm.getBaselineIndex()]) must be 0 + // by definition. Was: + // int hght = (int) (ht + (newAsc - newDec); + // - lm.getBaselineOffsets()[lm.getBaselineIndex()])); + + if (Platform.isJS()) + { + /* + * SwingJS does not implement font.deriveFont() + * so use a scaling transform to draw instead, + * this is off by a very small amount + */ + final int hght = (int) (ht2 + (newAsc - newDec)); + Graphics2D gg = (Graphics2D) g; + int xShift = (int) Math.round(x * charWidth / sx); + int yShift = (int) Math.round(hght / sy); + gg.transform(AffineTransform.getScaleInstance(sx, sy)); + gg.drawString(s, xShift, yShift); + gg.transform( + AffineTransform.getScaleInstance(1D / sx, 1D / sy)); + ht2 += newHeight; + } + else + /** + * Java only + * + * @j2sIgnore + */ + { + // Java ('normal') method is to scale the font to fit + + final int hght = (int) (ht + (newAsc - newDec)); + Font font = ofont + .deriveFont(AffineTransform.getScaleInstance(sx, sy)); + g.setFont(font); + g.drawChars(dc, 0, dc.length, x * charWidth, hght); + g.setFont(ofont); - g.drawChars(dc, 0, dc.length, x * charWidth, (int) hght); - valuesProcessed++; + ht += newHeight; + } } - g.setFont(ofont); } } x++; @@ -1487,14 +1665,13 @@ public class AnnotationRenderer if (_aa.threshold != null) { g.setColor(_aa.threshold.colour); - Graphics2D g2 = (Graphics2D) g; - g2.setStroke(new BasicStroke(1, BasicStroke.CAP_SQUARE, - BasicStroke.JOIN_ROUND, 3f, new float[] { 5f, 3f }, 0f)); + Stroke s = new BasicStroke(1, BasicStroke.CAP_SQUARE, + BasicStroke.JOIN_ROUND, 3f, new float[] + { 5f, 3f }, 0f); - y2 = (int) (y - ((_aa.threshold.value - min) / range) - * _aa.graphHeight); - g.drawLine(0, y2, (eRes - sRes) * charWidth, y2); - g2.setStroke(new BasicStroke()); + y2 = (int) (y + - ((_aa.threshold.value - min) / range) * _aa.graphHeight); + drawLine(g, s, 0, y2, (eRes - sRes) * charWidth, y2); } } @@ -1504,7 +1681,7 @@ public class AnnotationRenderer { eRes = Math.min(eRes, aa_annotations.length); g.setColor(Color.white); - g.fillRect(0, 0, width, y); + fillRect(g, 0, 0, width, y); g.setColor(new Color(0, 0, 180)); int x = 0, height; @@ -1528,7 +1705,7 @@ public class AnnotationRenderer height = y; } - g.fillRect(x, y - height, charWidth, height); + fillRect(g, x, y - height, charWidth, height); } x += charWidth; } @@ -1655,9 +1832,92 @@ public class AnnotationRenderer return new Color(0, 80, 255); default: - System.out.println("This is not a interaction : " + lastss); + Console.info("This is not a interaction : " + lastss); return null; } } + + private void fillPolygon(Graphics g, int[] xpoints, int[] ypoints, int n) + { + setAntialias(g); + g.fillPolygon(xpoints, ypoints, n); + } + + /* + private void fillRect(Graphics g, int a, int b, int c, int d) + { + fillRect(g, false, a, b, c, d); + }*/ + + private void fillRect(Graphics g, int a, int b, int c, int d) + { + unsetAntialias(g); + g.fillRect(a, b, c, d); + } + + private void fillRoundRect(Graphics g, int a, int b, int c, int d, int e, + int f) + { + setAntialias(g); + g.fillRoundRect(a, b, c, d, e, f); + } + + private void fillArc(Graphics g, int a, int b, int c, int d, int e, int f) + { + setAntialias(g); + g.fillArc(a, b, c, d, e, f); + } + + private void drawLine(Graphics g, Stroke s, int a, int b, int c, int d) + { + Graphics2D g2d = (Graphics2D) g; + Stroke p = g2d.getStroke(); + g2d.setStroke(s); + drawLine(g, a, b, c, d); + g2d.setStroke(p); + } + + private void drawLine(Graphics g, int a, int b, int c, int d) + { + setAntialias(g); + g.drawLine(a, b, c, d); + } + + private void setAntialias(Graphics g) + { + if (isVectorRendering()) + { + // no need to antialias vector drawings + return; + } + if (Cache.getDefault("ANTI_ALIAS", true)) + { + Graphics2D g2d = (Graphics2D) g; + g2d.setRenderingHint(RenderingHints.KEY_ANTIALIASING, + RenderingHints.VALUE_ANTIALIAS_ON); + } + } + + private void unsetAntialias(Graphics g) + { + if (isVectorRendering()) + { + // no need to antialias vector drawings + return; + } + Graphics2D g2d = (Graphics2D) g; + g2d.setRenderingHint(RenderingHints.KEY_ANTIALIASING, + RenderingHints.VALUE_ANTIALIAS_OFF); + } + + public void setVectorRendering(boolean b) + { + renderingVectors = b; + } + + public boolean isVectorRendering() + { + return renderingVectors; + } }