/*
- * Jalview - A Sequence Alignment Editor and Viewer (Version 2.8)
- * Copyright (C) 2012 J Procter, AM Waterhouse, LM Lui, J Engelhardt, G Barton, M Clamp, S Searle
+ * Jalview - A Sequence Alignment Editor and Viewer ($$Version-Rel$$)
+ * Copyright (C) $$Year-Rel$$ The Jalview Authors
*
* This file is part of Jalview.
*
* Jalview is free software: you can redistribute it and/or
* modify it under the terms of the GNU General Public License
- * as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version.
+ * as published by the Free Software Foundation, either version 3
+ * of the License, or (at your option) any later version.
*
* Jalview is distributed in the hope that it will be useful, but
* WITHOUT ANY WARRANTY; without even the implied warranty
* of MERCHANTABILITY or FITNESS FOR A PARTICULAR
* PURPOSE. See the GNU General Public License for more details.
*
- * You should have received a copy of the GNU General Public License along with Jalview. If not, see <http://www.gnu.org/licenses/>.
+ * You should have received a copy of the GNU General Public License
+ * along with Jalview. If not, see <http://www.gnu.org/licenses/>.
+ * The Jalview Authors are detailed in the 'AUTHORS' file.
*/
package jalview.renderer;
-import jalview.analysis.AAFrequency;
-import jalview.analysis.StructureFrequency;
-import jalview.api.AlignViewportI;
-import jalview.datamodel.AlignmentAnnotation;
-import jalview.datamodel.Annotation;
-import jalview.datamodel.ColumnSelection;
-import jalview.schemes.ColourSchemeI;
-
import java.awt.BasicStroke;
import java.awt.Color;
import java.awt.Font;
import java.awt.Graphics;
import java.awt.Graphics2D;
import java.awt.Image;
-import java.awt.font.LineMetrics;
+import java.awt.RenderingHints;
+import java.awt.Stroke;
import java.awt.geom.AffineTransform;
import java.awt.image.ImageObserver;
import java.util.BitSet;
import java.util.Hashtable;
-import com.stevesoft.pat.Regex;
+import org.jfree.graphics2d.svg.SVGGraphics2D;
+import org.jibble.epsgraphics.EpsGraphics2D;
+
+import jalview.analysis.AAFrequency;
+import jalview.analysis.CodingUtils;
+import jalview.analysis.Rna;
+import jalview.analysis.StructureFrequency;
+import jalview.api.AlignViewportI;
+import jalview.bin.Cache;
+import jalview.bin.Console;
+import jalview.datamodel.AlignmentAnnotation;
+import jalview.datamodel.Annotation;
+import jalview.datamodel.ColumnSelection;
+import jalview.datamodel.HiddenColumns;
+import jalview.datamodel.ProfilesI;
+import jalview.renderer.api.AnnotationRendererFactoryI;
+import jalview.renderer.api.AnnotationRowRendererI;
+import jalview.schemes.ColourSchemeI;
+import jalview.schemes.NucleotideColourScheme;
+import jalview.schemes.ResidueProperties;
+import jalview.schemes.ZappoColourScheme;
+import jalview.util.Platform;
public class AnnotationRenderer
{
+ private static final int UPPER_TO_LOWER = 'a' - 'A'; // 32
+
+ private static final int CHAR_A = 'A'; // 65
+
+ private static final int CHAR_Z = 'Z'; // 90
+
/**
* flag indicating if timing and redraw parameter info should be output
*/
private final boolean debugRedraw;
- public AnnotationRenderer()
- {
- this(false);
- }
- /**
- * Create a new annotation Renderer
- * @param debugRedraw flag indicating if timing and redraw parameter info should be output
- */
- public AnnotationRenderer(boolean debugRedraw)
- {
- this.debugRedraw=debugRedraw;
- }
-
- public void drawStemAnnot(Graphics g, Annotation[] row_annotations,
- int lastSSX, int x, int y, int iconOffset, int startRes,
- int column, boolean validRes, boolean validEnd)
- {
- g.setColor(STEM_COLOUR);
- int sCol = (lastSSX / charWidth) + startRes;
- int x1 = lastSSX;
- int x2 = (x * charWidth);
- Regex closeparen = new Regex("(\\))");
-
- String dc = (column == 0 || row_annotations[column - 1] == null) ? ""
- : row_annotations[column - 1].displayCharacter;
-
- boolean diffupstream = sCol == 0 || row_annotations[sCol - 1] == null
- || !dc.equals(row_annotations[sCol - 1].displayCharacter);
- boolean diffdownstream = !validRes || !validEnd
- || row_annotations[column] == null
- || !dc.equals(row_annotations[column].displayCharacter);
- // System.out.println("Column "+column+" diff up: "+diffupstream+" down:"+diffdownstream);
- // If a closing base pair half of the stem, display a backward arrow
- if (column > 0 && closeparen.search(dc))
- {
-
- if (diffupstream)
- // if (validRes && column>1 && row_annotations[column-2]!=null &&
- // dc.equals(row_annotations[column-2].displayCharacter))
- {
- g.fillPolygon(new int[]
- { lastSSX + 5, lastSSX + 5, lastSSX }, new int[]
- { y + iconOffset, y + 14 + iconOffset, y + 8 + iconOffset }, 3);
- x1 += 5;
- }
- if (diffdownstream)
- {
- x2 -= 1;
- }
- }
- else
- {
-
- // display a forward arrow
- if (diffdownstream)
- {
- g.fillPolygon(new int[]
- { x2 - 5, x2 - 5, x2 }, new int[]
- { y + iconOffset, y + 14 + iconOffset, y + 8 + iconOffset }, 3);
- x2 -= 5;
- }
- if (diffupstream)
- {
- x1 += 1;
- }
- }
- // draw arrow body
- g.fillRect(x1, y + 4 + iconOffset, x2 - x1, 7);
- }
-
private int charWidth, endRes, charHeight;
private boolean validCharWidth, hasHiddenColumns;
private FontMetrics fm;
- private final boolean MAC = new jalview.util.Platform().isAMac();
+ private final boolean USE_FILL_ROUND_RECT = Platform.isAMacAndNotJS();
boolean av_renderHistogram = true, av_renderProfile = true,
av_normaliseProfile = false;
- ColourSchemeI profcolour = null;
+ ResidueShaderI profcolour = null;
private ColumnSelection columnSelection;
- private Hashtable[] hconsensus;
+ private HiddenColumns hiddenColumns;
+
+ private ProfilesI hconsensus;
- private Hashtable[] hStrucConsensus;
+ private Hashtable<String, Object>[] complementConsensus;
+
+ private Hashtable<String, Object>[] hStrucConsensus;
private boolean av_ignoreGapsConsensus;
+ private boolean renderingVectors = false;
+
+ private boolean glyphLineDrawn = false;
+
/**
* attributes set from AwtRenderPanelI
*/
* width of image to render in panel
*/
private int imgWidth;
+
/**
* offset to beginning of visible area
*/
private int sOffset;
+
/**
* offset to end of visible area
*/
private int visHeight;
+
/**
- * indicate if the renderer should only render the visible portion of the annotation given the current view settings
+ * indicate if the renderer should only render the visible portion of the
+ * annotation given the current view settings
*/
- private boolean useClip=true;
+ private boolean useClip = true;
+
/**
- * master flag indicating if renderer should ever try to clip. not enabled for jalview 2.8.1
+ * master flag indicating if renderer should ever try to clip. not enabled for
+ * jalview 2.8.1
*/
- private boolean canClip=false;
+ private boolean canClip = false;
-
- public void drawNotCanonicalAnnot(Graphics g, Color nonCanColor, Annotation[] row_annotations,
- int lastSSX, int x, int y, int iconOffset, int startRes,
- int column, boolean validRes, boolean validEnd)
+ public AnnotationRenderer()
{
- //System.out.println(nonCanColor);
-
- g.setColor(nonCanColor);
- int sCol = (lastSSX / charWidth) + startRes;
+ this(false);
+ }
+
+ /**
+ * Create a new annotation Renderer
+ *
+ * @param debugRedraw
+ * flag indicating if timing and redraw parameter info should be
+ * output
+ */
+ public AnnotationRenderer(boolean debugRedraw)
+ {
+ this.debugRedraw = debugRedraw;
+ }
+
+ /**
+ * Remove any references and resources when this object is no longer required
+ */
+ public void dispose()
+ {
+ hiddenColumns = null;
+ hconsensus = null;
+ complementConsensus = null;
+ hStrucConsensus = null;
+ fadedImage = null;
+ annotationPanel = null;
+ rendererFactoryI = null;
+ }
+
+ void drawStemAnnot(Graphics g, Annotation[] row_annotations, int lastSSX,
+ int x, int y, int iconOffset, int startRes, int column,
+ boolean validRes, boolean validEnd)
+ {
+ int sCol = (lastSSX / charWidth)
+ + hiddenColumns.visibleToAbsoluteColumn(startRes);
int x1 = lastSSX;
int x2 = (x * charWidth);
- Regex closeparen = new Regex("}|]|<|[a-z]");
-
+
+ char dc = (column == 0 || row_annotations[column - 1] == null) ? ' '
+ : row_annotations[column - 1].secondaryStructure;
+
+ boolean diffupstream = sCol == 0 || row_annotations[sCol - 1] == null
+ || dc != row_annotations[sCol - 1].secondaryStructure
+ || !validEnd;
+ boolean diffdownstream = !validRes || !validEnd
+ || row_annotations[column] == null
+ || dc != row_annotations[column].secondaryStructure;
+
+ if (diffupstream || diffdownstream)
+ {
+ // draw glyphline under arrow
+ drawGlyphLine(g, lastSSX, x, y, iconOffset);
+ }
+ g.setColor(STEM_COLOUR);
+
+ if (column > 0 && Rna.isClosingParenthesis(dc))
+ {
+ if (diffupstream)
+ // if (validRes && column>1 && row_annotations[column-2]!=null &&
+ // dc.equals(row_annotations[column-2].displayCharacter))
+ {
+ /*
+ * if new annotation with a closing base pair half of the stem,
+ * display a backward arrow
+ */
+ fillPolygon(g, new int[] { lastSSX + 5, lastSSX + 5, lastSSX },
+ new int[]
+ { y + iconOffset + 1, y + 13 + iconOffset,
+ y + 7 + iconOffset },
+ 3);
+ x1 += 5;
+ }
+ if (diffdownstream)
+ {
+ x2 -= 1;
+ }
+ }
+ else
+ {
+ // display a forward arrow
+ if (diffdownstream)
+ {
+ /*
+ * if annotation ending with an opeing base pair half of the stem,
+ * display a forward arrow
+ */
+ fillPolygon(g, new int[] { x2 - 6, x2 - 6, x2 - 1 },
+ new int[]
+ { y + iconOffset + 1, y + 13 + iconOffset,
+ y + 7 + iconOffset },
+ 3);
+ x2 -= 5;
+ }
+ if (diffupstream)
+ {
+ x1 += 1;
+ }
+ }
+ // draw arrow body
+ unsetAntialias(g);
+ fillRect(g, x1, y + 4 + iconOffset, x2 - x1, 6);
+ }
+
+ void drawNotCanonicalAnnot(Graphics g, Color nonCanColor,
+ Annotation[] row_annotations, int lastSSX, int x, int y,
+ int iconOffset, int startRes, int column, boolean validRes,
+ boolean validEnd)
+ {
+ // Console.info(nonCanColor);
+
+ int sCol = (lastSSX / charWidth)
+ + hiddenColumns.visibleToAbsoluteColumn(startRes);
+ int x1 = lastSSX;
+ int x2 = (x * charWidth);
+
String dc = (column == 0 || row_annotations[column - 1] == null) ? ""
: row_annotations[column - 1].displayCharacter;
boolean diffupstream = sCol == 0 || row_annotations[sCol - 1] == null
- || !dc.equals(row_annotations[sCol - 1].displayCharacter);
+ || !dc.equals(row_annotations[sCol - 1].displayCharacter)
+ || !validEnd;
boolean diffdownstream = !validRes || !validEnd
|| row_annotations[column] == null
|| !dc.equals(row_annotations[column].displayCharacter);
- // System.out.println("Column "+column+" diff up: "+diffupstream+" down:"+diffdownstream);
+ // Console.info("Column "+column+" diff up:
+ // "+diffupstream+"
+ // down:"+diffdownstream);
// If a closing base pair half of the stem, display a backward arrow
- if (column > 0 && closeparen.search(dc))// closeletter_b.search(dc)||closeletter_c.search(dc)||closeletter_d.search(dc)||closecrochet.search(dc)) )
+ if (diffupstream || diffdownstream)
{
-
+ // draw glyphline under arrow
+ drawGlyphLine(g, lastSSX, x, y, iconOffset);
+ }
+ g.setColor(nonCanColor);
+ if (column > 0 && Rna.isClosingParenthesis(dc))
+ {
+
if (diffupstream)
// if (validRes && column>1 && row_annotations[column-2]!=null &&
// dc.equals(row_annotations[column-2].displayCharacter))
{
- g.fillPolygon(new int[]
- { lastSSX + 5, lastSSX + 5, lastSSX }, new int[]
- { y + iconOffset, y + 14 + iconOffset, y + 8 + iconOffset }, 3);
+ fillPolygon(g, new int[] { lastSSX + 5, lastSSX + 5, lastSSX },
+ new int[]
+ { y + iconOffset + 1, y + 13 + iconOffset,
+ y + 7 + iconOffset },
+ 3);
x1 += 5;
}
if (diffdownstream)
}
else
{
-
+
// display a forward arrow
if (diffdownstream)
{
- g.fillPolygon(new int[]
- { x2 - 5, x2 - 5, x2 }, new int[]
- { y + iconOffset, y + 14 + iconOffset, y + 8 + iconOffset }, 3);
+ fillPolygon(g, new int[] { x2 - 6, x2 - 6, x2 - 1 },
+ new int[]
+ { y + iconOffset + 1, y + 13 + iconOffset,
+ y + 7 + iconOffset },
+ 3);
x2 -= 5;
}
if (diffupstream)
}
}
// draw arrow body
- g.fillRect(x1, y + 4 + iconOffset, x2 - x1, 7);
+ unsetAntialias(g);
+ fillRect(g, x1, y + 4 + iconOffset, x2 - x1, 6);
}
+
// public void updateFromAnnotationPanel(FontMetrics annotFM, AlignViewportI
// av)
public void updateFromAwtRenderPanel(AwtRenderPanelI annotPanel,
fadedImage = annotPanel.getFadedImage();
imgWidth = annotPanel.getFadedImageWidth();
// visible area for rendering
- int[] bounds=annotPanel.getVisibleVRange();
- if (bounds!=null)
+ int[] bounds = annotPanel.getVisibleVRange();
+ if (bounds != null)
{
sOffset = bounds[0];
visHeight = bounds[1];
- if (visHeight==0)
+ if (visHeight == 0)
{
- useClip=false;
- } else {
- useClip=canClip;
+ useClip = false;
+ }
+ else
+ {
+ useClip = canClip;
}
- } else {
- useClip=false;
+ }
+ else
+ {
+ useClip = false;
}
+ rendererFactoryI = AnnotationRendererFactory.getRendererFactory();
updateFromAlignViewport(av);
}
public void updateFromAlignViewport(AlignViewportI av)
{
charWidth = av.getCharWidth();
- endRes = av.getEndRes();
+ endRes = av.getRanges().getEndRes();
charHeight = av.getCharHeight();
hasHiddenColumns = av.hasHiddenColumns();
validCharWidth = av.isValidCharWidth();
av_renderHistogram = av.isShowConsensusHistogram();
av_renderProfile = av.isShowSequenceLogo();
av_normaliseProfile = av.isNormaliseSequenceLogo();
- profcolour = av.getGlobalColourScheme();
- if (profcolour == null)
+ profcolour = av.getResidueShading();
+ if (profcolour == null || profcolour.getColourScheme() == null)
{
- // Set the default colour for sequence logo if the alignnent has no
- // colourscheme set
- profcolour = av.getAlignment().isNucleotide() ? new jalview.schemes.NucleotideColourScheme()
- : new jalview.schemes.ZappoColourScheme();
+ /*
+ * Use default colour for sequence logo if
+ * the alignment has no colourscheme set
+ * (would like to use user preference but n/a for applet)
+ */
+ ColourSchemeI col = av.getAlignment().isNucleotide()
+ ? new NucleotideColourScheme()
+ : new ZappoColourScheme();
+ profcolour = new ResidueShader(col);
}
columnSelection = av.getColumnSelection();
- hconsensus = av.getSequenceConsensusHash();// hconsensus;
- hStrucConsensus = av.getRnaStructureConsensusHash(); // hStrucConsensus;
- av_ignoreGapsConsensus = av.getIgnoreGapsConsensus();
+ hiddenColumns = av.getAlignment().getHiddenColumns();
+ hconsensus = av.getSequenceConsensusHash();
+ complementConsensus = av.getComplementConsensusHash();
+ hStrucConsensus = av.getRnaStructureConsensusHash();
+ av_ignoreGapsConsensus = av.isIgnoreGapsConsensus();
}
- public int[] getProfileFor(AlignmentAnnotation aa, int column)
+ /**
+ * Returns profile data; the first element is the profile type, the second is
+ * the number of distinct values, the third the total count, and the remainder
+ * depend on the profile type.
+ *
+ * @param aa
+ * @param column
+ * @return
+ */
+ int[] getProfileFor(AlignmentAnnotation aa, int column)
{
// TODO : consider refactoring the global alignment calculation
// properties/rendering attributes as a global 'alignment group' which holds
// all vis settings for the alignment as a whole rather than a subset
//
- if (aa.autoCalculated && aa.label.startsWith("Consensus"))
+ if (aa.autoCalculated && (aa.label.startsWith("Consensus")
+ || aa.label.startsWith("cDNA Consensus")))
{
+ boolean forComplement = aa.label.startsWith("cDNA Consensus");
if (aa.groupRef != null && aa.groupRef.consensusData != null
&& aa.groupRef.isShowSequenceLogo())
{
+ // TODO? group consensus for cDNA complement
return AAFrequency.extractProfile(
- aa.groupRef.consensusData[column],
+ aa.groupRef.consensusData.get(column),
aa.groupRef.getIgnoreGapsConsensus());
}
// TODO extend annotation row to enable dynamic and static profile data to
// be stored
if (aa.groupRef == null && aa.sequenceRef == null)
{
- return AAFrequency.extractProfile(hconsensus[column],
- av_ignoreGapsConsensus);
+ if (forComplement)
+ {
+ return AAFrequency.extractCdnaProfile(complementConsensus[column],
+ av_ignoreGapsConsensus);
+ }
+ else
+ {
+ return AAFrequency.extractProfile(hconsensus.get(column),
+ av_ignoreGapsConsensus);
+ }
}
}
else
return null;
}
+ boolean rna = false;
+
+ private AnnotationRendererFactoryI rendererFactoryI;
+
/**
* Render the annotation rows associated with an alignment.
*
AlignViewportI av, Graphics g, int activeRow, int startRes,
int endRes)
{
- long stime=System.currentTimeMillis();
+ if (g instanceof EpsGraphics2D || g instanceof SVGGraphics2D)
+ {
+ this.setVectorRendering(true);
+ }
+ Graphics2D g2d = (Graphics2D) g;
+
+ long stime = System.currentTimeMillis();
boolean usedFaded = false;
// NOTES:
// AnnotationPanel needs to implement: ImageObserver, access to
updateFromAwtRenderPanel(annotPanel, av);
fm = g.getFontMetrics();
AlignmentAnnotation[] aa = av.getAlignment().getAlignmentAnnotation();
- int temp = 0;
- if (aa==null)
+ // int temp = 0;
+ if (aa == null)
{
return false;
}
boolean validRes = false;
boolean validEnd = false;
boolean labelAllCols = false;
- boolean centreColLabels, centreColLabelsDef = av
- .getCentreColumnLabels();
+ // boolean centreColLabels;
+ // boolean centreColLabelsDef = av.isCentreColumnLabels();
boolean scaleColLabel = false;
- AlignmentAnnotation consensusAnnot=av.getAlignmentConsensusAnnotation(),structConsensusAnnot=av.getAlignmentStrucConsensusAnnotation();
- boolean renderHistogram = true, renderProfile = true, normaliseProfile = false;
+ final AlignmentAnnotation consensusAnnot = av
+ .getAlignmentConsensusAnnotation();
+ final AlignmentAnnotation structConsensusAnnot = av
+ .getAlignmentStrucConsensusAnnotation();
+ final AlignmentAnnotation complementConsensusAnnot = av
+ .getComplementConsensusAnnotation();
BitSet graphGroupDrawn = new BitSet();
int charOffset = 0; // offset for a label
- float fmWidth, fmScaling = 1f; // scaling for a label to fit it into a
- // column.
- Font ofont = g.getFont();
// \u03B2 \u03B1
// debug ints
- int yfrom=0,f_i=0,yto=0,f_to=0;
- boolean clipst=false,clipend=false;
+ int yfrom = 0, f_i = 0, yto = 0, f_to = 0;
+ boolean clipst = false, clipend = false;
for (int i = 0; i < aa.length; i++)
{
AlignmentAnnotation row = aa[i];
+ boolean renderHistogram = true;
+ boolean renderProfile = false;
+ boolean normaliseProfile = false;
+ boolean isRNA = row.isRNA();
+
+ // check if this is a consensus annotation row and set the display
+ // settings appropriately
+ // TODO: generalise this to have render styles for consensus/profile
+ // data
+ if (row.groupRef != null && row == row.groupRef.getConsensus())
{
- // check if this is a consensus annotation row and set the display settings appropriately
- // TODO: generalise this to have render styles for consensus/profile
- // data
- if (row.groupRef != null && row == row.groupRef.getConsensus())
- {
- renderHistogram = row.groupRef.isShowConsensusHistogram();
- renderProfile = row.groupRef.isShowSequenceLogo();
- normaliseProfile = row.groupRef.isNormaliseSequenceLogo();
- }
- else if (row == consensusAnnot || row == structConsensusAnnot)
- {
- renderHistogram = av_renderHistogram;
- renderProfile = av_renderProfile;
- normaliseProfile = av_normaliseProfile;
- } else {
- renderHistogram = true;
- // don't need to set render/normaliseProfile since they are not currently used in any other annotation track renderer
- }
+ renderHistogram = row.groupRef.isShowConsensusHistogram();
+ renderProfile = row.groupRef.isShowSequenceLogo();
+ normaliseProfile = row.groupRef.isNormaliseSequenceLogo();
+ }
+ else if (row == consensusAnnot || row == structConsensusAnnot
+ || row == complementConsensusAnnot)
+ {
+ renderHistogram = av_renderHistogram;
+ renderProfile = av_renderProfile;
+ normaliseProfile = av_normaliseProfile;
}
+
Annotation[] row_annotations = row.annotations;
if (!row.visible)
{
continue;
}
- centreColLabels = row.centreColLabels || centreColLabelsDef;
+ // centreColLabels = row.centreColLabels || centreColLabelsDef;
labelAllCols = row.showAllColLabels;
scaleColLabel = row.scaleColLabel;
lastSS = ' ';
lastSSX = 0;
-
- if (!useClip || ((y-charHeight)<visHeight && (y+row.height+charHeight*2)>=sOffset))
+
+ if (!useClip || ((y - charHeight) < visHeight
+ && (y + row.height + charHeight * 2) >= sOffset))
{// if_in_visible_region
if (!clipst)
{
- clipst=true;
- yfrom=y;
- f_i=i;
+ clipst = true;
+ yfrom = y;
+ f_i = i;
}
yto = y;
- f_to=i;
- if (row.graph > 0)
- {
- if (row.graphGroup > -1 && graphGroupDrawn.get(row.graphGroup)) {
- continue;
- }
+ f_to = i;
+ if (row.graph > 0)
+ {
+ if (row.graphGroup > -1 && graphGroupDrawn.get(row.graphGroup))
+ {
+ continue;
+ }
- // this is so that we draw the characters below the graph
- y += row.height;
+ // this is so that we draw the characters below the graph
+ y += row.height;
- if (row.hasText)
+ if (row.hasText)
+ {
+ iconOffset = charHeight - fm.getDescent();
+ y -= charHeight;
+ }
+ }
+ else if (row.hasText)
{
iconOffset = charHeight - fm.getDescent();
- y -= charHeight;
+
+ }
+ else
+ {
+ iconOffset = 0;
}
- }
- else if (row.hasText)
- {
- iconOffset = charHeight - fm.getDescent();
- }
- else
- {
- iconOffset = 0;
- }
+ if (row.autoCalculated && av.isCalculationInProgress(row))
+ {
+ y += charHeight;
+ usedFaded = true;
+ g.drawImage(fadedImage, 0, y - row.height, imgWidth, y, 0,
+ y - row.height, imgWidth, y, annotationPanel);
+ g.setColor(Color.black);
+ // g.drawString("Calculating "+aa[i].label+"....",20, y-row.height/2);
- if (row.autoCalculated && av.isCalculationInProgress(row))
- {
- y += charHeight;
- usedFaded = true;
- g.drawImage(fadedImage, 0, y - row.height, imgWidth, y, 0, y
- - row.height, imgWidth, y, annotationPanel);
- g.setColor(Color.black);
- // g.drawString("Calculating "+aa[i].label+"....",20, y-row.height/2);
+ continue;
+ }
- continue;
- }
+ /*
+ * else if (annotationPanel.av.updatingConservation &&
+ * aa[i].label.equals("Conservation")) {
+ *
+ * y += charHeight; g.drawImage(annotationPanel.fadedImage, 0, y -
+ * row.height, annotationPanel.imgWidth, y, 0, y - row.height,
+ * annotationPanel.imgWidth, y, annotationPanel);
+ *
+ * g.setColor(Color.black); //
+ * g.drawString("Calculating Conservation.....",20, y-row.height/2);
+ *
+ * continue; } else if (annotationPanel.av.updatingConservation &&
+ * aa[i].label.equals("Quality")) {
+ *
+ * y += charHeight; g.drawImage(annotationPanel.fadedImage, 0, y -
+ * row.height, annotationPanel.imgWidth, y, 0, y - row.height,
+ * annotationPanel.imgWidth, y, annotationPanel);
+ * g.setColor(Color.black); // /
+ * g.drawString("Calculating Quality....",20, y-row.height/2);
+ *
+ * continue; }
+ */
- /*
- * else if (annotationPanel.av.updatingConservation &&
- * aa[i].label.equals("Conservation")) {
- *
- * y += charHeight; g.drawImage(annotationPanel.fadedImage, 0, y -
- * row.height, annotationPanel.imgWidth, y, 0, y - row.height,
- * annotationPanel.imgWidth, y, annotationPanel);
- *
- * g.setColor(Color.black); //
- * g.drawString("Calculating Conservation.....",20, y-row.height/2);
- *
- * continue; } else if (annotationPanel.av.updatingConservation &&
- * aa[i].label.equals("Quality")) {
- *
- * y += charHeight; g.drawImage(annotationPanel.fadedImage, 0, y -
- * row.height, annotationPanel.imgWidth, y, 0, y - row.height,
- * annotationPanel.imgWidth, y, annotationPanel); g.setColor(Color.black);
- * // / g.drawString("Calculating Quality....",20, y-row.height/2);
- *
- * continue; }
- */
- // first pass sets up state for drawing continuation from left-hand column
- // of startRes
- x = (startRes == 0) ? 0 : -1;
- while (x < endRes - startRes)
- {
- if (hasHiddenColumns)
+ // first pass sets up state for drawing continuation from left-hand
+ // column
+ // of startRes
+
+ // flag used for vector rendition
+ this.glyphLineDrawn = false;
+ x = (startRes == 0) ? 0 : -1;
+ while (x < endRes - startRes)
{
- column = columnSelection.adjustForHiddenColumns(startRes + x);
- if (column > row_annotations.length - 1)
+ if (hasHiddenColumns)
+ {
+ column = hiddenColumns.visibleToAbsoluteColumn(startRes + x);
+ if (column > row_annotations.length - 1)
+ {
+ break;
+ }
+ }
+ else
+ {
+ column = startRes + x;
+ }
+
+ if ((row_annotations == null)
+ || (row_annotations.length <= column)
+ || (row_annotations[column] == null))
+ {
+ validRes = false;
+ }
+ else
+ {
+ validRes = true;
+ }
+ final String displayChar = validRes
+ ? row_annotations[column].displayCharacter
+ : null;
+ if (x > -1)
{
+ unsetAntialias(g);
+ if (activeRow == i)
+ {
+ g.setColor(Color.red);
+
+ if (columnSelection != null)
+ {
+ if (columnSelection.contains(column))
+ {
+ fillRect(g, x * charWidth, y, charWidth, charHeight);
+ }
+ }
+ }
+ if (row.getInvalidStrucPos() > x)
+ {
+ g.setColor(Color.orange);
+ fillRect(g, x * charWidth, y, charWidth, charHeight);
+ }
+ else if (row.getInvalidStrucPos() == x)
+ {
+ g.setColor(Color.orange.darker());
+ fillRect(g, x * charWidth, y, charWidth, charHeight);
+ }
+ if (validCharWidth && validRes && displayChar != null
+ && (displayChar.length() > 0))
+ {
+ // Graphics2D gg = (g);
+ float fmWidth = fm.charsWidth(displayChar.toCharArray(), 0,
+ displayChar.length());
+
+ /*
+ * shrink label width to fit in column, if that is
+ * both configured and necessary
+ */
+ boolean scaledToFit = false;
+ float fmScaling = 1f;
+ if (scaleColLabel && fmWidth > charWidth)
+ {
+ scaledToFit = true;
+ fmScaling = charWidth;
+ fmScaling /= fmWidth;
+ // and update the label's width to reflect the scaling.
+ fmWidth = charWidth;
+ }
+
+ charOffset = (int) ((charWidth - fmWidth) / 2f);
+
+ if (row_annotations[column].colour == null)
+ {
+ g2d.setColor(Color.black);
+ }
+ else
+ {
+ g2d.setColor(row_annotations[column].colour);
+ }
+
+ /*
+ * draw the label, unless it is the same secondary structure
+ * symbol (excluding RNA Helix) as the previous column
+ */
+ final int xPos = (x * charWidth) + charOffset;
+ final int yPos = y + iconOffset;
+
+ /*
+ * translate to drawing position _before_ applying any scaling
+ */
+ g2d.translate(xPos, yPos);
+ if (scaledToFit)
+ {
+ /*
+ * use a scaling transform to make the label narrower
+ * (JalviewJS doesn't have Font.deriveFont(AffineTransform))
+ */
+ g2d.transform(
+ AffineTransform.getScaleInstance(fmScaling, 1.0));
+ }
+ setAntialias(g);
+ if (column == 0 || row.graph > 0)
+ {
+ g2d.drawString(displayChar, 0, 0);
+ }
+ else if (row_annotations[column - 1] == null || (labelAllCols
+ || !displayChar.equals(
+ row_annotations[column - 1].displayCharacter)
+ || (displayChar.length() < 2
+ && row_annotations[column].secondaryStructure == ' ')))
+ {
+ g2d.drawString(displayChar, 0, 0);
+ }
+ if (scaledToFit)
+ {
+ /*
+ * undo scaling before translating back
+ * (restoring saved transform does NOT work in JS PDFGraphics!)
+ */
+ g2d.transform(AffineTransform
+ .getScaleInstance(1D / fmScaling, 1.0));
+ }
+ g2d.translate(-xPos, -yPos);
+ }
+ }
+ if (row.hasIcons)
+ {
+ char ss = validRes ? row_annotations[column].secondaryStructure
+ : '-';
+
+ if (ss == '(')
+ {
+ // distinguish between forward/backward base-pairing
+ if (displayChar.indexOf(')') > -1)
+ {
+
+ ss = ')';
+
+ }
+ }
+ if (ss == '[')
+ {
+ if ((displayChar.indexOf(']') > -1))
+ {
+ ss = ']';
+
+ }
+ }
+ if (ss == '{')
+ {
+ // distinguish between forward/backward base-pairing
+ if (displayChar.indexOf('}') > -1)
+ {
+ ss = '}';
+
+ }
+ }
+ if (ss == '<')
+ {
+ // distinguish between forward/backward base-pairing
+ if (displayChar.indexOf('<') > -1)
+ {
+ ss = '>';
+
+ }
+ }
+ if (isRNA && (ss >= CHAR_A) && (ss <= CHAR_Z))
+ {
+ // distinguish between forward/backward base-pairing
+ int ssLowerCase = ss + UPPER_TO_LOWER;
+ // TODO would .equals() be safer here? or charAt(0)?
+ if (displayChar.indexOf(ssLowerCase) > -1)
+ {
+ ss = (char) ssLowerCase;
+ }
+ }
+
+ if (!validRes || (ss != lastSS))
+ {
+
+ if (x > -1)
+ {
+
+ // int nb_annot = x - temp;
+ // Console.info("\t type :"+lastSS+"\t x
+ // :"+x+"\t nbre
+ // annot :"+nb_annot);
+ switch (lastSS)
+ {
+ case '(': // Stem case for RNA secondary structure
+ case ')': // and opposite direction
+ drawStemAnnot(g, row_annotations, lastSSX, x, y,
+ iconOffset, startRes, column, validRes, validEnd);
+ // temp = x;
+ break;
+
+ case 'H':
+ if (!isRNA)
+ {
+ drawHelixAnnot(g, row_annotations, lastSSX, x, y,
+ iconOffset, startRes, column, validRes,
+ validEnd);
+ break;
+ }
+ // no break if isRNA - falls through to drawNotCanonicalAnnot!
+ case 'E':
+ if (!isRNA)
+ {
+ drawSheetAnnot(g, row_annotations, lastSSX, x, y,
+ iconOffset, startRes, column, validRes,
+ validEnd);
+ break;
+ }
+ // no break if isRNA - fall through to drawNotCanonicalAnnot!
+
+ case '{':
+ case '}':
+ case '[':
+ case ']':
+ case '>':
+ case '<':
+ case 'A':
+ case 'a':
+ case 'B':
+ case 'b':
+ case 'C':
+ case 'c':
+ case 'D':
+ case 'd':
+ case 'e':
+ case 'F':
+ case 'f':
+ case 'G':
+ case 'g':
+ case 'h':
+ case 'I':
+ case 'i':
+ case 'J':
+ case 'j':
+ case 'K':
+ case 'k':
+ case 'L':
+ case 'l':
+ case 'M':
+ case 'm':
+ case 'N':
+ case 'n':
+ case 'O':
+ case 'o':
+ case 'P':
+ case 'p':
+ case 'Q':
+ case 'q':
+ case 'R':
+ case 'r':
+ case 'S':
+ case 's':
+ case 'T':
+ case 't':
+ case 'U':
+ case 'u':
+ case 'V':
+ case 'v':
+ case 'W':
+ case 'w':
+ case 'X':
+ case 'x':
+ case 'Y':
+ case 'y':
+ case 'Z':
+ case 'z':
+
+ Color nonCanColor = getNotCanonicalColor(lastSS);
+ drawNotCanonicalAnnot(g, nonCanColor, row_annotations,
+ lastSSX, x, y, iconOffset, startRes, column,
+ validRes, validEnd);
+ // temp = x;
+ break;
+ default:
+ if (isVectorRendering())
+ {
+ // draw single full width glyphline
+ drawGlyphLine(g, lastSSX, endRes - x, y, iconOffset);
+ // disable more glyph lines
+ this.glyphLineDrawn = true;
+ }
+ else
+ {
+ drawGlyphLine(g, lastSSX, x, y, iconOffset);
+ }
+ break;
+ }
+ }
+ if (validRes)
+ {
+ lastSS = ss;
+ }
+ else
+ {
+ lastSS = ' ';
+ }
+ if (x > -1)
+ {
+ lastSSX = (x * charWidth);
+ }
+ }
+ }
+ column++;
+ x++;
+ }
+ if (column >= row_annotations.length)
+ {
+ column = row_annotations.length - 1;
+ validEnd = false;
+ }
+ else
+ {
+ validEnd = true;
+ }
+ if ((row_annotations == null) || (row_annotations.length <= column)
+ || (row_annotations[column] == null))
+ {
+ validRes = false;
+ }
+ else
+ {
+ validRes = true;
+ }
+ // x ++;
+
+ if (row.hasIcons)
+ {
+ switch (lastSS)
+ {
+
+ case 'H':
+ if (!isRNA)
+ {
+ drawHelixAnnot(g, row_annotations, lastSSX, x, y, iconOffset,
+ startRes, column, validRes, validEnd);
+ break;
+ }
+ // no break if isRNA - fall through to drawNotCanonicalAnnot!
+
+ case 'E':
+ if (!isRNA)
+ {
+ drawSheetAnnot(g, row_annotations, lastSSX, x, y, iconOffset,
+ startRes, column, validRes, validEnd);
+ break;
+ }
+ // no break if isRNA - fall through to drawNotCanonicalAnnot!
+
+ case '(':
+ case ')': // Stem case for RNA secondary structure
+
+ drawStemAnnot(g, row_annotations, lastSSX, x, y, iconOffset,
+ startRes, column, validRes, validEnd);
+
+ break;
+ case '{':
+ case '}':
+ case '[':
+ case ']':
+ case '>':
+ case '<':
+ case 'A':
+ case 'a':
+ case 'B':
+ case 'b':
+ case 'C':
+ case 'c':
+ case 'D':
+ case 'd':
+ case 'e':
+ case 'F':
+ case 'f':
+ case 'G':
+ case 'g':
+ case 'h':
+ case 'I':
+ case 'i':
+ case 'J':
+ case 'j':
+ case 'K':
+ case 'k':
+ case 'L':
+ case 'l':
+ case 'M':
+ case 'm':
+ case 'N':
+ case 'n':
+ case 'O':
+ case 'o':
+ case 'P':
+ case 'p':
+ case 'Q':
+ case 'q':
+ case 'R':
+ case 'r':
+ case 'T':
+ case 't':
+ case 'U':
+ case 'u':
+ case 'V':
+ case 'v':
+ case 'W':
+ case 'w':
+ case 'X':
+ case 'x':
+ case 'Y':
+ case 'y':
+ case 'Z':
+ case 'z':
+ // Console.info(lastSS);
+ Color nonCanColor = getNotCanonicalColor(lastSS);
+ drawNotCanonicalAnnot(g, nonCanColor, row_annotations, lastSSX,
+ x, y, iconOffset, startRes, column, validRes, validEnd);
+ break;
+ default:
+ if (isVectorRendering())
+ {
+ // draw single full width glyphline
+ drawGlyphLine(g, lastSSX, endRes - x, y, iconOffset);
+ // disable more glyph lines
+ this.glyphLineDrawn = true;
+ }
+ else
+ {
+ drawGlyphLine(g, lastSSX, x, y, iconOffset);
+ }
break;
}
}
- else
- {
- column = startRes + x;
- }
- if ((row_annotations == null) || (row_annotations.length <= column)
- || (row_annotations[column] == null))
- {
- validRes = false;
- }
- else
- {
- validRes = true;
- }
- if (x > -1)
+ if (row.graph > 0 && row.graphHeight > 0)
{
- if (activeRow == i)
+ if (row.graph == AlignmentAnnotation.LINE_GRAPH)
{
- g.setColor(Color.red);
-
- if (columnSelection != null)
+ if (row.graphGroup > -1 && !graphGroupDrawn.get(row.graphGroup))
{
- for (int n = 0; n < columnSelection.size(); n++)
+ // TODO: JAL-1291 revise rendering model so the graphGroup map is
+ // computed efficiently for all visible labels
+ float groupmax = -999999, groupmin = 9999999;
+ for (int gg = 0; gg < aa.length; gg++)
{
- int v = columnSelection.columnAt(n);
+ if (aa[gg].graphGroup != row.graphGroup)
+ {
+ continue;
+ }
- if (v == column)
+ if (aa[gg] != row)
+ {
+ aa[gg].visible = false;
+ }
+ if (aa[gg].graphMax > groupmax)
+ {
+ groupmax = aa[gg].graphMax;
+ }
+ if (aa[gg].graphMin < groupmin)
{
- g.fillRect(x * charWidth, y, charWidth, charHeight);
+ groupmin = aa[gg].graphMin;
}
}
- }
- }
- if (!row.isValidStruc())
- {
- g.setColor(Color.orange);
- g.fillRect((int) row.getInvalidStrucPos() * charWidth, y,
- charWidth, charHeight);
- }
- if (validCharWidth
- && validRes
- && row_annotations[column].displayCharacter != null
- && (row_annotations[column].displayCharacter.length() > 0))
- {
-
- if (centreColLabels || scaleColLabel)
- {
- fmWidth = fm.charsWidth(
- row_annotations[column].displayCharacter
- .toCharArray(), 0,
- row_annotations[column].displayCharacter.length());
- if (scaleColLabel)
+ for (int gg = 0; gg < aa.length; gg++)
{
- // justify the label and scale to fit in column
- if (fmWidth > charWidth)
+ if (aa[gg].graphGroup == row.graphGroup)
{
- // scale only if the current font isn't already small enough
- fmScaling = charWidth;
- fmScaling /= fmWidth;
- g.setFont(ofont.deriveFont(AffineTransform
- .getScaleInstance(fmScaling, 1.0)));
- // and update the label's width to reflect the scaling.
- fmWidth = charWidth;
+ drawLineGraph(g, aa[gg], aa[gg].annotations, startRes,
+ endRes, y, groupmin, groupmax, row.graphHeight);
}
}
- }
- else
- {
- fmWidth = fm
- .charWidth(row_annotations[column].displayCharacter
- .charAt(0));
- }
- charOffset = (int) ((charWidth - fmWidth) / 2f);
-
- if (row_annotations[column].colour == null)
- g.setColor(Color.black);
- else
- g.setColor(row_annotations[column].colour);
- if (column == 0 || row.graph > 0)
- {
- g.drawString(row_annotations[column].displayCharacter,
- (x * charWidth) + charOffset, y + iconOffset);
+ graphGroupDrawn.set(row.graphGroup);
}
- else if (row_annotations[column - 1] == null
- || (labelAllCols
- || !row_annotations[column].displayCharacter
- .equals(row_annotations[column - 1].displayCharacter) || (row_annotations[column].displayCharacter
- .length() < 2 && row_annotations[column].secondaryStructure == ' ')))
+ else
{
- g.drawString(row_annotations[column].displayCharacter
- , x
- * charWidth + charOffset, y + iconOffset);
+ drawLineGraph(g, row, row_annotations, startRes, endRes, y,
+ row.graphMin, row.graphMax, row.graphHeight);
}
- g.setFont(ofont);
}
- }
- if (row.hasIcons)
- {
- char ss = validRes ? row_annotations[column].secondaryStructure
- : '-';
-
- if (ss == '(')
+ else if (row.graph == AlignmentAnnotation.BAR_GRAPH)
{
- // distinguish between forward/backward base-pairing
- if (row_annotations[column].displayCharacter.indexOf(')') > -1)
- {
-
- ss = ')';
-
- }
+ drawBarGraph(g, row, row_annotations, startRes, endRes,
+ row.graphMin, row.graphMax, y, renderHistogram,
+ renderProfile, normaliseProfile);
}
- if (ss == '[')
+ else
{
- if ((row_annotations[column].displayCharacter.indexOf(']') > -1))
- {
- ss = ']';
-
-
- }
- }
- if (ss == '{')
- {
- // distinguish between forward/backward base-pairing
- if (row_annotations[column].displayCharacter.indexOf('}') > -1)
- {
- ss = '}';
-
-
- }
- }
- if (ss == '<')
- {
- // distinguish between forward/backward base-pairing
- if (row_annotations[column].displayCharacter.indexOf('<') > -1)
- {
- ss = '>';
-
-
- }
- }
- if (ss >=65)
- {
- // distinguish between forward/backward base-pairing
- if (row_annotations[column].displayCharacter.indexOf(ss+32) > -1)
- {
-
- ss = (char) (ss+32);
-
-
- }
- }
-
-
- if (!validRes || (ss != lastSS))
- {
-
-
- if (x > -1)
- {
-
-
- int nb_annot=x-temp;
- //System.out.println("\t type :"+lastSS+"\t x :"+x+"\t nbre annot :"+nb_annot);
- switch (lastSS)
- {
-
- case '$':
- drawHelixAnnot(g, row_annotations, lastSSX, x, y, iconOffset, startRes,
- column, validRes, validEnd);
- break;
-
- case 'µ':
- drawSheetAnnot(g, row_annotations, lastSSX, x, y, iconOffset, startRes,
- column, validRes, validEnd);
- break;
-
- case '(': // Stem case for RNA secondary structure
- case ')': // and opposite direction
- drawStemAnnot(g, row_annotations, lastSSX, x, y, iconOffset, startRes,
- column, validRes, validEnd);
- temp=x;
- break;
- case '{':
- case '}':
- case '[':
- case ']':
- case '>':
- case '<':
- case 'A':
- case 'a':
- case 'B':
- case 'b':
- case 'C':
- case 'c':
- case 'D':
- case 'd':
- case 'E':
- case 'e':
- case 'F':
- case 'f':
- case 'G':
- case 'g':
- case 'H':
- case 'h':
- case 'I':
- case 'i':
- case 'J':
- case 'j':
- case 'K':
- case 'k':
- case 'L':
- case 'l':
- case 'M':
- case 'm':
- case 'N':
- case 'n':
- case 'O':
- case 'o':
- case 'P':
- case 'p':
- case 'Q':
- case 'q':
- case 'R':
- case 'r':
- case 'S':
- case 's':
- case 'T':
- case 't':
- case 'U':
- case 'u':
- case 'V':
- case 'v':
- case 'W':
- case 'w':
- case 'X':
- case 'x':
- case 'Y':
- case 'y':
- case 'Z':
- case 'z':
-
- Color nonCanColor= getNotCanonicalColor(lastSS);
- drawNotCanonicalAnnot(g, nonCanColor, row_annotations, lastSSX, x, y, iconOffset, startRes,
- column, validRes, validEnd);
- temp=x;
- break;
- default:
- g.setColor(Color.gray);
- g.fillRect(lastSSX, y + 6 + iconOffset, (x * charWidth)
- - lastSSX, 2);
- temp=x;
- break;
- }
- }
- if (validRes)
- {
- lastSS = ss;
- }
- else
- {
- lastSS = ' ';
- }
- if (x > -1)
+ AnnotationRowRendererI renderer = rendererFactoryI
+ .getRendererFor(row);
+ if (renderer != null)
{
- lastSSX = (x * charWidth);
+ renderer.renderRow(g, charWidth, charHeight, hasHiddenColumns,
+ av, hiddenColumns, columnSelection, row,
+ row_annotations, startRes, endRes, row.graphMin,
+ row.graphMax, y);
}
- }
- }
- column++;
- x++;
- }
- if (column >= row_annotations.length)
- {
- column = row_annotations.length - 1;
- validEnd = false;
- }
- else
- {
- validEnd = true;
- }
- if ((row_annotations == null) || (row_annotations.length <= column)
- || (row_annotations[column] == null))
- {
- validRes = false;
- }
- else
- {
- validRes = true;
- }
-
- // x ++;
-
- if (row.hasIcons)
- {
- switch (lastSS)
- {
- case '$':
- drawHelixAnnot(g, row_annotations, lastSSX, x, y, iconOffset, startRes,
- column, validRes, validEnd);
- break;
-
- case 'µ':
- drawSheetAnnot(g, row_annotations, lastSSX, x, y, iconOffset, startRes,
- column, validRes, validEnd);
- break;
- case 's':
- case 'S': // Stem case for RNA secondary structure
-
- drawStemAnnot(g, row_annotations, lastSSX, x, y, iconOffset, startRes,
- column, validRes, validEnd);
-
- break;
- case '{':
- case '}':
- case '[':
- case ']':
- case '>':
- case '<':
- case 'A':
- case 'a':
- case 'B':
- case 'b':
- case 'C':
- case 'c':
- case 'D':
- case 'd':
- case 'E':
- case 'e':
- case 'F':
- case 'f':
- case 'G':
- case 'g':
- case 'H':
- case 'h':
- case 'I':
- case 'i':
- case 'J':
- case 'j':
- case 'K':
- case 'k':
- case 'L':
- case 'l':
- case 'M':
- case 'm':
- case 'N':
- case 'n':
- case 'O':
- case 'o':
- case 'P':
- case 'p':
- case 'Q':
- case 'q':
- case 'R':
- case 'r':
- case 'T':
- case 't':
- case 'U':
- case 'u':
- case 'V':
- case 'v':
- case 'W':
- case 'w':
- case 'X':
- case 'x':
- case 'Y':
- case 'y':
- case 'Z':
- case 'z':
- //System.out.println(lastSS);
- Color nonCanColor = getNotCanonicalColor(lastSS);
- drawNotCanonicalAnnot(g,nonCanColor, row_annotations, lastSSX, x, y, iconOffset, startRes,
- column, validRes, validEnd);
- break;
- default:
- drawGlyphLine(g, row_annotations, lastSSX, x, y, iconOffset, startRes,
- column, validRes, validEnd);
- break;
- }
- }
-
- if (row.graph > 0 && row.graphHeight > 0)
- {
- if (row.graph == AlignmentAnnotation.LINE_GRAPH)
- {
- if (row.graphGroup > -1 && !graphGroupDrawn.get(row.graphGroup))
- {
- // TODO: JAL-1291 revise rendering model so the graphGroup map is computed efficiently for all visible labels
- float groupmax = -999999, groupmin = 9999999;
- for (int gg = 0; gg < aa.length; gg++)
+ if (debugRedraw)
{
- if (aa[gg].graphGroup != row.graphGroup)
+ if (renderer == null)
{
- continue;
+ System.err
+ .println("No renderer found for " + row.toString());
}
-
- if (aa[gg] != row)
- {
- aa[gg].visible = false;
- }
- if (aa[gg].graphMax > groupmax)
- {
- groupmax = aa[gg].graphMax;
- }
- if (aa[gg].graphMin < groupmin)
- {
- groupmin = aa[gg].graphMin;
- }
- }
-
- for (int gg = 0; gg < aa.length; gg++)
- {
- if (aa[gg].graphGroup == row.graphGroup)
+ else
{
- drawLineGraph(g, aa[gg], aa[gg].annotations, startRes, endRes, y, groupmin,
- groupmax, row.graphHeight);
+ Console.warn(
+ "rendered with " + renderer.getClass().toString());
}
}
- graphGroupDrawn.set(row.graphGroup);
- }
- else
- {
- drawLineGraph(g, row, row_annotations, startRes, endRes, y, row.graphMin,
- row.graphMax, row.graphHeight);
}
}
- else if (row.graph == AlignmentAnnotation.BAR_GRAPH)
- {
- drawBarGraph(g, row, row_annotations, startRes, endRes,
- row.graphMin, row.graphMax, y, renderHistogram,renderProfile,normaliseProfile);
- }
}
- } else {
- if (clipst && !clipend)
+ else
{
- clipend = true;
- }
- }// end if_in_visible_region
+ if (clipst && !clipend)
+ {
+ clipend = true;
+ }
+ } // end if_in_visible_region
if (row.graph > 0 && row.hasText)
{
y += charHeight;
{
if (clipst)
{
- System.err.println("Start clip at : " + yfrom + " (index " + f_i
- + ")");
+ Console.warn("Start clip at : " + yfrom + " (index " + f_i + ")");
}
if (clipend)
{
- System.err.println("End clip at : " + yto + " (index " + f_to
- + ")");
+ Console.warn("End clip at : " + yto + " (index " + f_to + ")");
}
}
;
- System.err.println("Annotation Rendering time:"
+ Console.warn("Annotation Rendering time:"
+ (System.currentTimeMillis() - stime));
}
;
return !usedFaded;
}
- private final Color GLYPHLINE_COLOR = Color.gray;
+ public static final Color GLYPHLINE_COLOR = Color.gray;
- private final Color SHEET_COLOUR = Color.green;
+ public static final Color SHEET_COLOUR = Color.green;
- private final Color HELIX_COLOUR = Color.red;
+ public static final Color HELIX_COLOUR = Color.red;
- private final Color STEM_COLOUR = Color.blue;
-
- private Color sdNOTCANONICAL_COLOUR;
+ public static final Color STEM_COLOUR = Color.blue;
- public void drawGlyphLine(Graphics g, Annotation[] row,
- int lastSSX, int x, int y, int iconOffset, int startRes,
- int column, boolean validRes, boolean validEnd)
+ // private Color sdNOTCANONICAL_COLOUR;
+
+ void drawGlyphLine(Graphics g, int lastSSX, int x, int y, int iconOffset)
{
+ if (glyphLineDrawn)
+ {
+ // if we've drawn a single long glyphline for an export, don't draw the
+ // bits
+ return;
+ }
+ unsetAntialias(g);
g.setColor(GLYPHLINE_COLOR);
g.fillRect(lastSSX, y + 6 + iconOffset, (x * charWidth) - lastSSX, 2);
}
- public void drawSheetAnnot(Graphics g, Annotation[] row,
+ void drawSheetAnnot(Graphics g, Annotation[] row,
int lastSSX, int x, int y, int iconOffset, int startRes,
int column, boolean validRes, boolean validEnd)
{
- g.setColor(SHEET_COLOUR);
-
if (!validEnd || !validRes || row == null || row[column] == null
|| row[column].secondaryStructure != 'E')
{
- g.fillRect(lastSSX, y + 4 + iconOffset,
- (x * charWidth) - lastSSX - 4, 7);
- g.fillPolygon(new int[]
- { (x * charWidth) - 4, (x * charWidth) - 4, (x * charWidth) },
+ // draw the glyphline underneath
+ drawGlyphLine(g, lastSSX, x, y, iconOffset);
+
+ g.setColor(SHEET_COLOUR);
+ fillRect(g, lastSSX, y + 4 + iconOffset,
+ (x * charWidth) - lastSSX - 4, 6);
+ fillPolygon(g,
+ new int[]
+ { (x * charWidth) - 6, (x * charWidth) - 6,
+ (x * charWidth - 1) },
new int[]
- { y + iconOffset, y + 14 + iconOffset, y + 7 + iconOffset },
+ { y + iconOffset + 1, y + 13 + iconOffset,
+ y + 7 + iconOffset },
3);
}
else
{
- g.fillRect(lastSSX, y + 4 + iconOffset,
- (x + 1) * charWidth - lastSSX, 7);
+ g.setColor(SHEET_COLOUR);
+ fillRect(g, lastSSX, y + 4 + iconOffset, (x * charWidth) - lastSSX,
+ 6);
}
-
}
- public void drawHelixAnnot(Graphics g, Annotation[] row, int lastSSX,
- int x, int y, int iconOffset, int startRes, int column,
- boolean validRes, boolean validEnd)
+ void drawHelixAnnot(Graphics g, Annotation[] row, int lastSSX, int x,
+ int y, int iconOffset, int startRes, int column, boolean validRes,
+ boolean validEnd)
{
- g.setColor(HELIX_COLOUR);
-
- int sCol = (lastSSX / charWidth) + startRes;
+ int sCol = (lastSSX / charWidth)
+ + hiddenColumns.visibleToAbsoluteColumn(startRes);
int x1 = lastSSX;
int x2 = (x * charWidth);
- if (MAC)
+ if (USE_FILL_ROUND_RECT || isVectorRendering())
{
+ // draw glyph line behind helix (visible in EPS or SVG output)
+ drawGlyphLine(g, lastSSX, x, y, iconOffset);
+
+ g.setColor(HELIX_COLOUR);
+ setAntialias(g);
int ofs = charWidth / 2;
// Off by 1 offset when drawing rects and ovals
// to offscreen image on the MAC
- g.fillRoundRect(lastSSX, y + 4 + iconOffset, x2 - x1, 8, 8, 8);
+ fillRoundRect(g, lastSSX, y + 3 + iconOffset, x2 - x1 - 1, 8, 8, 8);
if (sCol == 0 || row[sCol - 1] == null
|| row[sCol - 1].secondaryStructure != 'H')
{
}
else
{
- // g.setColor(Color.orange);
- g.fillRoundRect(lastSSX, y + 4 + iconOffset, x2 - x1 - ofs + 1, 8,
- 0, 0);
+ fillRoundRect(g, lastSSX, y + 3 + iconOffset, x2 - x1 - ofs, 8, 0,
+ 0);
}
if (!validRes || row[column] == null
|| row[column].secondaryStructure != 'H')
}
else
{
- // g.setColor(Color.magenta);
- g.fillRoundRect(lastSSX + ofs, y + 4 + iconOffset, x2 - x1 - ofs
- + 1, 8, 0, 0);
-
+ fillRoundRect(g, lastSSX + ofs, y + 3 + iconOffset, x2 - x1 - ofs,
+ 8, 0, 0);
}
return;
}
- if (sCol == 0 || row[sCol - 1] == null
- || row[sCol - 1].secondaryStructure != 'H')
+ boolean leftEnd = sCol == 0 || row[sCol - 1] == null
+ || row[sCol - 1].secondaryStructure != 'H';
+ boolean rightEnd = !validRes || row[column] == null
+ || row[column].secondaryStructure != 'H';
+
+ if (leftEnd || rightEnd)
+ {
+ drawGlyphLine(g, lastSSX, x, y, iconOffset);
+ }
+ g.setColor(HELIX_COLOUR);
+
+ if (leftEnd)
{
- g.fillArc(lastSSX, y + 4 + iconOffset, charWidth, 8, 90, 180);
+ fillArc(g, lastSSX, y + 3 + iconOffset, charWidth, 8, 90, 180);
x1 += charWidth / 2;
}
- if (!validRes || row[column] == null
- || row[column].secondaryStructure != 'H')
+ if (rightEnd)
{
- g.fillArc((x * charWidth) - charWidth, y + 4 + iconOffset, charWidth,
- 8, 270, 180);
+ fillArc(g, ((x - 1) * charWidth), y + 3 + iconOffset, charWidth, 8,
+ 270, 180);
x2 -= charWidth / 2;
}
- g.fillRect(x1, y + 4 + iconOffset, x2 - x1, 8);
+ fillRect(g, x1, y + 3 + iconOffset, x2 - x1, 8);
}
- public void drawLineGraph(Graphics g, AlignmentAnnotation _aa,
- Annotation[] aa_annotations, int sRes, int eRes, int y,
- float min, float max, int graphHeight)
+ void drawLineGraph(Graphics g, AlignmentAnnotation _aa,
+ Annotation[] aa_annotations, int sRes, int eRes, int y, float min,
+ float max, int graphHeight)
{
if (sRes > aa_annotations.length)
{
return;
}
+ Stroke roundStroke = new BasicStroke(1, BasicStroke.CAP_ROUND,
+ BasicStroke.JOIN_ROUND);
+ Stroke squareStroke = new BasicStroke(1, BasicStroke.CAP_SQUARE,
+ BasicStroke.JOIN_MITER);
+ Graphics2D g2d = (Graphics2D) g;
+ Stroke prevStroke = g2d.getStroke();
+ g2d.setStroke(roundStroke);
int x = 0;
}
g.setColor(Color.gray);
- g.drawLine(x - charWidth, y2, (eRes - sRes + 1) * charWidth, y2);
+ drawLine(g, squareStroke, x * charWidth - charWidth, y2,
+ (eRes - sRes) * charWidth, y2);
eRes = Math.min(eRes, aa_annotations.length);
column = sRes + x;
if (hasHiddenColumns)
{
- column = columnSelection.adjustForHiddenColumns(column);
+ column = hiddenColumns.visibleToAbsoluteColumn(column);
}
if (column > aaMax)
break;
}
- if (aa_annotations[column] == null
- || aa_annotations[column - 1] == null)
+ if (aa_annotations[column] == null)
{
x++;
continue;
}
if (aa_annotations[column].colour == null)
+ {
g.setColor(Color.black);
+ }
else
+ {
g.setColor(aa_annotations[column].colour);
+ }
+
+ if (aa_annotations[column - 1] == null
+ && aa_annotations.length > column + 1
+ && aa_annotations[column + 1] == null)
+ {
+ // standalone value
+ y1 = y - (int) (((aa_annotations[column].value - min) / range)
+ * graphHeight);
+ drawLine(g, x * charWidth + charWidth / 4, y1,
+ x * charWidth + 3 * charWidth / 4, y1);
+ x++;
+ continue;
+ }
+
+ if (aa_annotations[column - 1] == null)
+ {
+ x++;
+ continue;
+ }
- y1 = y
- - (int) (((aa_annotations[column - 1].value - min) / range) * graphHeight);
- y2 = y
- - (int) (((aa_annotations[column].value - min) / range) * graphHeight);
+ y1 = y - (int) (((aa_annotations[column - 1].value - min) / range)
+ * graphHeight);
+ y2 = y - (int) (((aa_annotations[column].value - min) / range)
+ * graphHeight);
- g.drawLine(x * charWidth - charWidth / 2, y1, x * charWidth
- + charWidth / 2, y2);
+ drawLine(g, (x - 1) * charWidth + charWidth / 2, y1,
+ x * charWidth + charWidth / 2, y2);
x++;
}
{
g.setColor(_aa.threshold.colour);
Graphics2D g2 = (Graphics2D) g;
- g2.setStroke(new BasicStroke(1, BasicStroke.CAP_SQUARE,
+ Stroke s = new BasicStroke(1, BasicStroke.CAP_SQUARE,
BasicStroke.JOIN_ROUND, 3f, new float[]
- { 5f, 3f }, 0f));
+ { 5f, 3f }, 0f);
y2 = (int) (y - ((_aa.threshold.value - min) / range) * graphHeight);
- g.drawLine(0, y2, (eRes - sRes) * charWidth, y2);
- g2.setStroke(new BasicStroke());
+ drawLine(g, s, 0, y2, (eRes - sRes) * charWidth, y2);
}
+ g2d.setStroke(prevStroke);
}
- public void drawBarGraph(Graphics g, AlignmentAnnotation _aa,
+ @SuppressWarnings("unused")
+ void drawBarGraph(Graphics g, AlignmentAnnotation _aa,
Annotation[] aa_annotations, int sRes, int eRes, float min,
- float max, int y, boolean renderHistogram,boolean renderProfile,boolean normaliseProfile)
+ float max, int y, boolean renderHistogram, boolean renderProfile,
+ boolean normaliseProfile)
{
if (sRes > aa_annotations.length)
{
g.setColor(Color.gray);
- g.drawLine(x, y2, (eRes - sRes) * charWidth, y2);
+ drawLine(g, x, y2, (eRes - sRes) * charWidth, y2);
int column;
int aaMax = aa_annotations.length - 1;
column = sRes + x;
if (hasHiddenColumns)
{
- column = columnSelection.adjustForHiddenColumns(column);
+ column = hiddenColumns.visibleToAbsoluteColumn(column);
}
if (column > aaMax)
continue;
}
if (aa_annotations[column].colour == null)
+ {
g.setColor(Color.black);
+ }
else
+ {
g.setColor(aa_annotations[column].colour);
+ }
- y1 = y
- - (int) (((aa_annotations[column].value - min) / (range)) * _aa.graphHeight);
+ y1 = y - (int) (((aa_annotations[column].value - min) / (range))
+ * _aa.graphHeight);
if (renderHistogram)
{
if (y1 - y2 > 0)
{
- g.fillRect(x * charWidth, y2, charWidth, y1 - y2);
+ fillRect(g, x * charWidth, y2, charWidth, y1 - y2);
}
else
{
- g.fillRect(x * charWidth, y1, charWidth, y2 - y1);
+ fillRect(g, x * charWidth, y1, charWidth, y2 - y1);
}
}
// draw profile if available
if (renderProfile)
{
+ /*
+ * {profile type, #values, total count, char1, pct1, char2, pct2...}
+ */
int profl[] = getProfileFor(_aa, column);
+
// just try to draw the logo if profl is not null
- if (profl != null && profl[1] != 0)
+ if (profl != null && profl[2] != 0)
{
+ boolean isStructureProfile = profl[0] == AlignmentAnnotation.STRUCTURE_PROFILE;
+ boolean isCdnaProfile = profl[0] == AlignmentAnnotation.CDNA_PROFILE;
float ht = normaliseProfile ? y - _aa.graphHeight : y1;
- double htn = normaliseProfile ? _aa.graphHeight : (y2 - y1);// aa.graphHeight;
- double hght;
- float wdth;
- double ht2 = 0;
- char[] dc;
+ final double normaliseFactor = normaliseProfile ? _aa.graphHeight
+ : (y2 - y1);
/**
- * profl.length == 74 indicates that the profile of a secondary
- * structure conservation row was accesed. Therefore dc gets length 2,
- * to have space for a basepair instead of just a single nucleotide
+ * Render a single base for a sequence profile, a base pair for
+ * structure profile, and a triplet for a cdna profile
*/
- if (profl.length == 74)
- {
- dc = new char[2];
- }
- else
- {
- dc = new char[1];
- }
- LineMetrics lm = g.getFontMetrics(ofont).getLineMetrics("Q", g);
- double scale = 1f / (normaliseProfile ? profl[1] : 100f);
- float ofontHeight = 1f / lm.getAscent();// magnify to fill box
- double scl = 0.0;
- for (int c = 2; c < profl[0];)
+ char[] dc = new char[isStructureProfile ? 2
+ : (isCdnaProfile ? 3 : 1)];
+
+ // lm is not necessary - we can just use fm - could be off by no more
+ // than 0.5 px
+ // LineMetrics lm = g.getFontMetrics(ofont).getLineMetrics("Q", g);
+ // Console.info(asc + " " + dec + " " + (asc -
+ // lm.getAscent())
+ // + " " + (dec - lm.getDescent()));
+
+ double asc = fm.getAscent();
+ double dec = fm.getDescent();
+ double fht = fm.getHeight();
+
+ double scale = 1f / (normaliseProfile ? profl[2] : 100f);
+ // float ofontHeight = 1f / fm.getAscent();// magnify to fill box
+
+ /*
+ * Traverse the character(s)/percentage data in the array
+ */
+
+ float ht2 = ht;
+
+ // profl[1] is the number of values in the profile
+ for (int i = 0, c = 3, last = profl[1]; i < last; i++)
{
- dc[0] = (char) profl[c++];
- if (_aa.label.startsWith("StrucConsensus"))
+ String s;
+ if (isStructureProfile)
{
+ // todo can we encode a structure pair as an int, like codons?
+ dc[0] = (char) profl[c++];
dc[1] = (char) profl[c++];
+ s = new String(dc);
}
+ else if (isCdnaProfile)
+ {
+ CodingUtils.decodeCodon2(profl[c++], dc);
+ s = new String(dc);
+ }
+ else
+ {
+ dc[0] = (char) profl[c++];
+ s = new String(dc);
+ }
+ // next profl[] position is profile % for the character(s)
- wdth = charWidth;
- wdth /= fm.charsWidth(dc, 0, dc.length);
-
- ht += scl;
+ int percent = profl[c++];
+ if (percent == 0)
+ {
+ // failsafe in case a count rounds down to 0%
+ continue;
+ }
+ double newHeight = normaliseFactor * scale * percent;
+
+ /*
+ * Set character colour as per alignment colour scheme; use the
+ * codon translation if a cDNA profile
+ */
+ Color colour = null;
+ if (isCdnaProfile)
+ {
+ final String codonTranslation = ResidueProperties
+ .codonTranslate(s);
+ colour = profcolour.findColour(codonTranslation.charAt(0),
+ column, null);
+ }
+ else
+ {
+ colour = profcolour.findColour(dc[0], column, null);
+ }
+ g.setColor(colour == Color.white ? Color.lightGray : colour);
+
+ // Debug - render boxes around characters
+ // g.setColor(Color.red);
+ // g.drawRect(x*av.charWidth, (int)ht, av.charWidth,
+ // (int)(scl));
+ // g.setColor(profcolour.findColour(dc[0]).darker());
+
+ double sx = 1f * charWidth / fm.charsWidth(dc, 0, dc.length);
+ double sy = newHeight / asc;
+ double newAsc = asc * sy;
+ double newDec = dec * sy;
+ // it is not necessary to recalculate lm for the new font.
+ // note: lm.getBaselineOffsets()[lm.getBaselineIndex()]) must be 0
+ // by definition. Was:
+ // int hght = (int) (ht + (newAsc - newDec);
+ // - lm.getBaselineOffsets()[lm.getBaselineIndex()]));
+
+ if (Platform.isJS())
{
- scl = htn * scale * profl[c++];
- lm = ofont.getLineMetrics(dc, 0, 1, g.getFontMetrics()
- .getFontRenderContext());
- g.setFont(ofont.deriveFont(AffineTransform.getScaleInstance(
- wdth, scl / lm.getAscent())));
- lm = g.getFontMetrics().getLineMetrics(dc, 0, 1, g);
-
- // Debug - render boxes around characters
- // g.setColor(Color.red);
- // g.drawRect(x*av.charWidth, (int)ht, av.charWidth,
- // (int)(scl));
- // g.setColor(profcolour.findColour(dc[0]).darker());
- g.setColor(profcolour.findColour(dc[0], column, null));
-
- hght = (ht + (scl - lm.getDescent() - lm.getBaselineOffsets()[lm
- .getBaselineIndex()]));
-
- g.drawChars(dc, 0, dc.length, x * charWidth, (int) hght);
+ /*
+ * SwingJS does not implement font.deriveFont()
+ * so use a scaling transform to draw instead,
+ * this is off by a very small amount
+ */
+ final int hght = (int) (ht2 + (newAsc - newDec));
+ Graphics2D gg = (Graphics2D) g;
+ int xShift = (int) Math.round(x * charWidth / sx);
+ int yShift = (int) Math.round(hght / sy);
+ gg.transform(AffineTransform.getScaleInstance(sx, sy));
+ gg.drawString(s, xShift, yShift);
+ gg.transform(
+ AffineTransform.getScaleInstance(1D / sx, 1D / sy));
+ ht2 += newHeight;
+ }
+ else
+ /**
+ * Java only
+ *
+ * @j2sIgnore
+ */
+ {
+ // Java ('normal') method is to scale the font to fit
+
+ final int hght = (int) (ht + (newAsc - newDec));
+ Font font = ofont
+ .deriveFont(AffineTransform.getScaleInstance(sx, sy));
+ g.setFont(font);
+ g.drawChars(dc, 0, dc.length, x * charWidth, hght);
+ g.setFont(ofont);
+
+ ht += newHeight;
}
}
- g.setFont(ofont);
}
}
x++;
if (_aa.threshold != null)
{
g.setColor(_aa.threshold.colour);
- Graphics2D g2 = (Graphics2D) g;
- g2.setStroke(new BasicStroke(1, BasicStroke.CAP_SQUARE,
+ Stroke s = new BasicStroke(1, BasicStroke.CAP_SQUARE,
BasicStroke.JOIN_ROUND, 3f, new float[]
- { 5f, 3f }, 0f));
+ { 5f, 3f }, 0f);
- y2 = (int) (y - ((_aa.threshold.value - min) / range)
- * _aa.graphHeight);
- g.drawLine(0, y2, (eRes - sRes) * charWidth, y2);
- g2.setStroke(new BasicStroke());
+ y2 = (int) (y
+ - ((_aa.threshold.value - min) / range) * _aa.graphHeight);
+ drawLine(g, s, 0, y2, (eRes - sRes) * charWidth, y2);
}
}
{
eRes = Math.min(eRes, aa_annotations.length);
g.setColor(Color.white);
- g.fillRect(0, 0, width, y);
+ fillRect(g, 0, 0, width, y);
g.setColor(new Color(0, 0, 180));
int x = 0, height;
if (aa_annotations[j] != null)
{
if (aa_annotations[j].colour == null)
+ {
g.setColor(Color.black);
+ }
else
+ {
g.setColor(aa_annotations[j].colour);
+ }
height = (int) ((aa_annotations[j].value / _aa.graphMax) * y);
if (height > y)
height = y;
}
- g.fillRect(x, y - height, charWidth, height);
+ fillRect(g, x, y - height, charWidth, height);
}
x += charWidth;
}
}
-
Color getNotCanonicalColor(char lastss)
- {
- switch (lastss)
- {
- case '{':
- case '}':
- return new Color(255,125,5);
-
- case '[':
- case ']':
- return new Color(245,115,10);
-
- case '>':
- case '<':
- return new Color(235,135,15);
-
- case 'A':
- case 'a':
- return new Color(225,105,20);
-
- case 'B':
- case 'b':
- return new Color(215,145,30);
-
- case 'C':
- case 'c':
- return new Color(205,95,35);
-
- case 'D':
- case 'd':
- return new Color(195,155,45);
-
- case 'E':
- case 'e':
- return new Color(185,85,55);
-
- case 'F':
- case 'f':
- return new Color(175,165,65);
-
- case 'G':
- case 'g':
- return new Color(170,75,75);
-
- case 'H':
- case 'h':
- return new Color(160,175,85);
-
- case 'I':
- case 'i':
- return new Color(150,65,95);
-
- case 'J':
- case 'j':
- return new Color(140,185,105);
-
- case 'K':
- case 'k':
- return new Color(130,55,110);
-
- case 'L':
- case 'l':
- return new Color(120,195,120);
-
- case 'M':
- case 'm':
- return new Color(110,45,130);
-
- case 'N':
- case 'n':
- return new Color(100,205,140);
-
- case 'O':
- case 'o':
- return new Color(90,35,150);
-
- case 'P':
- case 'p':
- return new Color(85,215,160);
-
- case 'Q':
- case 'q':
- return new Color(75,25,170);
-
- case 'R':
- case 'r':
- return new Color(65,225,180);
-
- case 'S':
- case 's':
- return new Color(55,15,185);
-
- case 'T':
- case 't':
- return new Color(45,235,195);
-
- case 'U':
- case 'u':
- return new Color(35,5,205);
-
- case 'V':
- case 'v':
- return new Color(25,245,215);
-
- case 'W':
- case 'w':
- return new Color(15,0,225);
-
- case 'X':
- case 'x':
- return new Color(10,255,235);
-
- case 'Y':
- case 'y':
- return new Color(5,150,245);
-
- case 'Z':
- case 'z':
- return new Color(0,80,255);
-
- default :
- System.out.println("This is not a interaction : "+lastss);
- return null;
-
- }
- }
-}
+ {
+ switch (lastss)
+ {
+ case '{':
+ case '}':
+ return new Color(255, 125, 5);
+
+ case '[':
+ case ']':
+ return new Color(245, 115, 10);
+
+ case '>':
+ case '<':
+ return new Color(235, 135, 15);
+
+ case 'A':
+ case 'a':
+ return new Color(225, 105, 20);
+
+ case 'B':
+ case 'b':
+ return new Color(215, 145, 30);
+
+ case 'C':
+ case 'c':
+ return new Color(205, 95, 35);
+
+ case 'D':
+ case 'd':
+ return new Color(195, 155, 45);
+
+ case 'E':
+ case 'e':
+ return new Color(185, 85, 55);
+
+ case 'F':
+ case 'f':
+ return new Color(175, 165, 65);
-
-
+ case 'G':
+ case 'g':
+ return new Color(170, 75, 75);
+
+ case 'H':
+ case 'h':
+ return new Color(160, 175, 85);
+
+ case 'I':
+ case 'i':
+ return new Color(150, 65, 95);
+
+ case 'J':
+ case 'j':
+ return new Color(140, 185, 105);
+
+ case 'K':
+ case 'k':
+ return new Color(130, 55, 110);
+
+ case 'L':
+ case 'l':
+ return new Color(120, 195, 120);
+
+ case 'M':
+ case 'm':
+ return new Color(110, 45, 130);
+
+ case 'N':
+ case 'n':
+ return new Color(100, 205, 140);
+
+ case 'O':
+ case 'o':
+ return new Color(90, 35, 150);
+
+ case 'P':
+ case 'p':
+ return new Color(85, 215, 160);
+
+ case 'Q':
+ case 'q':
+ return new Color(75, 25, 170);
+
+ case 'R':
+ case 'r':
+ return new Color(65, 225, 180);
+
+ case 'S':
+ case 's':
+ return new Color(55, 15, 185);
+
+ case 'T':
+ case 't':
+ return new Color(45, 235, 195);
+
+ case 'U':
+ case 'u':
+ return new Color(35, 5, 205);
+
+ case 'V':
+ case 'v':
+ return new Color(25, 245, 215);
+
+ case 'W':
+ case 'w':
+ return new Color(15, 0, 225);
+
+ case 'X':
+ case 'x':
+ return new Color(10, 255, 235);
+
+ case 'Y':
+ case 'y':
+ return new Color(5, 150, 245);
+
+ case 'Z':
+ case 'z':
+ return new Color(0, 80, 255);
+
+ default:
+ Console.info("This is not a interaction : " + lastss);
+ return null;
+
+ }
+ }
+
+ private void fillPolygon(Graphics g, int[] xpoints, int[] ypoints, int n)
+ {
+ setAntialias(g);
+ g.fillPolygon(xpoints, ypoints, n);
+ }
+
+ /*
+ private void fillRect(Graphics g, int a, int b, int c, int d)
+ {
+ fillRect(g, false, a, b, c, d);
+ }*/
+
+ private void fillRect(Graphics g, int a, int b, int c, int d)
+ {
+ unsetAntialias(g);
+ g.fillRect(a, b, c, d);
+ }
+
+ private void fillRoundRect(Graphics g, int a, int b, int c, int d, int e,
+ int f)
+ {
+ setAntialias(g);
+ g.fillRoundRect(a, b, c, d, e, f);
+ }
+
+ private void fillArc(Graphics g, int a, int b, int c, int d, int e, int f)
+ {
+ setAntialias(g);
+ g.fillArc(a, b, c, d, e, f);
+ }
+
+ private void drawLine(Graphics g, Stroke s, int a, int b, int c, int d)
+ {
+ Graphics2D g2d = (Graphics2D) g;
+ Stroke p = g2d.getStroke();
+ g2d.setStroke(s);
+ drawLine(g, a, b, c, d);
+ g2d.setStroke(p);
+ }
+
+ private void drawLine(Graphics g, int a, int b, int c, int d)
+ {
+ setAntialias(g);
+ g.drawLine(a, b, c, d);
+ }
+
+ private void setAntialias(Graphics g)
+ {
+ if (isVectorRendering())
+ {
+ // no need to antialias vector drawings
+ return;
+ }
+ if (Cache.getDefault("ANTI_ALIAS", true))
+ {
+ Graphics2D g2d = (Graphics2D) g;
+ g2d.setRenderingHint(RenderingHints.KEY_ANTIALIASING,
+ RenderingHints.VALUE_ANTIALIAS_ON);
+ }
+ }
+
+ private void unsetAntialias(Graphics g)
+ {
+ if (isVectorRendering())
+ {
+ // no need to antialias vector drawings
+ return;
+ }
+ Graphics2D g2d = (Graphics2D) g;
+ g2d.setRenderingHint(RenderingHints.KEY_ANTIALIASING,
+ RenderingHints.VALUE_ANTIALIAS_OFF);
+ }
+
+ public void setVectorRendering(boolean b)
+ {
+ renderingVectors = b;
+ }
+
+ public boolean isVectorRendering()
+ {
+ return renderingVectors;
+ }
+}